Feedback

L-serine

PropertiesImageOccurences in reactions
MNX_IDMNXM737787Image of MNXM737787
#reac
in my sandbox 0
in MNXref (generic)451
in models (compartimentalized) 453
formulaC3H7NO3
charge0
mass105.04259
referencechebi:33384
InChIKeyMTCFGRXMJLQNBG-REOHCLBHSA-N
InChIInChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1
SMILES[NH3+][C@@H](CO)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-200736
reactomeM:R-ALL-200736
reactome:R-ALL-352002
reactomeM:R-ALL-352002
reactome:R-ALL-379732
reactomeM:R-ALL-379732
CHEBI:33384
chebi:33384
L-serine
(2S)-2-ammonio-3-hydroxypropanoate
L-serine zwitterion
bigg.metabolite:ser__L
biggM:ser__L
envipath:...9b99fb380595
envipathM:...9b99fb380595
L-Serine
hmdb:HMDB0000187 L-Serine
(-)-Serine
(2S)-2-Amino-3-hydroxypropanoate
(2S)-2-Amino-3-hydroxypropanoic acid
(2S)-2-amino-3-hydroxypropanoic acid
(3R,3'r,6S)-4,5-DIDEHYDRO-5,6-dihydro-BETA,BETA-carotene-3,3'-diol
(3R,3'r,6S)-4,5-DIDEHYDRO-5,6-dihydro-b,b-carotene-3,3'-diol
(3R,3'r,6S)-4,5-DIDEHYDRO-5,6-dihydro-beta,beta-carotene-3,3'-diol
(S)-(-)-Serine
(S)-2-Amino-3-hydroxy-propanoate
(S)-2-Amino-3-hydroxy-propanoic acid
(S)-2-Amino-3-hydroxypropanoate
(S)-2-Amino-3-hydroxypropanoic acid
(S)-Serine
(S)-a-Amino-b-hydroxypropionate
(S)-a-Amino-b-hydroxypropionic acid
(S)-alpha-Amino-beta-hydroxypropionate
(S)-alpha-Amino-beta-hydroxypropionic acid
(S)-alpha-amino-beta-hydroxypropionate
(S)-alpha-amino-beta-hydroxypropionic acid
(S)-b-Amino-3-hydroxypropionate
(S)-b-Amino-3-hydroxypropionic acid
(S)-beta-Amino-3-hydroxypropionate
(S)-beta-Amino-3-hydroxypropionic acid
2-Amino-3-hydroxypropanoate
2-Amino-3-hydroxypropanoic acid
3-Hydroxy-L-alanine
Bo-xan
L Serine
L-(-)-Serine
L-2-Amino-3-hydroxypropionate
L-2-Amino-3-hydroxypropionic acid
L-3-Hydroxy-2-aminopropionate
L-3-Hydroxy-2-aminopropionic acid
L-3-Hydroxy-alanine
L-Ser
L-Serin
L-serine
S
SERINE
Ser
Xanthophyll
b-Hydroxy-L-alanine
b-Hydroxyalanine
beta-Hydroxy-L-alanine
beta-Hydroxyalanine
beta-hydroxy-L-alanine
beta-hydroxyalanine
e 161b
sabiork.compound:75
sabiorkM:75
L-Serine
(S)-Serine
L-2-Amino-3-hydroxypropionic acid
L-3-Hydroxy-alanine
Ser
seed.compound:cpd00054
seedM:cpd00054
L-Serine
L-2-Amino-3-hydroxypropionic acid
L-3-Hydroxy-alanine
L-ser
L-serine
Serine
ser
ser-L
serine
kegg.compound:C00065
keggC:C00065
L-Serine
L-2-Amino-3-hydroxypropionic acid
L-3-Hydroxy-alanine
Serine
CHEBI:32836
chebi:32836
L-serinate
(2S)-2-amino-3-hydroxypropanoate
L-serine anion
CHEBI:17115
chebi:17115
L-serine
(2S)-2-amino-3-hydroxypropanoic acid
(S)-(-)-serine
(S)-2-amino-3-hydroxypropanoic acid
(S)-alpha-Amino-beta-hydroxypropionic acid
(S)-serine
L-(-)-serine
L-2-Amino-3-hydroxypropionic acid
L-3-Hydroxy-2-aminopropionic acid
L-3-Hydroxy-alanine
L-Ser
L-Serin
L-Serine
S
SERINE
Ser
Serine
beta-Hydroxy-L-alanine
beta-Hydroxyalanine
metacyc.compound:SER
metacycM:SER
L-serine
L-ser
S
ser
serine
CHEBI:32837
chebi:32837
L-serinium
(1S)-1-carboxy-2-hydroxyethanaminium
L-serine cation
kegg.drug:D00016
keggD:D00016
Serine (USP)
L-Serine (JP18)
sabiork.compound:2140
sabiorkM:2140
Serine
2-Amino-3-hydroxypropionic acid
3-Hydroxyalanine
biggM:ser-L
hmdb:HMDB0000589
hmdb:HMDB00187
hmdb:HMDB00589
hmdb:HMDB0062263
hmdb:HMDB62263
chebi:13167
chebi:21387
chebi:45440
chebi:45451
chebi:45590
chebi:45597
chebi:45677
chebi:6301
biggM:M_ser__L
keggC:M_C00065
keggD:M_D00016
seedM:M_cpd00054
secondary/obsolete/fantasy identifier