Feedback

3-dehydro-L-gulonate

PropertiesImageOccurences in reactions
MNX_IDMNXM736Image of MNXM736
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 5
formulaC6H9O7
charge-1
mass193.13146
referencechebi:57655
InChIKeyWTAHRPBPWHCMHW-LWKDLAHASA-M
InChIInChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-3,5,7-9,11H,1H2,(H,12,13)/p-1/t2-,3+,5-/m0/s1
SMILESOC[C@H](O)[C@@H](O)C(=O)[C@H](O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57655
chebi:57655
3-dehydro-L-gulonate
(2S,4R,5S)-2,4,5,6-tetrahydroxy-3-oxohexanoate
3-dehydro-L-gulonate anion
L-xylo-hex-3-ulosonate
bigg.metabolite:3dhguln
biggM:3dhguln
sabiork.compound:2117
sabiorkM:2117
kegg.compound:C00618
keggC:C00618
3-Dehydro-L-gulonate
hmdb:HMDB0006334 3-Dehydro-L-gulonate
(2S,4R,5S)-2,4,5,6-tetrahydroxy-3-oxohexanoic acid
3-dehydro-L-Gulonic acid
3-dehydro-L-gulonic acid
L-xylo-Hex-3-ulosonic acid
seed.compound:cpd00473
seedM:cpd00473
3-Dehydro-L-gulonate
3-dehydro-L-gulonate
3-keto-L-gulonate
3dhguln
CHEBI:16142
chebi:16142
3-dehydro-L-gulonic acid
3-Dehydro-L-gulonate
3-dehydro-L-gulonate
L-xylo-hex-3-ulosonic acid
metacyc.compound:3-KETO-L-GULONATE
metacycM:3-KETO-L-GULONATE
3-keto-L-gulonate
3-dehydro-L-gulonate
hmdb:HMDB06334
chebi:11777
chebi:1482
chebi:19992
biggM:M_3dhguln
keggC:M_C00618
seedM:M_cpd00473
secondary/obsolete/fantasy identifier