Feedback

L-glutamate

PropertiesImageOccurences in reactions
MNX_IDMNXM741173Image of MNXM741173
#reac
in my sandbox 0
in MNXref (generic)811
in models (compartimentalized) 624
formulaC5H8NO4
charge-1
mass146.04588
referencechebi:29985
InChIKeyWHUUTDBJXJRKMK-VKHMYHEASA-M
InChIInChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/p-1/t3-/m0/s1
SMILES[NH3+][C@@H](CCC(=O)[O-])C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-113552
reactomeM:R-ALL-113552
reactome:R-ALL-210382
reactomeM:R-ALL-210382
reactome:R-ALL-210509
reactomeM:R-ALL-210509
reactome:R-ALL-29404
reactomeM:R-ALL-29404
reactome:R-ALL-428614
reactomeM:R-ALL-428614
CHEBI:29985
chebi:29985
L-glutamate
(2S)-2-ammoniopentanedioate
L-glutamate(1-)
L-glutamic acid monoanion
L-glutamic acid, ion(1-)
hydrogen L-glutamate
kegg.drug:D00007
keggD:D00007
Glutamic acid (USP)
L-Glutamic acid (JP18)
bigg.metabolite:glu__L
biggM:glu__L
L-Glutamate
seed.compound:cpd00023
seedM:cpd00023
L-Glutamate
1-amino-propane-1,3-dicarboxylic acid
2-aminopentanedioic acid
GLU
Glutamate
Glutaminic acid
L-Glutamic acid
L-Glutaminic acid
L-glu
L-glutamate
L-glutamic acid
alpha-aminoglutaric acid
glt
glu
glu-L
glut
glutacid
glutamate
glutaminic acid
kegg.compound:C00025
keggC:C00025
L-Glutamate
Glutamate
L-Glutamic acid
L-Glutaminic acid
sabiork.compound:73
sabiorkM:73
L-Glutamate
Glu
L-Glutamic acid
L-Glutaminic acid
hmdb:HMDB0000148 L-Glutamic acid
(+)-Estrone
(1S)-2-[(3-O-b-D-Glucopyranosyl-b-D-galactopyranosyl)oxy]-1-{[(9E)-octadec-9-enoyloxy]methyl}ethyl (10E)-nonadec-10-enoate
(1S)-2-[(3-O-b-D-Glucopyranosyl-b-D-galactopyranosyl)oxy]-1-{[(9E)-octadec-9-enoyloxy]methyl}ethyl (10E)-nonadec-10-enoic acid
(1S)-2-[(3-O-beta-D-Glucopyranosyl-beta-D-galactopyranosyl)oxy]-1-{[(9E)-octadec-9-enoyloxy]methyl}ethyl (10E)-nonadec-10-enoic acid
(1S)-2-[(3-O-beta-D-glucopyranosyl-beta-D-galactopyranosyl)oxy]-1-{[(9E)-octadec-9-enoyloxy]methyl}ethyl (10E)-nonadec-10-enoate
(1S)-2-[(3-O-beta-D-glucopyranosyl-beta-D-galactopyranosyl)oxy]-1-{[(9E)-octadec-9-enoyloxy]methyl}ethyl (10E)-nonadec-10-enoic acid
(2R)-2,3-Dihydroxypropanoic acid
(2S)-2-Aminopentanedioate
(2S)-2-Aminopentanedioic acid
(2S)-2-aminopentanedioic acid
(3R,4S,5R)-5-[(1R)-1-Carboxy-2,2-difluoro-1-(phosphonooxy)ethoxy]-4-hydroxy-3-(phosphonooxy)cyclohex-1-ene-1-carboxylate
(R)-2,3-Dihydroxypropanoic acid
(R)-Glycerate
(R)-Glyceric acid
(S)-(+)-Glutamate
(S)-(+)-Glutamic acid
(S)-2-Aminopentanedioate
(S)-2-Aminopentanedioic acid
(S)-Glutamate
(S)-Glutamic acid
1,3,5(10)-Estratrien-3-ol-17-one
1-Amino-2-hydroxyethane
1-Amino-propane-1,3-dicarboxylate
1-Amino-propane-1,3-dicarboxylic acid
1-Aminopropane-1,3-dicarboxylate
1-Aminopropane-1,3-dicarboxylic acid
2 Acetamido 2 deoxy D glucose
2 Acetamido 2 deoxyglucose
2 Aminoethanol
2-Acetamido-2-deoxy-D-glucose
2-Acetamido-2-deoxyglucose
2-Amino-1-ethanol
2-Amino-ethanol
2-Aminoethan-1-ol
2-Aminoethanol
2-Aminoethyl alcohol
2-Aminoglutarate
2-Aminoglutaric acid
2-Aminopentanedioate
2-Aminopentanedioic acid
2-Ethanolamine
2-Hydroxyethanamine
2-Hydroxyethylamine
3-Hydroxy-1,3,5(10)-estratrien-17-one
3-Hydroxy-17-keto-estra-1,3,5-triene
3-Hydroxyestra-1,3,5(10)-trien-17-one
3-Hydroxyestra-1,3,5(10)-triene-17-one
3-Hydroxyoestra-1,3,5(10)-trien-17-one
3a,7a,12a-Trihydroxy-5b-cholan-24-oylglycine
3alpha,7alpha,12alpha-Trihydroxy-5beta-cholan-24-oylglycine
3alpha,7alpha,12alpha-Trihydroxy-5beta-cholanic acid-24-glycine
3alpha,7alpha,12alpha-Trihydroxy-N-(carboxymethyl)-5beta-cholan-24-amide
3alpha,7alpha,12alpha-trihydroxy-5beta-cholan-24-oylglycine
3alpha,7alpha,12alpha-trihydroxy-5beta-cholanic acid-24-glycine
3alpha,7alpha,12alpha-trihydroxy-N-(carboxymethyl)-5beta-cholan-24-amide
Acetylglucosamine
Acide glutamique
Acido glutamico
Acidum glutamicum
Aciglut
Aethanolamin
Aluminum L glutamate
Aluminum L-glutamate
Aminoethanol
Aminoglutarate
Aminoglutaric acid
Cholylglycine
Colamine
D Glutamate
D-2,3-Dihydroxypropanoic acid
D-GlcNAc
D-Glutamate
D-Glycerate
D-Glyceric acid
D-GroA
D1,3,5(10)-Estratrien-3-ol-17-one
E
ETA
Envision conditioner PDD 9020
Estrone, (+-)-isomer
Estrone, (8 alpha)-isomer
Estrone, (9 beta)-isomer
Estrovarin
Ethylolamine
Follicular hormone
Folliculin
GLUTAMIC ACID
Glt
Glu
Glusate
Glut
Glutacid
Glutamate
Glutamate, potassium
Glutamic acid, (D)-isomer
Glutamicol
Glutamidex
Glutaminate
Glutaminic acid
Glutaminol
Glutaton
Glycerate
Glycine cholate
Glycinol
Glycocholate
Glycocholate sodium
Glycocholic acid, sodium salt
Glycoreductodehydrocholic acid
Glycylcholate
Glycylcholic acid
H-Glycinol
Hauck brand OF estrone
Hea
Hyrex brand OF estrone
Kestrone
L Glutamate
L Glutamic acid
L-(+)-Glutamate
L-(+)-Glutamic acid
L-Glu
L-Glutamate
L-Glutamate, aluminum
L-Glutaminate
L-Glutaminic acid
L-Glutaminsaeure
L-a-Aminoglutarate
L-a-Aminoglutaric acid
L-alpha-Aminoglutarate
L-alpha-Aminoglutaric acid
L-glutamic acid
MEA
MONOETHANOLAMINE
Monoaethanolamin
N Acetyl D glucosamine
N-(Carboxymethyl)-3alpha,7alpha,12alpha-trihydroxy-5beta-cholan-24-amide
N-Acetyl-D-glucosamine
N-Acetylchitosamine
N-Choloyl-glycine
N-Choloylglycine
N-[(3a,5b,7a,12a)-3,7,12-Trihydroxy-24-oxocholan-24-yl]glycine
N-[(3alpha,5beta,7alpha,12alpha)-3,7,12-Trihydroxy-24-oxocholan-24-yl]glycine
N-[(3alpha,5beta,7alpha,12alpha)-3,7,12-trihydroxy-24-oxocholan-24-yl]glycine
Oestrone
Olamine
Potassium glutamate
R-Glycerate
R-Glyceric acid
Unigen
Vortech brand OF estrone
Wehgen
a,b-Hydroxypropionate
a,b-Hydroxypropionic acid
a-Aminoglutarate
a-Aminoglutaric acid
a-Glutamate
a-Glutamic acid
alpha,beta-Hydroxypropionate
alpha,beta-Hydroxypropionic acid
alpha,beta-hydroxypropionate
alpha,beta-hydroxypropionic acid
alpha-Aminoglutarate
alpha-Aminoglutaric acid
alpha-Glutamate
alpha-Glutamic acid
b-Aminoethanol
b-Aminoethyl alcohol
b-Ethanolamine
b-Hydroxyethylamine
beta-Aminoethanol
beta-Aminoethyl alcohol
beta-Ethanolamine
beta-Hydroxyethylamine
beta-aminoethanol
beta-aminoethyl alcohol
beta-ethanolamine
beta-hydroxyethylamine
CHEBI:29988
chebi:29988
L-glutamate(2-)
(2S)-2-aminopentanedioate
L-glutamate
L-glutamic acid dianion
metacyc.compound:GLT
metacycM:GLT
L-glutamate
1-amino-propane-1,3-dicarboxylic acid
2-aminopentanedioic acid
E
L-glu
L-glutamic acid
alpha-aminoglutaric acid
glt
glu
glut
glutacid
glutaminic acid
CHEBI:16015
chebi:16015
L-glutamic acid
(2S)-2-aminopentanedioic acid
(S)-2-aminopentanedioic acid
(S)-glutamic acid
E
GLUTAMIC ACID
Glu
Glutamate
L-Glu
L-Glutamic acid
L-Glutaminic acid
L-Glutaminsaeure
acide glutamique
acido glutamico
acidum glutamicum
glutamic acid
biggM:glu-L
hmdb:HMDB00148
chebi:13107
chebi:21301
chebi:21304
chebi:42825
chebi:6224
biggM:M_glu__L
keggC:M_C00025
keggD:M_D00007
seedM:M_cpd00023
secondary/obsolete/fantasy identifier