Search MNXref
 Feedback

(S)-3-phenyllactate

PropertiesImage
MNX_IDMNXM726663 Image of MNXM726663
referencechebi:32979
formulaC9H9O3
global charge-1
mol weight165.168
InChIKeyVOXXWSYKYCBWHO-QMMMGPOBSA-M
InChIInChI=1S/C9H10O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/p-1/t8-/m0/s1
SMILESO=C([O-])[C@@H](O)CC1=CC=CC=C1
MNX internals
InChI (mnx)InChI=1/C9H10O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/t8-/m0/s1 Image of MNXM726663
SMILES (mnx)[CH:1]1=[CH:2][CH:4]=[C:7]([CH2:6][C@@H:8]([C:9](=[O:11])[OH:12])[OH:10])[CH:5]=[CH:3]1
Parent-child relations graph
Occurences in reactions#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
Similar chemical compounds in external resources
IdentifierDescription

CHEBI:32979
chebi:32979
VOXXWSYKYCBWHO-QMMMGPOBSA-M
(S)-3-phenyllactate
(2S)-2-hydroxy-3-phenylpropanoate

CHEBI:43065
chebi:43065
VOXXWSYKYCBWHO-QMMMGPOBSA-N
(S)-3-phenyllactic acid
(2S)-2-hydroxy-3-phenylpropanoic acid
ALPHA-HYDROXY-BETA-PHENYL-PROPIONIC ACID
L-(-)-3-phenyllactic acid
L-3-phenyllactic acid
L-beta-phenyllactic acid
hmdb:HMDB0000563
VOXXWSYKYCBWHO-QMMMGPOBSA-N
D-Phenyllactic acid
(+)-2-Hydroxy-3-phenylpropionate
(+)-2-Hydroxy-3-phenylpropionic acid
(+)-3-Phenyllactate
(+)-3-Phenyllactic acid
(+)-b-Phenyllactate
(+)-b-Phenyllactic acid
(+)-beta-Phenyllactate
(+)-beta-Phenyllactic acid
(2R)-2-Hydroxy-2-phenylpropanoate
(2R)-2-Hydroxy-2-phenylpropanoic acid
(2R)-2-Hydroxy-2-phenylpropionate
(2R)-2-Hydroxy-2-phenylpropionic acid
(2S)-2-hydroxy-3-phenylpropanoic acid
(R)-2-Hydroxy-2-phenylpropionate
(R)-2-Hydroxy-2-phenylpropionic acid
(R)-2-Phenyl-2-hydroxypropanoate
(R)-2-Phenyl-2-hydroxypropanoic acid
(R)-3-Phenyl-lactate
(R)-3-Phenyl-lactic acid
(R)-3-Phenyllactate
(R)-3-Phenyllactic acid
(R)-Phenyllactate
(R)-Phenyllactic acid
(R)-a-Hydroxy-3-phenylpropionate
(R)-a-Hydroxy-3-phenylpropionic acid
(R)-a-Hydroxy-benzenepropanoate
(R)-a-Hydroxy-benzenepropanoic acid
(R)-alpha-Hydroxy-3-phenylpropionate
(R)-alpha-Hydroxy-3-phenylpropionic acid
(R)-alpha-Hydroxy-benzenepropanoate
(R)-alpha-Hydroxy-benzenepropanoic acid
(R)-b-Phenyllactate
(R)-b-Phenyllactic acid
(R)-beta-Phenyllactate
(R)-beta-Phenyllactic acid
(S)-3-Phenyllactate
ALPHA-HYDROXY-BETA-phenyl-propionIC ACID
D-2-Hydroxy-3-phenylpropionate
D-2-Hydroxy-3-phenylpropionic acid
D-3-Phenyllactate
D-3-Phenyllactic acid
D-Phenyllactate
D-b-Phenyllactate
D-b-Phenyllactic acid
L-(-)-3-Phenyllactate
L-(-)-3-Phenyllactic acid
L-3-Phenyllactate
L-3-Phenyllactic acid
L-3-phenyllactic acid
L-b-Phenyllactate
L-b-Phenyllactic acid
L-beta-Phenyllactate
L-beta-Phenyllactic acid
L-beta-phenyllactate
L-beta-phenyllactic acid
a-HYDROXY-b-phenyl-propionate
a-HYDROXY-b-phenyl-propionic acid
alpha-HYDROXY-beta-phenyl-propionate
alpha-hydroxy-beta-phenyl-propionate
alpha-hydroxy-beta-phenyl-propionic acid
b-Phenyl-D-lactate
b-Phenyl-D-lactic acid
beta-Phenyl-delta-lactate
beta-Phenyl-delta-lactic acid
delta-2-Hydroxy-3-phenylpropionate
delta-2-Hydroxy-3-phenylpropionic acid
delta-3-Phenyllactate
delta-3-Phenyllactic acid
delta-Phenyllactate
delta-Phenyllactic acid
delta-beta-Phenyllactate
delta-beta-Phenyllactic acid

sabiork.compound:27754
sabiorkM:27754
VOXXWSYKYCBWHO-QMMMGPOBSA-N
L-Phenyllactate
(2S)-2-Hydroxy-3-phenylpropanoic acid
L-3-Phenyllactic acid
L-beta-Phenyllactic acid

hmdb:HMDB00563
chebi:21211
chebi:43061
secondary/obsolete/fantasy identifier