Feedback

phosphoenolpyruvate

PropertiesImageOccurences in reactions
MNX_IDMNXM73Image of MNXM73
#reac
in my sandbox 0
in MNXref (generic)194
in models (compartimentalized) 123
formulaC3H2O6P
charge-3
mass165.018141
referencechebi:58702
InChIKeyDTBNBXWJWCWCIK-UHFFFAOYSA-K
InChIInChI=1S/C3H5O6P/c1-2(3(4)5)9-10(6,7)8/h1H2,(H,4,5)(H2,6,7,8)/p-3
SMILES[O-]C(=O)C(=C)OP([O-])([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-29492
reactomeM:R-ALL-29492
reactome:R-ALL-372364
reactomeM:R-ALL-372364
CHEBI:58702
chebi:58702
phosphoenolpyruvate
2-(phosphonoatooxy)prop-2-enoate
phosphonatoenolpyruvate
phosphonatoenolpyruvate(3-)
bigg.metabolite:pep
biggM:pep
Phosphoenolpyruvate
seed.compound:cpd00061
seedM:cpd00061
Phosphoenolpyruvate
2-(phosphooxy)- 2-propenoate
P-enol-pyr
P-enol-pyruvate
PEP
Phosphoenolpyruvic acid
pep
phosphoenolpyruvate
sabiork.compound:32
sabiorkM:32
Phosphoenolpyruvate
2-Phosphoenolpyruvate
PEP
Phosphoenolpyruvic acid
kegg.compound:C00074
keggC:C00074
Phosphoenolpyruvate
PEP
Phosphoenolpyruvic acid
hmdb:HMDB0000263 Phosphoenolpyruvic acid
2-(Phosphonooxy)-2-propenoate
2-(Phosphonooxy)-2-propenoic acid
2-(phosphonooxy)prop-2-enoic acid
2-Hydroxy-acrylic acid dihydrogen phosphate
2-PHOSPHOENOLPYRUVIC ACID
2-PHOSPHOENOLPYRUVate
2-Phosphonooxyprop-2-enoate
2-Phosphonooxyprop-2-enoic acid
P-enol-Pyruvate
PEP
PHOSPHOENOLPYRUVATE
phosphoenolpyruvic acid
CHEBI:18021
chebi:18021
phosphoenolpyruvate
2-(phosphonooxy)-2-propenoate
2-(phosphonooxy)acrylate
2-(phosphonooxy)prop-2-enoate
2-hydroxy-2-propenoate (dihydrogen phosphate) (ester)
2-hydroxy-2-propenoate phosphate (ester)
O-phosphono-enol-pyruvate
PEP
PHOSPHOENOLPYRUVATE
Phosphoenolpyruvate
phosphoenolpyruvate(1-)
metacyc.compound:PHOSPHO-ENOL-PYRUVATE
metacycM:PHOSPHO-ENOL-PYRUVATE
phosphoenolpyruvate
2-(phosphooxy)- 2-propenoate
PEP
CHEBI:44897
chebi:44897
phosphoenolpyruvic acid
2-(phosphonooxy)-2-propenoic acid
2-(phosphonooxy)prop-2-enoic acid
2-PHOSPHOENOLPYRUVIC ACID
PEP
PHOSPHOENOLPYRUVATE
Phosphoenolpyruvic acid
hmdb:HMDB00263
chebi:14812
chebi:26054
chebi:26055
chebi:44894
chebi:8147
biggM:M_pep
keggC:M_C00074
seedM:M_cpd00061
secondary/obsolete/fantasy identifier