Feedback

D-glucono-1,5-lactone

PropertiesImageOccurences in reactions
MNX_IDMNXM728418Image of MNXM728418
#reac
in my sandbox 0
in MNXref (generic)62
in models (compartimentalized) 9
formulaC6H10O6
charge0
mass178.04774
referencechebi:16217
InChIKeyPHOQVHQSTUBQQK-SQOUGZDYSA-N
InChIInChI=1S/C6H10O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-5,7-10H,1H2/t2-,3-,4+,5-/m1/s1
SMILESO=C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16217
chebi:16217
D-glucono-1,5-lactone
(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-one
(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one
1,5-D-gluconolactone
1,5-Gluconolactone
D-Aldonolactone
D-Glucono-1,5-lactone
D-Gluconolactone
D-gluconic acid delta-lactone
D-gluconic acid lactone
D-threo-Aldono-1,5-lactone
Glucarolactone
Gluconic acid lactone
Gluconic lactone
Gluconolactone
delta-D-gluconolactone
delta-Gluconolactone
gluconic delta-lactone
bigg.metabolite:g15lac
biggM:g15lac
D Glucono 1 5 lactone
seed.compound:cpd26808
seedM:cpd26808
D-Aldonolactones
sabiork.compound:6101
sabiorkM:6101
D-Aldonolactone
D-Gluconolactone
kegg.compound:C00198
keggC:C00198
D-Glucono-1,5-lactone
1,5-Gluconolactone
D-Gluconolactone
Gluconic acid lactone
Gluconic lactone
Gluconolactone
delta-Gluconolactone
sabiork.compound:1971
sabiorkM:1971
D-Glucono-1,5-lactone
Gluconic acid lactone
Gluconic lactone
metacyc.compound:GLC-D-LACTONE
metacycM:GLC-D-LACTONE
D-glucono-1,5-lactone
1,5-gluconolactone
3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one
D-glucono-delta-lactone
D-gluconolactone
delta-gluconolactone
gluconic acid lactone
gluconic lactone
glucono-1,5-lactone
glucono-delta-lactone
gluconolactone
kegg.drug:D04332
keggD:D04332
Gluconolactone (USP)
D-Gluconolactone
hmdb:HMDB0000150 Gluconolactone
(3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one
(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-one
1,5-D-Gluconolactone
1,5-Gluconolactone
1,5-delta-Gluconolactone
3,4,5-Trihydroxy-6-hydroxymethyl-tetrahydro-pyran-2-one
D(+)-Gluconic acid gamma-lactone
D-(+)-Gluconic acid D-lactone
D-(+)-Gluconic acid-delta lactone
D-Aldonolactone
D-Gluconate delta-lactone
D-Gluconate lactone
D-Gluconic acid 1,5-lactone
D-Gluconic acid D-lactone
D-Gluconic acid delta-lactone
D-Gluconic acid lactone
D-Gluconic acid-1,5-lactone
D-Gluconic acid-delta-lactone
D-Gluconic delta-lactone
D-Glucono-1,5-lactone
D-Glucono-D-lactone
D-Gluconolactone
D-Threo-aldono-1,5-lactone
D-delta-Gluconolactone
Fujiglucon
GDL (Gluconate)
Glucarolactone
Gluconate lactone
Gluconate, lactone
Gluconic acid lactone
Gluconic delta-lactone
Gluconic lactone
Glucono 1,5-lactone
Glucono delta lactone
Glucono delta-lactone
Glucono gamma-lactone
Gulonic acid gamma-lactone
beta-Glucono-1,5-lactone
delta-(+)-Gluconic acid D-lactone
delta-(+)-Gluconic acid-delta lactone
delta-Aldonolactone
delta-D-Gluconolactone
delta-D-gluconolactone
delta-Gluconic acid 1,5-lactone
delta-Gluconic acid D-lactone
delta-Gluconic acid delta-lactone
delta-Gluconic acid lactone
delta-Gluconic acid-1,5-lactone
delta-Gluconic acid-delta-lactone
delta-Gluconic delta-lactone
delta-Glucono-1,5-lactone
delta-Glucono-delta-lactone
delta-Gluconolactone
delta-delta-Gluconolactone
delta-gluconolactone
gamma-Gluconolactone
gluconolactone
seed.compound:cpd00170
seedM:cpd00170
Gluconolactone
1,5-Gluconolactone
1,5-gluconolactone
3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one
D-Glucono-1,5-lactone
D-Gluconolactone
D-aldonolactone
D-glucono-1,5-lactone
D-glucono-delta-lactone
D-gluconolactone
Gluconic acid lactone
Gluconic lactone
delta-Gluconolactone
delta-gluconolactone
g15lac
gluconic acid lactone
gluconic lactone
glucono-1,5-lactone
glucono-delta-lactone
gluconolactone
CHEBI:74105
chebi:74105
aldono-1,5-lactone
metacyc.compound:D-Aldonolactones
metacycM:D-Aldonolactones
an aldono-1,5-lactone
hmdb:HMDB00150
chebi:12957
chebi:20988
chebi:4159
chebi:43753
biggM:M_g15lac
keggC:M_C00198
keggD:M_D04332
seedM:M_cpd00170
seedM:M_cpd26808
secondary/obsolete/fantasy identifier