Feedback

hypotaurine

PropertiesImageOccurences in reactions
MNX_IDMNXM726Image of MNXM726
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 14
formulaC2H7NO2S
charge0
mass109.01975
referencechebi:57853
InChIKeyVVIUBCNYACGLLV-UHFFFAOYSA-N
InChIInChI=1S/C2H7NO2S/c3-1-2-6(4)5/h1-3H2,(H,4,5)
SMILES[NH3+]CCS(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57853
chebi:57853
hypotaurine
2-ammonioethanesulfinate
2-azaniumylethane-1-sulfinate
2-azaniumylethanesulfinate
2-mmonioethane-1-sulfinate
hypotaurine zwitterion
hmdb:HMDB0000965 Hypotaurine
2-Amino-ethanesulfinate
2-Amino-ethanesulfinic acid
2-Aminoethanesulfinate
2-Aminoethanesulfinic acid
2-Aminoethanesulphinate
2-Aminoethanesulphinic acid
2-Aminoethylsulfinate
2-Aminoethylsulfinic acid
2-aminoethane-1-sulfinic acid
Cystaminesulfinate
Cystaminesulfinic acid
hypotaurine
bigg.metabolite:hyptaur
biggM:hyptaur
sabiork.compound:5127
sabiorkM:5127
kegg.compound:C00519
keggC:C00519
Hypotaurine
2-Aminoethanesulfinic acid
seed.compound:cpd00406
seedM:cpd00406
Hypotaurine
2-Aminoethanesulfinic acid
Ethanesulfinic acid, 2-amino-
hypotaurine
CHEBI:140741
chebi:140741
hypotaurine(1-)
2-aminoethanesulfinate
reactome:R-ALL-1655445
reactomeM:R-ALL-1655445
CHEBI:16668
chebi:16668
hypotaurine
2-Aminoethanesulfinic acid
2-aminoethanesulfinic acid
Hypotaurine
metacyc.compound:HYPOTAURINE
metacycM:HYPOTAURINE
hypotaurine
Ethanesulfinic acid, 2-amino-
hmdb:HMDB00965
chebi:14429
chebi:24760
chebi:5839
biggM:M_hyptaur
keggC:M_C00519
seedM:M_cpd00406
secondary/obsolete/fantasy identifier