Feedback

L-cysteate

PropertiesImageOccurences in reactions
MNX_IDMNXM713Image of MNXM713
#reac
in my sandbox 0
in MNXref (generic)18
in models (compartimentalized) 15
formulaC3H6NO5S
charge-1
mass168.14948
referencechebi:58090
InChIKeyXVOYSCVBGLVSOL-REOHCLBHSA-M
InChIInChI=1S/C3H7NO5S/c4-2(3(5)6)1-10(7,8)9/h2H,1,4H2,(H,5,6)(H,7,8,9)/p-1/t2-/m0/s1
SMILES[NH3+][C@@H](CS([O-])(=O)=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58090
chebi:58090
L-cysteate
(2R)-2-ammonio-3-sulfonatopropanoate
(2R)-2-azaniumyl-3-sulfonatopropanoate
L-cysteate anion
L-cysteate(1-)
bigg.metabolite:Lcyst
biggM:Lcyst
L-Cysteate
seed.compound:cpd00395
seedM:cpd00395
L-Cysteate
(2R)-2-amino-3-sulfopropanoic acid
(R)-cysteate
2-Amino-3-sulfopropionic acid
2-amino-3-sulfopropionic acid
3-Sulfoalanine
3-sulfo-L-alanine
3-sulfoalanine
L-Cysteic acid
L-cysteate
L-cysteic acid
Lcyst
sabiork.compound:2064
sabiorkM:2064
kegg.compound:C00506
keggC:C00506
L-Cysteate
2-Amino-3-sulfopropionic acid
3-Sulfoalanine
L-Cysteic acid
metacyc.compound:L-CYSTEATE
metacycM:L-CYSTEATE
L-cysteate
(2R)-2-amino-3-sulfopropanoic acid
(R)-cysteate
2-amino-3-sulfopropionic acid
3-sulfo-L-alanine
3-sulfoalanine
L-cysteic acid
CHEBI:17285
chebi:17285
L-cysteic acid
(2R)-2-amino-3-sulfopropanoic acid
2-Amino-3-sulfopropionic acid
3-Sulfoalanine
3-sulfo-L-alanine
CYSTEINESULFONIC ACID
L-Cysteate
L-Cysteic acid
chebi:13094
chebi:44466
chebi:44513
chebi:44590
chebi:44708
chebi:6206
biggM:M_Lcyst
keggC:M_C00506
seedM:M_cpd00395
secondary/obsolete/fantasy identifier