Feedback

L-cysteate

Properties
MNX_IDMNXM713
formulaC3H6NO5S
charge-1
mass168.14948
referencechebi:58090
Image of MNXM713
InChIKeyXVOYSCVBGLVSOL-REOHCLBHSA-M
InChIInChI=1S/C3H7NO5S/c4-2(3(5)6)1-10(7,8)9/h2H,1,4H2,(H,5,6)(H,7,8,9)/p-1/t2-/m0/s1
SMILES[NH3+][C@@H](CS([O-])(=O)=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref18
Distinct compatimentalized reactions in models15

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd00395 L-Cysteate
(2R)-2-amino-3-sulfopropanoic acid
(R)-cysteate
2-Amino-3-sulfopropionic acid
2-amino-3-sulfopropionic acid
3-Sulfoalanine
3-sulfo-L-alanine
3-sulfoalanine
L-Cysteic acid
L-cysteate
L-cysteic acid
Lcyst
keggC:C00506
sabiorkM:2064
L-Cysteate
2-Amino-3-sulfopropionic acid
3-Sulfoalanine
L-Cysteic acid
chebi:58090 L-cysteate
(2R)-2-ammonio-3-sulfonatopropanoate
(2R)-2-azaniumyl-3-sulfonatopropanoate
L-cysteate anion
L-cysteate(1-)
biggM:M_Lcyst
chebi:13094
chebi:44466
chebi:44513
chebi:44590
chebi:44708
chebi:6206
keggC:M_C00506
seedM:M_cpd00395
secondary/obsolete/fantasy identifier
chebi:17285 L-cysteic acid
(2R)-2-amino-3-sulfopropanoic acid
2-Amino-3-sulfopropionic acid
3-Sulfoalanine
3-sulfo-L-alanine
CYSTEINESULFONIC ACID
L-Cysteate
L-Cysteic acid
biggM:Lcyst L-Cysteate
metacycM:L-CYSTEATE L-cysteate
(2R)-2-amino-3-sulfopropanoic acid
(R)-cysteate
2-amino-3-sulfopropionic acid
3-sulfo-L-alanine
3-sulfoalanine
L-cysteic acid