Feedback

carbamate

Properties
MNX_IDMNXM742
formulaCH2NO2
charge-1
mass60.03212
referencechebi:13941
Image of MNXM742
InChIKeyKXDHJXZQYSOELW-UHFFFAOYSA-M
InChIInChI=1S/CH3NO2/c2-1(3)4/h2H2,(H,3,4)/p-1
SMILESNC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref18
Distinct compatimentalized reactions in models5

Similar chemical compounds in external resources
IdentifierDescription
chebi:13941 carbamate
Carbamat
Karbamat
carbamate ion
carbamic acid, ion(1-)
metacycM:CARBAMATE carbamate
aminoformic acid
carbamic acid
seedM:cpd01101 Carbamate
Aminoformic acid
Carbamic acid
aminoformic acid
carbamate
carbamic acid
hmdb:HMDB0003551 Carbamic acid
Aminoameisensaeure
Aminoformate
Aminoformic acid
Ammonium carbamate
Calcium carbamate
Carbamate
Carbamate ion
Carbamic acid, ammonia salt
Carbamic acid, calcium salt
Carbamic acid, potassium salt
Carbamic acid, sodium salt
Carbamidsaeure
Chlorphenesin carbamate
Maolate
Potassium carbamate
Sodium carbamate
carbamic acid
envipath:...6c9274b03e45 compound 40032
keggC:C01563
sabiorkM:5666
Carbamate
Aminoformic acid
Carbamic acid
chebi:28616 carbamic acid
Aminoameisensaeure
Aminoformic acid
CARBAMIC ACID
Carbamate
Carbamic acid
Carbamidsaeure
biggM:M_cbm
chebi:22504
chebi:23002
chebi:3386
chebi:44573
hmdb:HMDB03551
keggC:M_C01563
seedM:M_cpd01101
secondary/obsolete/fantasy identifier
biggM:cbm
envipath:...e02ea29dcaaf
Carbamate
MNXM724126is deprecated and replaced by this entry