Feedback

AMP

PropertiesImageOccurences in reactions
MNX_IDMNXM728294Image of MNXM728294
#reac
in my sandbox 0
in MNXref (generic)2031
in models (compartimentalized) 1104
formulaC10H12N5O7P
charge-2
mass345.04853
referencechebi:456215
InChIKeyUDMBCSSLTHHNCD-KQYNXXCUSA-L
InChIInChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/p-2/t4-,6-,7-,10-/m1/s1
SMILESNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:456215
chebi:456215
AMP
5'-O-phosphonatoadenosine
AMP dianion
AMP(2-)
Adenosine-5-monophosphate dianion
Adenosine-5-monophosphate(2-)
adenosine 5'-monophosphate(2-)
bigg.metabolite:amp
biggM:amp
AMP
metacyc.compound:AMP-GROUP
metacycM:AMP-GROUP
AMP group
AMP
adenosine 5'-phosphate group
seed.compound:cpd00018
seedM:cpd00018
AMP
5'-AMP
5'-Adenosine monophosphate
5'-Adenylic acid
5'-adenosine monophosphate
5'-adenylic acid
Adenosine 5'-monophosphate
Adenosine 5'-phosphate
Adenylate
Adenylic acid
adenosine 5'-monophosphate
adenosine 5'-phosphate
adenosine-5'-phosphate
adenosine-monophosphate
adenosine-phosphate
adenylate
adenylic acid
amp
sabiork.compound:1273
sabiorkM:1273
kegg.compound:C00020
keggC:C00020
AMP
5'-AMP
5'-Adenosine monophosphate
5'-Adenylic acid
Adenosine 5'-monophosphate
Adenosine 5'-phosphate
Adenylate
Adenylic acid
metacyc.compound:AMP
metacycM:AMP
AMP
5'-AMP
5'-adenosine monophosphate
5'-adenylic acid
adenosine 5'-monophosphate
adenosine 5'-phosphate
adenosine-monophosphate
adenylate
adenylic acid
hmdb:HMDB0000045 Adenosine monophosphate
2' Adenosine monophosphate
2' Adenylic acid
2'-AMP
2'-Adenosine monophosphate
2'-Adenylic acid
5' Adenylic acid
5'-AMP
5'-Adenosine monophosphate
5'-Adenosine monophosphoric acid
5'-Adenylate
5'-Adenylic acid
5'-O-Phosphonoadenosine
5'-Phosphate, adenosine
AMP
Acid, 2'-adenylic
Acid, 5'-adenylic
Adenosine 2' phosphate
Adenosine 2'-phosphate
Adenosine 3' phosphate
Adenosine 3'-phosphate
Adenosine 5' phosphate
Adenosine 5'-(dihydrogen phosphate)
Adenosine 5'-(dihydrogen phosphoric acid)
Adenosine 5'-monophosphate
Adenosine 5'-monophosphoric acid
Adenosine 5'-phosphate
Adenosine 5'-phosphorate
Adenosine 5'-phosphoric acid
Adenosine monophosphoric acid
Adenosine phosphate
Adenosine phosphate dipotassium
Adenosine phosphate disodium
Adenosine phosphoric acid
Adenosine-5'-monophosphate
Adenosine-5'-monophosphorate
Adenosine-5'-monophosphoric acid
Adenosine-5'p
Adenosine-5-monophosphorate
Adenosine-5-monophosphoric acid
Adenosine-monophosphate
Adenosine-phosphate
Adenosini phosphas
Adenovite
Adenyl
Adenylate
Adenylic acid
Ado5'p
Cardiomone
Dipotassium, adenosine phosphate
Disodium, adenosine phosphate
Fosfato de adenosina
Lycedan
Muscle adenylate
Muscle adenylic acid
My-b-den
My-beta-den
PAdo
Phosaden
Phosphaden
Phosphate d'adenosine
Phosphate dipotassium, adenosine
Phosphate disodium, adenosine
Phosphentaside
Phosphoric acid d'adenosine
adenylate
monoPhosphate, 2'-adenosine
pA
{[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}phosphonic acid
kegg.drug:D02769
keggD:D02769
Adenosine phosphate (USAN/INN)
Adenyl (TN)
CHEBI:40721
chebi:40721
adenosine 5'-monophosphate(1+)
AMP(1+)
N1-PROTONATED ADENOSINE-5'-MONOPHOSPHATE
reactome:R-ALL-109275
reactomeM:R-ALL-109275
reactome:R-ALL-159448
reactomeM:R-ALL-159448
reactome:R-ALL-164121
reactomeM:R-ALL-164121
reactome:R-ALL-2046064
reactomeM:R-ALL-2046064
reactome:R-ALL-389620
reactomeM:R-ALL-389620
reactome:R-ALL-76577
reactomeM:R-ALL-76577
CHEBI:16027
chebi:16027
adenosine 5'-monophosphate
5'-AMP
5'-Adenosine monophosphate
5'-Adenylic acid
5'-O-phosphonoadenosine
5'-adenylic acid
ADENOSINE MONOPHOSPHATE
AMP
Adenosine 5'-monophosphate
Adenosine 5'-phosphate
Adenosine-5'-monophosphoric acid
Adenylate
Adenylic acid
Ado5'P
PAdo
adenosine 5'-(dihydrogen phosphate)
adenosine phosphate
adenosine-5'P
adenosini phosphas
fosfato de adenosina
pA
phosphate d'adenosine
hmdb:HMDB00045
chebi:12056
chebi:13234
chebi:13235
chebi:13736
chebi:13740
chebi:22242
chebi:22245
chebi:2356
chebi:40510
chebi:40726
chebi:40786
chebi:40826
chebi:47222
biggM:M_amp
keggC:M_C00020
keggD:M_D02769
seedM:M_cpd00018
secondary/obsolete/fantasy identifier