Feedback

3-methyl-2-oxobutanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM732866Image of MNXM732866
#reac
in my sandbox 0
in MNXref (generic)57
in models (compartimentalized) 38
formulaC5H7O3
charge-1
mass115.04007
referencechebi:11851
InChIKeyQHKABHOOEWYVLI-UHFFFAOYSA-M
InChIInChI=1S/C5H8O3/c1-3(2)4(6)5(7)8/h3H,1-2H3,(H,7,8)/p-1
SMILESCC(C)C(=O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:11851
chebi:11851
3-methyl-2-oxobutanoate
2-Oxo-3-methylbutanoate
2-Oxoisopentanoate
2-Oxoisovalerate
3-methyl-2-oxobutyrate
alpha-keto-isovalerate
bigg.metabolite:3mob
biggM:3mob
3-Methyl-2-oxobutanoate
seed.compound:cpd00123
seedM:cpd00123
3-Methyl-2-oxobutanoate
2-Keto-3-methylbutyric acid
2-Ketovaline
2-Oxo-3-methylbutanoate
2-Oxoisopentanoate
2-Oxoisovalerate
2-keto-3-methylbutyric acid
2-keto-isovalerate
2-ketovaline
2-oxo-3-methylbutanoate
2-oxoisopentanoate
2-oxoisovalerate
3-Methyl-2-oxobutanoic acid
3-Methyl-2-oxobutyric acid
3-methyl-2-oxobutanoate
3-methyl-2-oxobutyrate
3MOB
3mob
alpha-Ketovaline
alpha-keto-isovalerate
alpha-keto-isovaleric acid
alpha-keto-valine
alpha-ketoisopentanoic acid
alpha-ketovaline
alpha-oxoisovalerate
kegg.compound:C00141
keggC:C00141
3-Methyl-2-oxobutanoic acid
2-Keto-3-methylbutyric acid
2-Ketovaline
2-Oxo-3-methylbutanoate
2-Oxoisopentanoate
2-Oxoisovalerate
3-Methyl-2-oxobutanoate
3-Methyl-2-oxobutyric acid
alpha-Ketovaline
lipidmaps:LMFA01020274
lipidmapsM:LMFA01020274
3-methyl-2-oxo-butanoic acid
3-methyl-2-oxo-butanoic acid
FA 5:1
O
metacyc.compound:2-KETO-ISOVALERATE
metacycM:2-KETO-ISOVALERATE
3-methyl-2-oxobutanoate
2-keto-3-methylbutyric acid
2-keto-isovalerate
2-ketovaline
2-oxo-3-methylbutanoate
2-oxoisopentanoate
2-oxoisovalerate
3-methyl-2-oxobutyrate
alpha-keto-isovalerate
alpha-keto-isovaleric acid
alpha-keto-valine
alpha-ketoisopentanoic acid
alpha-ketovaline
alpha-oxoisovalerate
reactome:R-ALL-113584
reactomeM:R-ALL-113584
reactome:R-ALL-70846
reactomeM:R-ALL-70846
CHEBI:16530
chebi:16530
3-methyl-2-oxobutanoic acid
2-Keto-3-methylbutyric acid
2-Ketoisovaleric acid
2-Ketovaline
2-Oxo-3-methylbutanoic acid
2-Oxo-3-methylbutyric acid
2-Oxoisovaleric acid
3-METHYL-2-OXOBUTANOIC ACID
3-Methyl-2-oxobutanoate
3-Methyl-2-oxobutanoic acid
3-Methyl-2-oxobutyric acid
Dimethylpyruvic acid
Isopropylglyoxylic acid
alpha-Ketovaline
alpha-keto-isovaleric acid
alpha-oxo-beta-methylbutyricacid
alpha-oxoisovaleric acid
hmdb:HMDB0000019 alpha-Ketoisovaleric acid
2-Keto-3-methylbutyrate
2-Keto-3-methylbutyric acid
2-Ketoisovalerate
2-Ketoisovaleric acid
2-Ketoisvaleric acid
2-Ketovaline
2-Oxoisopentanoate
2-Oxoisopentanoic acid
2-Oxoisovalerate
2-Oxoisovaleric acid
2-oxo-3-Methyl-butyrate
2-oxo-3-Methylbutanoate
2-oxo-3-Methylbutanoic acid
2-oxo-3-Methylbutyrate
2-oxo-3-Methylbutyric acid
3-Methyl-2-oxo-butanoate
3-Methyl-2-oxo-butanoic acid
3-Methyl-2-oxo-butyrate
3-Methyl-2-oxo-butyric acid
3-Methyl-2-oxobutanoate
3-Methyl-2-oxobutanoic acid
3-Methyl-2-oxobutinoate
3-Methyl-2-oxobutinoic acid
3-Methyl-2-oxobutyrate
3-Methyl-2-oxobutyric acid
3-methyl-2-oxobutanoic acid
Dimethylpyruvate
Dimethylpyruvic acid
Isopropylglyoxylate
Isopropylglyoxylic acid
Ketovaline
a-Keto-b-methylbutyrate
a-Keto-b-methylbutyric acid
a-Keto-isovalerate
a-Keto-isovaleric acid
a-Ketoisovalerate
a-Ketoisovaleric acid
a-Ketovaline
a-Oxoisovalerate
a-Oxoisovaleric acid
a-oxo-b-Methylbutyrate
a-oxo-b-Methylbutyric acid
a-oxo-b-Methylbutyricacid
alpha-Keto-beta-methylbutyrate
alpha-Keto-beta-methylbutyric acid
alpha-Keto-isovalerate
alpha-Keto-isovaleric acid
alpha-Ketoisopentanoic acid
alpha-Ketoisovalerate
alpha-Ketovaline
alpha-Oxoisovalerate
alpha-Oxoisovaleric acid
alpha-keto-isovalerate
alpha-keto-isovaleric acid
alpha-ketoisovalerate
alpha-ketoisovaleric acid
alpha-ketovaline
alpha-oxo-beta-Methylbutyrate
alpha-oxo-beta-Methylbutyric acid
alpha-oxo-beta-Methylbutyricacid
alpha-oxo-beta-methylbutyricacid
alpha-oxoisovalerate
alpha-oxoisovaleric acid
sabiork.compound:1945
sabiorkM:1945
alpha-Ketovaline
2-Keto-3-methylbutyric acid
2-Ketoisovalerate
2-Ketovaline
2-Oxo-3-methylbutanoate
2-Oxoisopentanoate
2-Oxoisovalerate
3-Methyl-2-oxobutanoate
3-Methyl-2-oxobutyric acid
alpha-Ketoisovalerate
envipath:...fa61f1f45f03
envipathM:...fa61f1f45f03
compound 38785
hmdb:HMDB00019
hmdb:HMDB0004260
hmdb:HMDB04260
chebi:1584
chebi:20115
chebi:43714
biggM:M_3mob
keggC:M_C00141
seedM:M_cpd00123
secondary/obsolete/fantasy identifier