Feedback

4-hydroxyphenylacetate

Properties
MNX_IDMNXM735208
formulaC8H7O3
charge-1
mass151.13938
referencechebi:48999
Image of MNXM735208
InChIKeyXQXPVVBIMDBYFF-UHFFFAOYSA-M
InChIInChI=1S/C8H8O3/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4,9H,5H2,(H,10,11)/p-1
SMILESOc1ccc(CC([O-])=O)cc1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref15
Distinct compatimentalized reactions in models11

Similar chemical compounds in external resources
IdentifierDescription
biggM:M_4hphac
chebi:12014
chebi:1874
chebi:20419
chebi:40091
hmdb:HMDB00020
keggC:M_C00642
seedM:M_cpd00489
secondary/obsolete/fantasy identifier
chebi:18101 4-hydroxyphenylacetic acid
(4-hydroxyphenyl)acetic acid
(p-hydroxyphenyl)acetic acid
4-Hydroxyphenylacetate
4-Hydroxyphenylacetic acid
4-carboxymethylphenol
4-hydroxybenzeneacetic acid
p-hydroxyphenylacetic acid
keggC:C00642 4-Hydroxyphenylacetate
4-Hydroxyphenylacetic acid
seedM:cpd00489 4-Hydroxyphenylacetate
(4-hydroxyphenyl)acetate
4-HPA
4-Hydroxyphenylacetic acid
4-hydroxyphenyl acetate
4-hydroxyphenylacetate
4-hydroxyphenylacetic acid
4hphac
DL-para-hydroxyphenylacetic acid
benzeneacetic acid, 4-hydroxy-
p-hydroxyphenylacetate
p-hydroxyphenylacetic acid
metacycM:4-HYDROXYPHENYLACETATE (4-hydroxyphenyl)acetate
4-HPA
4-hydroxyphenyl acetate
4-hydroxyphenylacetic acid
DL-para-hydroxyphenylacetic acid
benzeneacetic acid, 4-hydroxy-
p-hydroxyphenylacetate
p-hydroxyphenylacetic acid
chebi:48999 4-hydroxyphenylacetate
(4-hydroxyphenyl)acetate
(p-hydroxyphenyl)acetate
2-(4-hydroxyphenyl)ethanoate
4-hydroxybenzeneacetate
envipath:...d167cc692982 compound 38564
biggM:4hphac
envipath:...5cd134f03c97
4-Hydroxyphenylacetate
hmdb:HMDB0000020 p-Hydroxyphenylacetic acid
(4-Hydroxy-phenyl)-acetate
(4-Hydroxy-phenyl)-acetic acid
(4-Hydroxy-phenyl)-essigsaeure
(4-Hydroxyphenyl)acetate
(4-Hydroxyphenyl)acetic acid
(P-Hydroxyphenyl)-acetate
(P-Hydroxyphenyl)-acetic acid
(P-Hydroxyphenyl)acetate
(P-Hydroxyphenyl)acetic acid
2-(4-hydroxyphenyl)acetic acid
4-Carboxymethylphenol
4-Hydroxy-benzeneacetate
4-Hydroxy-benzeneacetic acid
4-Hydroxybenzeneacetate
4-Hydroxybenzeneacetic acid
4-Hydroxyphenyl-acetic acid
4-Hydroxyphenylacetate
4-Hydroxyphenylacetic acid
4-hydroxyphenylacetic acid
P-Hydroxyphenylacetate
Para-hydroxyphenylacetic acid
Parahydroxy phenylacetate
Parahydroxy phenylacetic acid
Parahydroxyphenylacetate
MNXM3863is deprecated and replaced by MNXM735207 (4-acetoxyphenol)
MNXM3863is deprecated and replaced by this entry
MNXM3863is deprecated and replaced by MNXM735209 (4 Hydroxyphenylacetic acid)
MNXM485is deprecated and replaced by MNXM735207 (4-acetoxyphenol)
MNXM485is deprecated and replaced by this entry
MNXM485is deprecated and replaced by MNXM735209 (4 Hydroxyphenylacetic acid)