Feedback

(S)-lactate

PropertiesImageOccurences in reactions
MNX_IDMNXM731835Image of MNXM731835
#reac
in my sandbox 0
in MNXref (generic)87
in models (compartimentalized) 75
formulaC3H5O3
charge-1
mass89.02442
referencechebi:16651
InChIKeyJVTAAEKCZFNVCJ-REOHCLBHSA-M
InChIInChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/p-1/t2-/m0/s1
SMILESC[C@H](O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16651
chebi:16651
(S)-lactate
(+)-lactate
(2S)-2-hydroxypropanoate
L(+)-lactate
L-(+)-lactate
L-lactate
kegg.compound:C00186
keggC:C00186
(S)-Lactate
L-Lactate
L-Lactic acid
metacyc.compound:L-LACTATE
metacycM:L-LACTATE
(S)-lactate
(S)-lactic acid
L(+)-lactate
L-lactate
L-lactic acid
reactome:R-ALL-29708
reactomeM:R-ALL-29708
reactome:R-ALL-373863
reactomeM:R-ALL-373863
CHEBI:422
chebi:422
(S)-lactic acid
(+)-lactic acid
(2S)-2-hydroxypropanoic acid
(S)-(+)-lactic acid
(S)-2-hydroxypropanoic acid
(S)-2-hydroxypropionic acid
L-(+)-alpha-hydroxypropionic acid
L-(+)-lactic acid
L-Lactic acid
L-Milchsaeure
bigg.metabolite:lac__L
biggM:lac__L
L-Lactate
seed.compound:cpd00159
seedM:cpd00159
L-Lactate
(S)-Lactate
(S)-lactate
L(+)-lactate
L-Lactic acid
L-lactate
LCTT
lac-L
sabiork.compound:1312
sabiorkM:1312
L-Lactate
(S)-Lactate
L-Lactic acid
biggM:lac-L
chebi:11065
chebi:12411
chebi:18783
biggM:M_lac__L
keggC:M_C00186
seedM:M_cpd00159
secondary/obsolete/fantasy identifier