Feedback

(9Z)-tetradecenoate

Properties
MNX_IDMNXM731700
formulaC14H25O2
charge-1
mass225.3471
referencechebi:32370
Image of MNXM731700
InChIKeyYWWVWXASSLXJHU-WAYWQWQTSA-M
InChIInChI=1S/C14H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h5-6H,2-4,7-13H2,1H3,(H,15,16)/p-1/b6-5-
SMILESCCCC\C=C/CCCCCCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref37
Distinct compatimentalized reactions in models34

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd05237 Myristoleic acid
(9Z)-Tetradecenoic acid
(9Z)-tetradec-9-enoate
(Z)-Tetradec-9-enoic acid
9-Tetradecenoic acid
myristoleate
keggC:C08322 Myristoleic acid
(9Z)-Tetradecenoic acid
(Z)-Tetradec-9-enoic acid
9-Tetradecenoic acid
lipidmaps:LMFA01030051 Myristoleic acid
9Z-tetradecenoic acid
C14:1n-5
FA(14:1)
cis-9-tetradecenoic acid
chebi:32370 (9Z)-tetradecenoate
(14:1n5)
(9Z)-tetradec-9-enoate
(Z)-tetradec-9-enoate
9-tetradecenoate
9Z-tetradecenoate
cis-9-tetradecenoate
cis-Delta(9)-tetradecenoate
myristoleate
slm:000000856 (9Z)-tetradecenoate
Myristoleate
biggM:M_ttdcea
chebi:25454
chebi:7058
hmdb:HMDB02000
keggC:M_C08322
seedM:M_cpd05237
secondary/obsolete/fantasy identifier
chebi:27781 myristoleic acid
(9Z)-Tetradecenoic acid
(9Z)-tetradec-9-enoic acid
(Z)-Tetradec-9-enoic acid
9-Tetradecenoic acid
9Z-tetradecenoic acid
Myristoleic acid
cis-9-tetradecenoic acid
cis-Delta(9)-tetradecenoic acid
cis-tetradec-9-enoic acid
metacycM:CPD-20392 myristoleate
(9Z)-tetradec-9-enoate
biggM:ttdcea Tetradecenoate (n-C14:1)
hmdb:HMDB0002000 Myristoleic acid
(9Z)-Tetradec-9-enoate
(9Z)-Tetradec-9-enoic acid
(9Z)-Tetradecenoate
(9Z)-Tetradecenoic acid
(9Z)-tetradec-9-enoic acid
(Z)-Tetradec-9-enoate
(Z)-Tetradec-9-enoic acid
9-Tetradecenoate
9-Tetradecenoic acid
9Z-Tetradecenoate
9Z-Tetradecenoic acid
Myristoleate
cis-9-Tetradecenoate
cis-9-Tetradecenoic acid
cis-Delta(9)-Tetradecenoic acid
cis-Tetradec-9-enoate
cis-Tetradec-9-enoic acid
cis-delta(9)-Tetradecenoate
cis-delta(9)-tetradecenoate
cis-delta(9)-tetradecenoic acid
myristoleic acid
MNXM173931is deprecated and replaced by MNXM731699 ((9E)-tetradecenoic acid)
MNXM173931is deprecated and replaced by this entry
MNXM29787is deprecated and replaced by MNXM173931
MNXM62836is deprecated and replaced by MNXM731699 ((9E)-tetradecenoic acid)
MNXM62836is deprecated and replaced by this entry
MNXM641is deprecated and replaced by MNXM731699 ((9E)-tetradecenoic acid)
MNXM641is deprecated and replaced by this entry
MNXM95346is deprecated and replaced by MNXM62836