Feedback

L-methionine

PropertiesImageOccurences in reactions
MNX_IDMNXM738804Image of MNXM738804
#reac
in my sandbox 0
in MNXref (generic)576
in models (compartimentalized) 428
formulaC5H11NO2S
charge0
mass149.05105
referencechebi:57844
InChIKeyFFEARJCKVFRZRR-BYPYZUCNSA-N
InChIInChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1
SMILESCSCC[C@H]([NH3+])C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-174390
reactomeM:R-ALL-174390
reactome:R-ALL-351966
reactomeM:R-ALL-351966
reactome:R-ALL-379705
reactomeM:R-ALL-379705
CHEBI:57844
chebi:57844
L-methionine
(2S)-2-ammonio-4-(methylsulfanyl)butanoate
(2S)-2-azaniumyl-4-(methylsulfanyl)butanoate
L-methionine zwitterion
bigg.metabolite:met__L
biggM:met__L
L-Methionine
hmdb:HMDB0000696 L-Methionine
(2S)-2-Amino-4-(methylsulfanyl)butanoate
(2S)-2-Amino-4-(methylsulfanyl)butanoic acid
(2S)-2-Amino-4-(methylsulphanyl)butanoate
(2S)-2-Amino-4-(methylsulphanyl)butanoic acid
(2S)-2-amino-4-(methylsulfanyl)butanoic acid
(L)-Methionine
(S)-(+)-Methionine
(S)-2-Amino-4-(methylthio)-butanoate
(S)-2-Amino-4-(methylthio)-butanoic acid
(S)-2-Amino-4-(methylthio)butanoate
(S)-2-Amino-4-(methylthio)butanoic acid
(S)-2-Amino-4-(methylthio)butyrate
(S)-2-Amino-4-(methylthio)butyric acid
(S)-Methionine
2-Amino-4-(methylthio)butyrate
2-Amino-4-(methylthio)butyric acid
2-Amino-4-methylthiobutanoate
2-Amino-4-methylthiobutanoic acid
Acimethin
Cymethion
H-Met-H
H-Met-OH
L(-)-Amino-alpha-amino-alpha-aminobutyric acid
L(-)-Amino-gamma-methylthiobutyric acid
L-(-)-Methionine
L-2-Amino-4-(methylthio)butyric acid
L-2-Amino-4-methylthiobutyric acid
L-2-Amino-4methylthiobutyrate
L-2-Amino-4methylthiobutyric acid
L-Isomer methionine
L-Methionin
L-Methionine Z
L-Methioninum
L-a-Amino-g-methylmercaptobutyrate
L-a-Amino-g-methylmercaptobutyric acid
L-a-Amino-g-methylthiobutyrate
L-a-Amino-g-methylthiobutyric acid
L-alpha-Amino-gamma-methylmercaptobutyrate
L-alpha-Amino-gamma-methylmercaptobutyric acid
L-alpha-Amino-gamma-methylthiobutyrate
L-alpha-Amino-gamma-methylthiobutyric acid
L-alpha-amino-gamma-methylmercaptobutyrate
L-alpha-amino-gamma-methylmercaptobutyric acid
L-gamma-Methylthio-alpha-aminobutyric acid
L-methionine
Liquimeth
M
METHIONINE
Mepron
Met
Methilanin
Methionine, L isomer
Methionine, L-isomer
Methioninum
Metionina
Neo-methidin
Pedameth
Poly-L-methionine
Polymethionine
S-Methionine
S-Methyl-L-homocysteine
Toxin war
a-Amino-g-methylmercaptobutyrate
a-Amino-g-methylmercaptobutyric acid
alpha-Amino-alpha-aminobutyric acid
alpha-Amino-gamma-methylmercaptobutyrate
alpha-Amino-gamma-methylmercaptobutyric acid
g-Methylthio-a-aminobutyrate
g-Methylthio-a-aminobutyric acid
gamma-Methylthio-alpha-aminobutyrate
gamma-Methylthio-alpha-aminobutyric acid
seed.compound:cpd00060
seedM:cpd00060
L-Methionine
L-2-Amino-4methylthiobutyric acid
L-met
L-methionine
Methionine
met
met-L
methionine
sabiork.compound:77
sabiorkM:77
L-Methionine
L-2-Amino-4methylthiobutyric acid
Met
kegg.compound:C00073
keggC:C00073
L-Methionine
L-2-Amino-4methylthiobutyric acid
Methionine
CHEBI:32631
chebi:32631
L-methioninate
(2S)-2-amino-4-(methylsulfanyl)butanoate
L-methionine anion
CHEBI:16643
chebi:16643
L-methionine
(2S)-2-amino-4-(methylsulfanyl)butanoic acid
(S)-2-amino-4-(methylthio)butanoic acid
(S)-2-amino-4-(methylthio)butyric acid
(S)-methionine
L-(-)-methionine
L-Methionin
L-Methionine
L-alpha-amino-gamma-methylmercaptobutyric acid
M
METHIONINE
Met
Methionine
metacyc.compound:MET
metacycM:MET
L-methionine
L-met
M
met
methionine
CHEBI:32632
chebi:32632
L-methioninium
(1S)-1-carboxy-3-(methylsulfanyl)propan-1-aminium
L-methionine cation
envipath:...8398e8723d5e
envipathM:...8398e8723d5e
Methionine
kegg.drug:D00019
keggD:D00019
Methionine (USP)
L-Methionine (JP18)
L-Methionine Z (TN)
kegg.drug:D04984
keggD:D04984
Methionine C 11
Carbon-11 methionine
sabiork.compound:2315
sabiorkM:2315
Methionine
2-Amino-4-(methylthio)butyric acid
biggM:met-L
hmdb:HMDB00696
chebi:13141
chebi:21360
chebi:43990
chebi:6271
biggM:M_met__L
keggC:M_C00073
keggD:M_D00019
keggD:M_D04984
seedM:M_cpd00060
secondary/obsolete/fantasy identifier