Feedback

(R)-glycerate

PropertiesImageOccurences in reactions
MNX_IDMNXM732052Image of MNXM732052
#reac
in my sandbox 0
in MNXref (generic)40
in models (compartimentalized) 34
formulaC3H5O4
charge-1
mass105.01933
referencechebi:16659
InChIKeyRBNPOMFGQQGHHO-UWTATZPHSA-M
InChIInChI=1S/C3H6O4/c4-1-2(5)3(6)7/h2,4-5H,1H2,(H,6,7)/p-1/t2-/m1/s1
SMILESO=C([O-])[C@H](O)CO
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16659
chebi:16659
(R)-glycerate
(2R)-2,3-dihydroxypropanoate
(R)-glycerate anion
D-glycerate
alpha,beta-Hydroxypropionate
bigg.metabolite:glyc__R
biggM:glyc__R
(R)-Glycerate
sabiork.compound:1999
sabiorkM:1999
D-Glycerate
(R)-Glycerate
kegg.compound:C00258
keggC:C00258
D-Glycerate
(R)-Glycerate
Glycerate
Glyceric acid
metacyc.compound:GLYCERATE
metacycM:GLYCERATE
D-glycerate
(R)-glycerate
D-glyceric acid
glycerate
CHEBI:32398
chebi:32398
D-glyceric acid
(2R)-2,3-dihydroxypropanoic acid
D-Glyceric acid
D-GroA
Glyceric acid
R-glyceric acid
alpha,beta-Hydroxypropionic acid
seed.compound:cpd00223
seedM:cpd00223
Glycerate
(R)-Glycerate
(R)-glycerate
D-Glycerate
D-glycerate
D-glyceric acid
Glyceric acid
glyc-R
glycerate
sabiork.compound:3917
sabiorkM:3917
Glycerate
Glyceric acid
hmdb:HMDB0000139 Glyceric acid
(2R)-2,3-Dihydroxypropanoic acid
(2R)-2,3-dihydroxypropanoic acid
(R)-2,3-Dihydroxypropanoic acid
(R)-Glycerate
(R)-Glyceric acid
D-2,3-Dihydroxypropanoic acid
D-Glycerate
D-Glyceric acid
D-GroA
Glycerate
R-Glycerate
R-Glyceric acid
a,b-Hydroxypropionate
a,b-Hydroxypropionic acid
alpha,beta-Hydroxypropionate
alpha,beta-Hydroxypropionic acid
glycerate
hmdb:HMDB00139
chebi:10999
chebi:12985
chebi:21027
chebi:21030
chebi:4187
chebi:41990
biggM:M_glyc__R
keggC:M_C00258
seedM:M_cpd00223
secondary/obsolete/fantasy identifier