Feedback

carbamate

PropertiesImageOccurences in reactions
MNX_IDMNXM742Image of MNXM742
#reac
in my sandbox 0
in MNXref (generic)19
in models (compartimentalized) 5
formulaCH2NO2
charge-1
mass60.0091
referencechebi:13941
InChIKeyKXDHJXZQYSOELW-UHFFFAOYSA-M
InChIInChI=1S/CH3NO2/c2-1(3)4/h2H2,(H,3,4)/p-1
SMILESNC(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:13941
chebi:13941
carbamate
Carbamat
Karbamat
carbamate ion
carbamic acid, ion(1-)
bigg.metabolite:cbm
biggM:cbm
envipath:...e02ea29dcaaf
envipathM:...e02ea29dcaaf
Carbamate
sabiork.compound:5666
sabiorkM:5666
kegg.compound:C01563
keggC:C01563
Carbamate
Aminoformic acid
Carbamic acid
seed.compound:cpd01101
seedM:cpd01101
Carbamate
Aminoformic acid
Carbamic acid
aminoformic acid
carbamate
carbamic acid
hmdb:HMDB0003551 Carbamic acid
Aminoameisensaeure
Aminoformate
Aminoformic acid
Ammonium carbamate
Calcium carbamate
Carbamate
Carbamate ion
Carbamic acid, ammonia salt
Carbamic acid, calcium salt
Carbamic acid, potassium salt
Carbamic acid, sodium salt
Carbamidsaeure
Chlorphenesin carbamate
Maolate
Potassium carbamate
Sodium carbamate
carbamic acid
metacyc.compound:CARBAMATE
metacycM:CARBAMATE
carbamate
aminoformic acid
carbamic acid
CHEBI:28616
chebi:28616
carbamic acid
Aminoameisensaeure
Aminoformic acid
CARBAMIC ACID
Carbamate
Carbamic acid
Carbamidsaeure
envipath:...6c9274b03e45
envipathM:...6c9274b03e45
compound 40032
hmdb:HMDB03551
chebi:22504
chebi:23002
chebi:3386
chebi:44573
biggM:M_cbm
keggC:M_C01563
seedM:M_cpd01101
secondary/obsolete/fantasy identifier