Feedback

3,4-dihydroxy-5-all-trans-decaprenylbenzoate

Properties
MNX_IDMNXM737269
formulaC57H85O4
charge-1
mass834.2824
referencechebi:62793
Image of MNXM737269
InChIKeyHGWUGDIATLOPBN-BHZQGFRMSA-M
InChIInChI=1S/C57H86O4/c1-43(2)21-12-22-44(3)23-13-24-45(4)25-14-26-46(5)27-15-28-47(6)29-16-30-48(7)31-17-32-49(8)33-18-34-50(9)35-19-36-51(10)37-20-38-52(11)39-40-53-41-54(57(60)61)42-55(58)56(53)59/h21,23,25,27,29,31,33,35,37,39,41-42,58-59H,12-20,22,24,26,28,30,32,34,36,38,40H2,1-11H3,(H,60,61)/p-1/b44-23+,45-25+,46-27+,47-29+,48-31+,49-33+,50-35+,51-37+,52-39+
SMILESCC(C)=CCC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CC\C(C)=C\Cc1cc(cc(O)c1O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref3
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
biggM:3dpdhb 3-Decaprenyl-4,5-dihdydroxybenzoate
metacycM:CPD-9895
seedM:cpd25894
3,4-dihydroxy-5-all-trans-decaprenylbenzoate
3-(3,7,11,15,19,23-decamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid
3-decaprenyl-4,5-dihydroxybenzoate
chebi:62793 3,4-dihydroxy-5-all-trans-decaprenylbenzoate
3,4-dihydroxy-5-decaprenylbenzoate
3-(3,7,11,15,19,23,27,31,35,39-decamethyltetracosa-2,6,10,14,18,22,26,30,34,38-decaenyl)-4,5-dihydroxybenzoate
3-[(2E,6E,10E,14E,18E,22E,26E,30E,34EE)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaen-1-yl]-4,5-dihydroxybenzoate
3-decaprenyl-4,5-dihydroxybenzoate
all-trans-3,4-dihydroxy-5-decaprenylbenzoate
all-trans-3-decaprenyl-4,5-dihydroxybenzoate
lipidmaps:LMPR02010034 3-decaprenyl-4,5-dihydroxybenzoic acid
3-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaen-1-yl]-4,5-dihydroxybenzoic acid
hmdb:HMDB0060249 3-Decaprenyl-4,5-dihydroxybenzoate
3,4-Dihydroxy-5-decaprenylbenzoate
3,4-Dihydroxy-5-decaprenylbenzoic acid
3-(3,7,11,15,19,23,27,31,35,39-Decamethyltetracosa-2,6,10,14,18,22,26,30,34,38-decaenyl)-4,5-dihydroxybenzoate
3-(3,7,11,15,19,23,27,31,35,39-Decamethyltetracosa-2,6,10,14,18,22,26,30,34,38-decaenyl)-4,5-dihydroxybenzoic acid
3-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaen-1-yl]-4,5-dihydroxybenzoic acid
all-trans-3,4-Dihydroxy-5-decaprenylbenzoate
all-trans-3,4-Dihydroxy-5-decaprenylbenzoic acid
all-trans-3-Decaprenyl-4,5-dihydroxybenzoate
all-trans-3-Decaprenyl-4,5-dihydroxybenzoic acid
biggM:M_3dpdhb
hmdb:HMDB60249
seedM:M_cpd25894
secondary/obsolete/fantasy identifier
chebi:50775
reactome:R-ALL-2162209
3-decaprenyl-4,5-dihydroxybenzoic acid
3,4-dihydroxy-5-decaprenylbenzoic acid
3-(3,7,11,15,19,23,27,31,35,39-decamethyltetracosa-2,6,10,14,18,22,26,30,34,38-decaenyl)-4,5-dihydroxybenzoic acid
3-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaen-1-yl]-4,5-dihydroxybenzoic acid
all-trans-3,4-dihydroxy-5-decaprenylbenzoic acid
all-trans-3-decaprenyl-4,5-dihydroxybenzoic acid
MNXM114093is deprecated and replaced by MNXM4984
MNXM4984is deprecated and replaced by this entry
MNXM4984is deprecated and replaced by MNXM737270 (3,4-dihydroxy-5-all-trans-decaprenylbenzoate)
MNXM91405is deprecated and replaced by this entry
MNXM91405is deprecated and replaced by MNXM737270 (3,4-dihydroxy-5-all-trans-decaprenylbenzoate)