Feedback

3-hydroxybenzoate

Properties
MNX_IDMNXM737
formulaC7H5O3
charge-1
mass137.1128
referencechebi:16193
Image of MNXM737
InChIKeyIJFXRHURBJZNAO-UHFFFAOYSA-M
InChIInChI=1S/C7H6O3/c8-6-3-1-2-5(4-6)7(9)10/h1-4,8H,(H,9,10)/p-1
SMILESOc1cccc(c1)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref17
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
keggC:C00587 3-Hydroxybenzoate
3-Hydroxybenzoic acid
m-Hydroxybenzoic acid
sabiorkM:2108 3-Hydroxybenzoate
m-Hydroxybenzoate
m-Hydroxybenzoic acid
chebi:11828
chebi:1538
chebi:20063
chebi:20064
chebi:39892
hmdb:HMDB02466
keggC:M_C00587
seedM:M_cpd00456
secondary/obsolete/fantasy identifier
chebi:16193 3-hydroxybenzoate
envipath:...bb8b920c2097 3-Hydroxybenzoate
chebi:30764 3-hydroxybenzoic acid
3-HYDROXYBENZOIC ACID
3-Hydroxybenzoic acid
3-carboxyphenol
m-Hydroxybenzoic acid
m-hydroxybenzoic acid
m-salicylic acid
seedM:cpd00456 3-Hydroxybenzoate
3-Hydroxybenzoic acid
3-hydroxybenzoate
3-hydroxybenzoic acid
m-Hydroxybenzoic acid
m-hydroxybenzoate
hmdb:HMDB0002466 3-Hydroxybenzoic acid
3-Carboxyphenol
3-Hydroxy benzoate
3-Hydroxy benzoic acid
3-Hydroxybenzoate
3-Hydroxybenzoic acid, copper (2+) (1:1) salt
3-Hydroxybenzoic acid, monosodium salt
3-hydroxybenzoic acid
Kyselina 3-hydroxybenzoova
Meta-hydroxybenzoate
Meta-hydroxybenzoic acid
Sodium 3-hydroxybenzoic acid
acido m-Idrossibenzoico
m-Hba
m-Hydroxybenzoate
m-Hydroxybenzoic acid
m-Salicylate
m-Salicylic acid
metacycM:3-HYDROXYBENZOATE 3-hydroxybenzoate
3-hydroxybenzoic acid
m-hydroxybenzoate