Feedback

L-serine

Properties
MNX_IDMNXM737787
formulaC3H7NO3
charge0
mass105.09262
referencechebi:33384
Image of MNXM737787
InChIKeyMTCFGRXMJLQNBG-REOHCLBHSA-N
InChIInChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1
SMILES[NH3+][C@@H](CO)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref448
Distinct compatimentalized reactions in models311

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB0000187 L-Serine
(-)-Serine
(2S)-2-amino-3-Hydroxypropanoate
(2S)-2-amino-3-Hydroxypropanoic acid
(2S)-2-amino-3-hydroxypropanoic acid
(S)-(-)-Serine
(S)-2-amino-3-Hydroxy-propanoate
(S)-2-amino-3-Hydroxy-propanoic acid
(S)-2-amino-3-Hydroxypropanoate
(S)-2-amino-3-Hydroxypropanoic acid
(S)-Serine
(S)-a-amino-b-Hydroxypropionate
(S)-a-amino-b-Hydroxypropionic acid
(S)-alpha-amino-beta-Hydroxypropionate
(S)-alpha-amino-beta-Hydroxypropionic acid
(S)-alpha-amino-beta-hydroxypropionate
(S)-alpha-amino-beta-hydroxypropionic acid
(S)-b-amino-3-Hydroxypropionate
(S)-b-amino-3-Hydroxypropionic acid
(S)-beta-amino-3-Hydroxypropionate
(S)-beta-amino-3-Hydroxypropionic acid
2-amino-3-Hydroxypropanoate
2-amino-3-Hydroxypropanoic acid
3-Hydroxy-L-alanine
L Serine
L-(-)-Serine
L-2-amino-3-Hydroxypropionate
L-2-amino-3-Hydroxypropionic acid
L-3-Hydroxy-2-aminopropionate
L-3-Hydroxy-2-aminopropionic acid
L-3-Hydroxy-alanine
L-Ser
L-Serin
L-serine
S
SERINE
Ser
b-Hydroxy-L-alanine
b-Hydroxyalanine
beta-Hydroxy-L-alanine
beta-Hydroxyalanine
beta-hydroxy-L-alanine
beta-hydroxyalanine
metacycM:SER L-serine
L-ser
S
ser
serine
chebi:33384
reactome:R-ALL-200736
reactome:R-ALL-352002
reactome:R-ALL-379732
L-serine
(2S)-2-ammonio-3-hydroxypropanoate
L-serine zwitterion
biggM:ser__L
envipath:...9b99fb380595
L-Serine
chebi:32836 L-serinate
(2S)-2-amino-3-hydroxypropanoate
L-serine anion
sabiorkM:2140 Serine
2-Amino-3-hydroxypropionic acid
3-Hydroxyalanine
hmdb:HMDB0062263 Protein serine
(-)-Serine
(2S)-2-amino-3-Hydroxypropanoate
(2S)-2-amino-3-Hydroxypropanoic acid
(2S)-2-amino-3-hydroxypropanoic acid
(S)-(-)-Serine
(S)-2-amino-3-Hydroxy-propanoate
(S)-2-amino-3-Hydroxy-propanoic acid
(S)-2-amino-3-Hydroxypropanoate
(S)-2-amino-3-Hydroxypropanoic acid
(S)-Serine
(S)-a-amino-b-Hydroxypropionate
(S)-a-amino-b-Hydroxypropionic acid
(S)-alpha-amino-beta-Hydroxypropionate
(S)-alpha-amino-beta-Hydroxypropionic acid
(S)-alpha-amino-beta-hydroxypropionate
(S)-alpha-amino-beta-hydroxypropionic acid
(S)-b-amino-3-Hydroxypropionate
(S)-b-amino-3-Hydroxypropionic acid
(S)-beta-amino-3-Hydroxypropionate
(S)-beta-amino-3-Hydroxypropionic acid
2-amino-3-Hydroxypropanoate
2-amino-3-Hydroxypropanoic acid
3-Hydroxy-L-alanine
L Serine
L-(-)-Serine
L-2-amino-3-Hydroxypropionate
L-2-amino-3-Hydroxypropionic acid
L-3-Hydroxy-2-aminopropionate
L-3-Hydroxy-2-aminopropionic acid
L-3-Hydroxy-alanine
L-Ser
L-Serin
L-serine
S
SERINE
Ser
b-Hydroxy-L-alanine
b-Hydroxyalanine
beta-Hydroxy-L-alanine
beta-Hydroxyalanine
beta-hydroxy-L-alanine
beta-hydroxyalanine
seedM:cpd00054 L-Serine
L-2-Amino-3-hydroxypropionic acid
L-3-Hydroxy-alanine
L-ser
L-serine
Serine
ser
ser-L
serine
sabiorkM:75 L-Serine
(S)-Serine
L-2-Amino-3-hydroxypropionic acid
L-3-Hydroxy-alanine
Ser
keggD:D00016 Serine (USP)
L-Serine (JP17)
keggC:C00065 L-Serine
L-2-Amino-3-hydroxypropionic acid
L-3-Hydroxy-alanine
Serine
biggM:M_ser__L
biggM:ser-L
chebi:13167
chebi:21387
chebi:45440
chebi:45451
chebi:45590
chebi:45597
chebi:45677
chebi:6301
hmdb:HMDB0000589
hmdb:HMDB00187
hmdb:HMDB00589
hmdb:HMDB62263
keggC:M_C00065
keggD:M_D00016
seedM:M_cpd00054
secondary/obsolete/fantasy identifier
chebi:17115 L-serine
(2S)-2-amino-3-hydroxypropanoic acid
(S)-(-)-serine
(S)-2-amino-3-hydroxypropanoic acid
(S)-alpha-Amino-beta-hydroxypropionic acid
(S)-serine
L-(-)-serine
L-2-Amino-3-hydroxypropionic acid
L-3-Hydroxy-2-aminopropionic acid
L-3-Hydroxy-alanine
L-Ser
L-Serin
L-Serine
S
SERINE
Ser
Serine
beta-Hydroxy-L-alanine
beta-Hydroxyalanine
chebi:32837 L-serinium
(1S)-1-carboxy-2-hydroxyethanaminium
L-serine cation
MNXM145525is deprecated and replaced by MNXM53
MNXM4823is deprecated and replaced by MNXM53
MNXM53is deprecated and replaced by MNXM737786 (serine)
MNXM53is deprecated and replaced by this entry
MNXM725422is deprecated and replaced by MNXM53
MNXM96422is deprecated and replaced by MNXM53