Feedback

(R)-lactate

PropertiesImageOccurences in reactions
MNX_IDMNXM731834Image of MNXM731834
#reac
in my sandbox 0
in MNXref (generic)88
in models (compartimentalized) 37
formulaC3H5O3
charge-1
mass89.02442
referencechebi:16004
InChIKeyJVTAAEKCZFNVCJ-UWTATZPHSA-M
InChIInChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/p-1/t2-/m1/s1
SMILESC[C@@H](O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16004
chebi:16004
(R)-lactate
(2R)-2-hydroxypropanoate
D-2-hydroxypropanoate
D-2-hydroxypropionate
D-lactate
kegg.compound:C00256
keggC:C00256
(R)-Lactate
D-2-Hydroxypropanoic acid
D-2-Hydroxypropionic acid
D-Lactate
D-Lactic acid
metacyc.compound:D-LACTATE
metacycM:D-LACTATE
(R)-lactate
(R)-2-hydroxypropanate
(R)-lactic acid
D-lactate
D-lactic acid
CHEBI:42111
chebi:42111
(R)-lactic acid
(-)-lactic acid
(2R)-2-hydroxypropanoic acid
(R)-(-)-lactic acid
D-2-Hydroxypropanoic acid
D-2-Hydroxypropionic acid
D-Lactic acid
D-Milchsaeure
D-lactic acid
LACTIC ACID
bigg.metabolite:lac__D
biggM:lac__D
D-Lactate
seed.compound:cpd00221
seedM:cpd00221
D-Lactate
(R)-2-hydroxypropanate
(R)-Lactate
(R)-lactate
D-2-Hydroxypropanoic acid
D-2-Hydroxypropionic acid
D-Lactic acid
D-lactate
lac-D
sabiork.compound:1997
sabiorkM:1997
D-Lactate
(R)-Lactate
D-2-Hydroxypropanoic acid
D-2-Hydroxypropionic acid
D-Lactic acid
hmdb:HMDB0001311 D-Lactic acid
(-)-Lactate
(-)-Lactic acid
(2R)-2-hydroxypropanoic acid
(R)-(-)-Lactate
(R)-(-)-Lactic acid
(R)-2-Hydroxypropanoate
(R)-2-Hydroxypropanoic acid
(R)-2-Hydroxypropionate
(R)-2-Hydroxypropionic acid
(R)-Lactate
(R)-Lactic acid
(R)-a-Hydroxypropionate
(R)-a-Hydroxypropionic acid
(R)-alpha-Hydroxypropionate
(R)-alpha-Hydroxypropionic acid
2 Hydroxypropanoic acid
2 Hydroxypropionic acid
2-Hydroxypropanoic acid
2-Hydroxypropionic acid
Ammonium lactate
D Lactic acid
D-(-)-Lactate
D-(-)-Lactic acid
D-2-Hydroxypropanoate
D-2-Hydroxypropanoic acid
D-2-Hydroxypropionate
D-2-Hydroxypropionic acid
D-Lactate
D-Milchsaeure
D-lactic acid
DLA
L Lactic acid
L-(+)-Lactate
L-Lactate
L-Lactic acid
LACTIC ACID
LACTate
Lactate, ammonium
Propel
Sarcolactic acid
Tisulac
delta-(-)-Lactate
delta-(-)-Lactic acid
delta-2-Hydroxypropanoate
delta-2-Hydroxypropanoic acid
delta-2-Hydroxypropionate
delta-2-Hydroxypropionic acid
delta-Lactate
delta-Lactic acid
hmdb:HMDB0000190 L-Lactic acid
(+)-Lactate
(+)-Lactic acid
(2S)-2-hydroxypropanoic acid
(S)-(+)-2-Hydroxypropanoate
(S)-(+)-2-Hydroxypropanoic acid
(S)-(+)-Lactate
(S)-(+)-Lactic acid
(S)-2-Hydroxy-propanoate
(S)-2-Hydroxy-propanoic acid
(S)-2-Hydroxypropanoate
(S)-2-Hydroxypropanoic acid
(S)-2-Hydroxypropionate
(S)-2-Hydroxypropionic acid
(S)-Lactate
(S)-Lactic acid
(alpha)-Lactate
(alpha)-Lactic acid
(alpha)-lactate
1-Hydroxyethane 1-carboxylate
1-Hydroxyethane 1-carboxylic acid
1-Hydroxyethanecarboxylate
1-Hydroxyethanecarboxylic acid
2 Hydroxypropanoic acid
2 Hydroxypropionic acid
2-Hydroxypropanoate
2-Hydroxypropanoic acid
2-Hydroxypropionate
2-Hydroxypropionic acid
Ammonium lactate
D Lactic acid
D-Lactate
D-Lactic acid
L Lactic acid
L-(+)- Lactic acid
L-(+)-Lactate
L-(+)-Lactic acid
L-(+)-a-Hydroxypropionate
L-(+)-a-Hydroxypropionic acid
L-(+)-alpha-Hydroxypropionate
L-(+)-alpha-Hydroxypropionic acid
L-(+)-alpha-hydroxypropionate
L-(+)-alpha-hydroxypropionic acid
L-2-Hydroxypropanoate
L-2-Hydroxypropanoic acid
L-Lactate
L-Milchsaeure
Lactate
Lactate, ammonium
Lactic acid
Milk acid
Sarcolactic acid
a-Hydroxypropanoate
a-Hydroxypropanoic acid
a-Hydroxypropionate
a-Hydroxypropionic acid
alpha-Hydroxypropanoate
alpha-Hydroxypropanoic acid
alpha-Hydroxypropionate
alpha-Hydroxypropionic acid
sabiork.compound:2284
sabiorkM:2284
Lactate
2-Hydroxypropanoic acid
2-Hydroxypropionic acid
Lactic acid
biggM:lac-D
hmdb:HMDB0000171
hmdb:HMDB0003328
hmdb:HMDB00171
hmdb:HMDB00190
hmdb:HMDB0062492
hmdb:HMDB01311
hmdb:HMDB03328
hmdb:HMDB62492
chebi:11001
chebi:18684
chebi:341
chebi:42105
chebi:43701
biggM:M_lac__D
keggC:M_C00256
seedM:M_cpd00221
secondary/obsolete/fantasy identifier