Feedback

L-glutamate

Properties
MNX_IDMNXM741173
formulaC5H8NO4
charge-1
mass146.12136
referencechebi:29985
Image of MNXM741173
InChIKeyWHUUTDBJXJRKMK-VKHMYHEASA-M
InChIInChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/p-1/t3-/m0/s1
SMILES[NH3+][C@@H](CCC([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref829
Distinct compatimentalized reactions in models444

Similar chemical compounds in external resources
IdentifierDescription
metacycM:GLT L-glutamate
1-amino-propane-1,3-dicarboxylic acid
2-aminopentanedioic acid
E
L-glu
L-glutamic acid
alpha-aminoglutaric acid
glt
glu
glut
glutacid
glutaminic acid
keggC:C00025 L-Glutamate
Glutamate
L-Glutamic acid
L-Glutaminic acid
chebi:29988 L-glutamate(2-)
(2S)-2-aminopentanedioate
L-glutamate
L-glutamic acid dianion
chebi:16015 L-glutamic acid
(2S)-2-aminopentanedioic acid
(S)-2-aminopentanedioic acid
(S)-glutamic acid
E
GLUTAMIC ACID
Glu
Glutamate
L-Glu
L-Glutamic acid
L-Glutaminic acid
L-Glutaminsaeure
acide glutamique
acido glutamico
acidum glutamicum
glutamic acid
sabiorkM:73 L-Glutamate
Glu
L-Glutamic acid
L-Glutaminic acid
hmdb:HMDB0000148 L-Glutamic acid
(2S)-2-Aminopentanedioate
(2S)-2-Aminopentanedioic acid
(2S)-2-aminopentanedioic acid
(S)-(+)-Glutamate
(S)-(+)-Glutamic acid
(S)-2-Aminopentanedioate
(S)-2-Aminopentanedioic acid
(S)-Glutamate
(S)-Glutamic acid
1-Aminopropane-1,3-dicarboxylate
1-Aminopropane-1,3-dicarboxylic acid
1-amino-Propane-1,3-dicarboxylate
1-amino-Propane-1,3-dicarboxylic acid
2-Aminoglutarate
2-Aminoglutaric acid
2-Aminopentanedioate
2-Aminopentanedioic acid
Acide glutamique
Acidum glutamicum
Aciglut
Aluminum L glutamate
Aluminum L-glutamate
Aminoglutarate
Aminoglutaric acid
D Glutamate
D-Glutamate
E
GLUTAMIC ACID
Glt
Glu
Glusate
Glut
Glutacid
Glutamate
Glutamate, potassium
Glutamic acid, (D)-isomer
Glutamicol
Glutamidex
Glutaminate
Glutaminic acid
Glutaminol
Glutaton
L Glutamate
L Glutamic acid
L-(+)-Glutamate
L-(+)-Glutamic acid
L-Glu
L-Glutamate
L-Glutamate, aluminum
L-Glutaminate
L-Glutaminic acid
L-Glutaminsaeure
L-a-Aminoglutarate
L-a-Aminoglutaric acid
L-alpha-Aminoglutarate
L-alpha-Aminoglutaric acid
L-glutamic acid
Potassium glutamate
a-Aminoglutarate
a-Aminoglutaric acid
a-Glutamate
a-Glutamic acid
acido Glutamico
alpha-Aminoglutarate
alpha-Aminoglutaric acid
alpha-Glutamate
alpha-Glutamic acid
keggD:D00007 Glutamic acid (USP)
L-Glutamic acid (JP17)
seedM:cpd00023 L-Glutamate
1-amino-propane-1,3-dicarboxylic acid
2-aminopentanedioic acid
GLU
Glutamate
Glutaminic acid
L-Glutamic acid
L-Glutaminic acid
L-glu
L-glutamate
L-glutamic acid
alpha-aminoglutaric acid
glt
glu
glu-L
glut
glutacid
glutamate
glutaminic acid
biggM:glu__L L-Glutamate
biggM:M_glu__L
biggM:glu-L
chebi:13107
chebi:21301
chebi:21304
chebi:42825
chebi:6224
hmdb:HMDB00148
keggC:M_C00025
keggD:M_D00007
seedM:M_cpd00023
secondary/obsolete/fantasy identifier
chebi:29985
reactome:R-ALL-113552
reactome:R-ALL-210382
reactome:R-ALL-210509
reactome:R-ALL-29404
reactome:R-ALL-428614
L-glutamate
(2S)-2-ammoniopentanedioate
L-glutamate(1-)
L-glutamic acid monoanion
L-glutamic acid, ion(1-)
hydrogen L-glutamate
MNXM18is deprecated and replaced by MNXM89557
MNXM89557is deprecated and replaced by MNXM741172 (glutamate)
MNXM89557is deprecated and replaced by this entry
MNXM96412is deprecated and replaced by MNXM89557