Feedback

(2R)-2,3-dihydroxy-3-methylbutanoate

Properties
MNX_IDMNXM734
formulaC5H9O4
charge-1
mass133.12256
referencechebi:49072
Image of MNXM734
InChIKeyJTEYKUFKXGDTEU-VKHMYHEASA-M
InChIInChI=1S/C5H10O4/c1-5(2,9)3(6)4(7)8/h3,6,9H,1-2H3,(H,7,8)/p-1/t3-/m0/s1
SMILESCC(C)(O)[C@@H](O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref9
Distinct compatimentalized reactions in models7

Similar chemical compounds in external resources
IdentifierDescription
biggM:23dhmb (R)-2,3-Dihydroxy-3-methylbutanoate
keggC:C04039
sabiorkM:7034
2,3-Dihydroxy-3-methylbutanoate
2,3-Dihydroxy-isovalerate
2,3-Dihydroxy-isovaleric acid
chebi:15689 2,3-dihydroxy-3-methylbutanoic acid
2,3-Dihydroxy-isovaleric acid
2,3-dihydroxy-3-methylbutyric acid
alpha,beta-Dihydroxyisovaleric acid
envipath:...721f09cbed4c compound 820
chebi:15684 (R)-2,3-dihydroxy-3-methylbutanoic acid
(2R)-2,3-dihydroxy-3-methylbutanoic acid
(R)-2,3-Dihydroxy-isovaleric acid
seedM:cpd19030 (R)-2,3-Dihydroxy-3-methylbutanoate
(2R)-2,3-Dihydroxy-3-methylbutanoate
(2R)-2,3-dihydroxy-3-methylbutanoate
(R)-2,3-Dihydroxy-isovalerate
(R)-2,3-Dihydroxy-isovaleric acid
(R)-2,3-dihydroxy-3-methylbutanoate
(R)-2,3-dihydroxy-isovalerate
seedM:cpd02498 2,3-Dihydroxy-isovalerate
2,3-Dihydroxy-3-methylbutanoate
2,3-Dihydroxy-isovaleric acid
23dhmb
R-2-3-Dihydroxy-3-methylbutanoate
lipidmaps:LMFA01050453 (R)-2,3-Dihydroxy-isovalerate
(2R)-2,3-dihydroxy-3-methylbutanoic acid
FA(5:0(OH2))
chebi:49072 (2R)-2,3-dihydroxy-3-methylbutanoate
(R)-2,3-Dihydroxy-isovalerate
(R)-2,3-dihydroxy-3-methylbutanoate
metacycM:CPD-13357 (2R)-2,3-dihydroxy-3-methylbutanoate
(R)-2,3-dihydroxy-3-methylbutanoate
(R)-2,3-dihydroxy-isovalerate
biggM:M_23dhmb
chebi:10966
chebi:18645
chebi:305
chebi:881
hmdb:HMDB12141
keggC:M_C04039
keggC:M_C04272
seedM:M_cpd02498
seedM:M_cpd19030
seedM:M_cpd26869
secondary/obsolete/fantasy identifier
chebi:11424 2,3-dihydroxy-3-methylbutanoate
2,3-dihydroxyisovalerate
hmdb:HMDB0012141 (R)-2,3-Dihydroxy-isovalerate
(2R)-2,3-Dihydroxy-3-methylbutanoate
(2R)-2,3-Dihydroxy-3-methylbutanoic acid
(2R)-2,3-dihydroxy-3-methylbutanoic acid
(R)-2,3-Dihydroxy-3-methylbutanoate
(R)-2,3-Dihydroxy-3-methylbutanoic acid
(R)-2,3-Dihydroxy-isovaleric acid
(R)-2,3-dihydroxy-isovalerate
seedM:cpd26869 DIOH-ISOVALERATE
keggC:C04272
sabiorkM:7197
(R)-2,3-Dihydroxy-3-methylbutanoate
(2R)-2,3-Dihydroxy-3-methylbutanoate
(R)-2,3-Dihydroxy-isovalerate
(R)-2,3-Dihydroxy-isovaleric acid
MNXM114097is deprecated and replaced by this entry
MNXM724467is deprecated and replaced by this entry
MNXM724607is deprecated and replaced by this entry