Feedback

 

3-oxoadipate

Image of MNXM716
Properties
MNX_IDMNXM716
formulaC6H6O5
charge-2
mass158.1099
referencechebi:15775
InChIKeyRTGHRDFWYQHVFW-UHFFFAOYSA-L
InChIInChI=1S/C6H8O5/c7-4(3-6(10)11)1-2-5(8)9/h1-3H2,(H,8,9)(H,10,11)/p-2
SMILES[O-]C(=O)CCC(=O)CC([O-])=O

This chemical compound does not exist in my selection



Occurrences of 3-oxoadipate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3oxoadp
envipath:...36e7c3d90c64
3-Oxoadipate
chebi:11870
chebi:15775
chebi:1631
chebi:20162
3-Keto-adipate
3-Oxoadipate
3-oxoadipate
3-oxoadipate(2-)
3-oxohexanedioate
RTGHRDFWYQHVFW-UHFFFAOYSA-L
chebi:37440 3-Keto-adipate
3-Oxoadipic acid
3-oxoadipic acid
3-oxohexanedioic acid
RTGHRDFWYQHVFW-UHFFFAOYSA-N
beta-Ketoadipic acid
beta-Oxoadipic acid
envipath:...7be29db0cf20 compound 42285
hmdb:HMDB00398 3-Oxoadipic acid
3-oxoadipic acid
3-oxohexanedioic acid
lipidmaps:LMFA01170096 3-oxo-adipic acid
3-oxo-hexanedioic acid
lipidmaps:LMFA01170096
metacyc:3-KETO-ADIPATE 3-KETO-ADIPATE
3-ketoadipate
3-oxoadipate
beta-ketoadipate
kegg:C00846
sabiork:5272
3-Keto-adipate
3-Oxoadipate
3-Oxoadipic acid
seed:cpd00630 3-Keto-adipate
3-Oxoadipate
3-Oxoadipic acid
3-ketoadipate
3oxadp
deprecated:MNXM724244