Feedback

3-hydroxybenzoate

PropertiesImageOccurences in reactions
MNX_IDMNXM737Image of MNXM737
#reac
in my sandbox 0
in MNXref (generic)18
in models (compartimentalized) 0
formulaC7H5O3
charge-1
mass137.1128
referencechebi:16193
InChIKeyIJFXRHURBJZNAO-UHFFFAOYSA-M
InChIInChI=1S/C7H6O3/c8-6-3-1-2-5(4-6)7(9)10/h1-4,8H,(H,9,10)/p-1
SMILESOc1cccc(c1)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16193
chebi:16193
3-hydroxybenzoate
envipath:...bb8b920c2097
envipathM:...bb8b920c2097
3-Hydroxybenzoate
seed.compound:cpd00456
seedM:cpd00456
3-Hydroxybenzoate
3-Hydroxybenzoic acid
3-hydroxybenzoate
3-hydroxybenzoic acid
m-Hydroxybenzoic acid
m-hydroxybenzoate
kegg.compound:C00587
keggC:C00587
3-Hydroxybenzoate
3-Hydroxybenzoic acid
m-Hydroxybenzoic acid
sabiork.compound:2108
sabiorkM:2108
3-Hydroxybenzoate
m-Hydroxybenzoate
m-Hydroxybenzoic acid
hmdb:HMDB0002466 3-Hydroxybenzoic acid
3-Carboxyphenol
3-Hydroxy benzoate
3-Hydroxy benzoic acid
3-Hydroxybenzoate
3-Hydroxybenzoic acid, copper (2+) (1:1) salt
3-Hydroxybenzoic acid, monosodium salt
3-hydroxybenzoic acid
Kyselina 3-hydroxybenzoova
Meta-hydroxybenzoate
Meta-hydroxybenzoic acid
Sodium 3-hydroxybenzoic acid
acido m-Idrossibenzoico
m-Hba
m-Hydroxybenzoate
m-Hydroxybenzoic acid
m-Salicylate
m-Salicylic acid
metacyc.compound:3-HYDROXYBENZOATE
metacycM:3-HYDROXYBENZOATE
3-hydroxybenzoate
3-hydroxybenzoic acid
m-hydroxybenzoate
CHEBI:30764
chebi:30764
3-hydroxybenzoic acid
3-HYDROXYBENZOIC ACID
3-Hydroxybenzoic acid
3-carboxyphenol
m-Hydroxybenzoic acid
m-hydroxybenzoic acid
m-salicylic acid
hmdb:HMDB02466
chebi:11828
chebi:1538
chebi:20063
chebi:20064
chebi:39892
keggC:M_C00587
seedM:M_cpd00456
secondary/obsolete/fantasy identifier