Feedback

N-acetyl-L-glutamate

PropertiesImageOccurences in reactions
MNX_IDMNXM730Image of MNXM730
#reac
in my sandbox 0
in MNXref (generic)13
in models (compartimentalized) 19
formulaC7H9NO5
charge-2
mass187.1501
referencechebi:44337
InChIKeyRFMMMVDNIPUKGG-YFKPBYRVSA-L
InChIInChI=1S/C7H11NO5/c1-4(9)8-5(7(12)13)2-3-6(10)11/h5H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13)/p-2/t5-/m0/s1
SMILESCC(=O)N[C@@H](CCC([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:44337
chebi:44337
N-acetyl-L-glutamate
(2S)-2-acetamidopentanedioate
(S)-2-(acetylamino)pentanedioate
N-Acetyl-L-glutamate
N-acetyl-L-glutamate(2-)
NAG
acetyl-L-glutamate
bigg.metabolite:acglu
biggM:acglu
N-Acetyl-L-glutamate
sabiork.compound:2120
sabiorkM:2120
kegg.compound:C00624
keggC:C00624
N-Acetyl-L-glutamate
N-Acetyl-L-glutamic acid
seed.compound:cpd00477
seedM:cpd00477
N-Acetyl-L-glutamate
N-Acetyl-L-glutamic acid
N-acetyl-L-glutamate
N-acetyl-L-glutamic acid
NAG
acetyl-L-glu
acetyl-L-glutamate
acglu
CHEBI:21549
chebi:21549
N-acetyl-L-glutamate(1-)
(2S)-2-(acetylammonio)pentanedioate
metacyc.compound:ACETYL-GLU
metacycM:ACETYL-GLU
N-acetyl-L-glutamate
N-acetyl-L-glutamic acid
NAG
acetyl-L-glu
acetyl-L-glutamate
reactome:R-ALL-30471
reactomeM:R-ALL-30471
CHEBI:17533
chebi:17533
N-acetyl-L-glutamic acid
(2S)-2-acetamidopentanedioic acid
(S)-2-(acetylamino)pentanedioic acid
Ac-Glu-OH
Acetyl-L-glutamic acid
Acetylglutamic acid
L-N-acetylglutamic acid
N-ACETYL-L-GLUTAMATE
N-Ac-Glu-OH
N-Acetyl-L-glutamic acid
N-Acetylglutamic acid
acetylglutamic acid
chebi:12575
chebi:21552
chebi:44335
chebi:64040
chebi:7150
chebi:87274
biggM:M_acglu
keggC:M_C00624
seedM:M_cpd00477
secondary/obsolete/fantasy identifier