Feedback

(2R,3S)-3-isopropylmalate

Properties
MNX_IDMNXM741109
formulaC7H10O5
charge-2
mass174.1513
referencechebi:35121
Image of MNXM741109
InChIKeyRNQHMTFBUSSBJQ-CRCLSJGQSA-L
InChIInChI=1S/C7H12O5/c1-3(2)4(6(9)10)5(8)7(11)12/h3-5,8H,1-2H3,(H,9,10)(H,11,12)/p-2/t4-,5+/m0/s1
SMILESCC(C)[C@@H]([C@@H](O)C([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref3
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
chebi:43468 (2R,3S)-3-isopropylmalic acid
(2R,3S)-2-hydroxy-3-(propan-2-yl)butanedioic acid
(2R,3S)-2-hydroxy-3-isopropylsuccinic acid
(2R,3S)-3-carboxy-2-hydroxy-4-methylpentanoic acid
2-D-threo-Hydroxy-3-carboxy-isocaproate
2-D-threo-hydroxy-3-carboxyisocaproic acid
3-Carboxy-2-hydroxy-4-methylpentanoate
3-Isopropylmalate
sabiorkM:7292 3-Isopropylmalate
2-D-threo-Hydroxy-3-carboxy-isocaproate
3-Carboxy-2-hydroxy-4-methylpentanoate
biggM:3c2hmp 3-Carboxy-2-hydroxy-4-methylpentanoate
keggC:C04411 (2R,3S)-3-Isopropylmalate
2-D-threo-Hydroxy-3-carboxy-isocaproate
3-Carboxy-2-hydroxy-4-methylpentanoate
3-Isopropylmalate
sabiorkM:31178 (2R,3S)-3-Isopropylmalate
chebi:35121 (2R,3S)-3-isopropylmalate
(2R,3S)-2-hydroxy-3-(propan-2-yl)butanedioate
(2R,3S)-2-hydroxy-3-isopropylsuccinate
(2R,3S)-3-Isopropylmalate
(2R,3S)-3-isopropylmalate(2-)
2-D-threo-Hydroxy-3-carboxy-isocaproate
metacycM:2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE (2R,3S)-3-isopropylmalate
2-D-threo-hydroxy-3-carboxy-isocaproate
3-carboxy-2-hydroxy-4-methylpentanoate
3-isopropylmalate
beta-isopropylmalate
biggM:M_3c2hmp
chebi:1565
chebi:35120
chebi:35122
chebi:43465
hmdb:HMDB12156
keggC:M_C04411
seedM:M_cpd02693
secondary/obsolete/fantasy identifier
hmdb:HMDB0012156 3-Isopropylmalate
(2R,3S)-2-Hydroxy-3-(propan-2-yl)butanedioate
(2R,3S)-2-Hydroxy-3-(propan-2-yl)butanedioic acid
(2R,3S)-2-Hydroxy-3-isopropylsuccinate
(2R,3S)-2-Hydroxy-3-isopropylsuccinic acid
(2R,3S)-2-hydroxy-3-(propan-2-yl)butanedioic acid
(2R,3S)-3-Carboxy-2-hydroxy-4-methylpentanoate
(2R,3S)-3-Carboxy-2-hydroxy-4-methylpentanoic acid
(2R,3S)-3-Isopropylmalate
(2R,3S)-3-Isopropylmalic acid
(2R,3S)-3-isopropylmalic acid
2-D-threo-Hydroxy-3-carboxy-isocaproate
2-D-threo-Hydroxy-3-carboxy-isocaproic acid
2-D-threo-Hydroxy-3-carboxyisocaproate
2-D-threo-Hydroxy-3-carboxyisocaproic acid
3-3-Isopropylmalic acid
3-Carboxy-2-hydroxy-4-methylpentanoate
3-Carboxy-2-hydroxy-4-methylpentanoic acid
3-Isopropylmalic acid
IPM
beta-Isopropylmalate
beta-Isopropylmalate, erythro-(L)-isomer
seedM:cpd02693 3-Isopropylmalate
(2R,3S)-3-Isopropylmalate
(2R,3S)-3-isopropylmalate
2-D-threo-Hydroxy-3-carboxy-isocaproate
2-D-threo-hydroxy-3-carboxy-isocaproate
3-Carboxy-2-hydroxy-4-methylpentanoate
3-carboxy-2-hydroxy-4-methylpentanoate
3-isopropylmalate
3c2hmp
beta-isopropylmalate
MNXM6092is deprecated and replaced by MNXM891
MNXM891is deprecated and replaced by MNXM741108 (3-isopropylmalate(2-))
MNXM891is deprecated and replaced by this entry