Feedback

3-oxoadipate

PropertiesImageOccurences in reactions
MNX_IDMNXM716Image of MNXM716
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 7
formulaC6H6O5
charge-2
mass158.10884
referencechebi:15775
InChIKeyRTGHRDFWYQHVFW-UHFFFAOYSA-L
InChIInChI=1S/C6H8O5/c7-4(3-6(10)11)1-2-5(8)9/h1-3H2,(H,8,9)(H,10,11)/p-2
SMILES[O-]C(=O)CCC(=O)CC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:15775
chebi:15775
3-oxoadipate
3-Keto-adipate
3-Oxoadipate
3-oxoadipate(2-)
3-oxohexanedioate
bigg.metabolite:3oxoadp
biggM:3oxoadp
envipath:...36e7c3d90c64
envipathM:...36e7c3d90c64
3-Oxoadipate
sabiork.compound:5272
sabiorkM:5272
kegg.compound:C00846
keggC:C00846
3-Oxoadipate
3-Keto-adipate
3-Oxoadipic acid
seed.compound:cpd00630
seedM:cpd00630
3-Oxoadipate
3-Keto-adipate
3-Oxoadipic acid
3-ketoadipate
3-oxoadipate
3oxadp
beta-ketoadipate
hmdb:HMDB0000398 3-Oxoadipic acid
3-Ketoadipate
3-Ketoadipic
3-Ketoadipic acid
3-Oxoadipate
3-Oxoadipic acid, disodium salt
3-Oxohexanedioate
3-Oxohexanedioic acid
3-keto-Adipate
3-keto-Adipic acid
3-oxoadipic acid
3-oxohexanedioic acid
b-Ketoadipate
b-Ketoadipic acid
b-Oxoadipate
b-Oxoadipic acid
beta-Ketoadipate
beta-Ketoadipic acid
beta-Oxoadipate
beta-Oxoadipic acid
beta-ketoadipate
beta-ketoadipic acid
beta-oxoadipate
beta-oxoadipic acid
lipidmaps:LMFA01170096
lipidmapsM:LMFA01170096
3-oxo-adipic acid
3-oxo-hexanedioic acid
metacyc.compound:3-KETO-ADIPATE
metacycM:3-KETO-ADIPATE
3-oxoadipate
3-ketoadipate
beta-ketoadipate
CHEBI:37440
chebi:37440
3-oxoadipic acid
3-Keto-adipate
3-Oxoadipic acid
3-oxohexanedioic acid
beta-Ketoadipic acid
beta-Oxoadipic acid
envipath:...7be29db0cf20
envipathM:...7be29db0cf20
compound 42285
hmdb:HMDB00398
chebi:11870
chebi:1631
chebi:20162
biggM:M_3oxoadp
keggC:M_C00846
seedM:M_cpd00630
secondary/obsolete/fantasy identifier