Feedback

(2R)-2,3-dihydroxy-3-methylbutanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM734Image of MNXM734
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 8
formulaC5H9O4
charge-1
mass133.05063
referencechebi:49072
InChIKeyJTEYKUFKXGDTEU-VKHMYHEASA-M
InChIInChI=1S/C5H10O4/c1-5(2,9)3(6)4(7)8/h3,6,9H,1-2H3,(H,7,8)/p-1/t3-/m0/s1
SMILESCC(C)(O)[C@@H](O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:49072
chebi:49072
(2R)-2,3-dihydroxy-3-methylbutanoate
(R)-2,3-Dihydroxy-isovalerate
(R)-2,3-dihydroxy-3-methylbutanoate
metacyc.compound:CPD-13357
metacycM:CPD-13357
(2R)-2,3-dihydroxy-3-methylbutanoate
(R)-2,3-dihydroxy-3-methylbutanoate
(R)-2,3-dihydroxy-isovalerate
bigg.metabolite:23dhmb
biggM:23dhmb
(R)-2,3-Dihydroxy-3-methylbutanoate
seed.compound:cpd19030
seedM:cpd19030
(R)-2,3-Dihydroxy-3-methylbutanoate
(2R)-2,3-Dihydroxy-3-methylbutanoate
(2R)-2,3-dihydroxy-3-methylbutanoate
(R)-2,3-Dihydroxy-isovalerate
(R)-2,3-Dihydroxy-isovaleric acid
(R)-2,3-dihydroxy-3-methylbutanoate
(R)-2,3-dihydroxy-isovalerate
sabiork.compound:7197
sabiorkM:7197
kegg.compound:C04272
keggC:C04272
(R)-2,3-Dihydroxy-3-methylbutanoate
(2R)-2,3-Dihydroxy-3-methylbutanoate
(R)-2,3-Dihydroxy-isovalerate
(R)-2,3-Dihydroxy-isovaleric acid
hmdb:HMDB0012141 (R)-2,3-Dihydroxy-isovalerate
(2R)-2,3-Dihydroxy-3-methylbutanoate
(2R)-2,3-Dihydroxy-3-methylbutanoic acid
(2R)-2,3-dihydroxy-3-methylbutanoic acid
(R)-2,3-Dihydroxy-3-methylbutanoate
(R)-2,3-Dihydroxy-3-methylbutanoic acid
(R)-2,3-Dihydroxy-isovaleric acid
(R)-2,3-dihydroxy-isovalerate
lipidmaps:LMFA01050453
lipidmapsM:LMFA01050453
(R)-2,3-Dihydroxy-isovalerate
(2R)-2,3-dihydroxy-3-methylbutanoic acid
FA 5:0
O2
CHEBI:15684
chebi:15684
(R)-2,3-dihydroxy-3-methylbutanoic acid
(2R)-2,3-dihydroxy-3-methylbutanoic acid
(R)-2,3-Dihydroxy-isovaleric acid
sabiork.compound:7034
sabiorkM:7034
kegg.compound:C04039
keggC:C04039
2,3-Dihydroxy-3-methylbutanoate
2,3-Dihydroxy-isovalerate
2,3-Dihydroxy-isovaleric acid
seed.compound:cpd02498
seedM:cpd02498
2,3-Dihydroxy-isovalerate
2,3-Dihydroxy-3-methylbutanoate
2,3-Dihydroxy-isovaleric acid
23dhmb
R-2-3-Dihydroxy-3-methylbutanoate
metacyc.compound:DIOH-ISOVALERATE
metacycM:DIOH-ISOVALERATE
2,3-dihydroxy-3-methylbutanoate
2,3-dihydroxy-isovalerate
alpha,beta-dihydroxy-isovalerate
CHEBI:11424
chebi:11424
2,3-dihydroxy-3-methylbutanoate
2,3-dihydroxyisovalerate
CHEBI:15689
chebi:15689
2,3-dihydroxy-3-methylbutanoic acid
2,3-Dihydroxy-isovaleric acid
2,3-dihydroxy-3-methylbutyric acid
alpha,beta-Dihydroxyisovaleric acid
seed.compound:cpd26869
seedM:cpd26869
DIOH-ISOVALERATE
envipath:...721f09cbed4c
envipathM:...721f09cbed4c
compound 820
hmdb:HMDB12141
chebi:10966
chebi:18645
chebi:305
chebi:881
biggM:M_23dhmb
keggC:M_C04039
keggC:M_C04272
seedM:M_cpd02498
seedM:M_cpd19030
seedM:M_cpd26869
secondary/obsolete/fantasy identifier