|
|
|||||||||||||
| InChIKey | RHKKZBWRNHGJEZ-ARQDHWQXSA-L |
| InChI | InChI=1S/C6H13O9P/c7-1-3-4(8)5(9)6(10,15-3)2-14-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/p-2/t3-,4-,5+,6-/m1/s1 |
| SMILES | OC[C@H]1O[C@](O)(COP([O-])([O-])=O)[C@@H](O)[C@@H]1O |
| #reac | |
|---|---|
| Distinct reactions in my sandbox | 0 |
| Distinct generic reactions in MNXref | 29 |
| Distinct compatimentalized reactions in models | 7 |
| Identifier | Description |
|---|---|
| chebi:58674 | D-fructose 1-phosphate 1-O-phosphonato-D-fructofuranose D-fructofuranose 1-phosphate D-fructofuranose 1-phosphate(2-) |
| chebi:37515 | D-fructofuranose 1-phosphate 1-O-phosphono-D-fructofuranose D-fructofuranose 1-(dihydrogen phosphate) Fructose 1-phosphate(furanose) |
| metacycM:FRU1P | beta-D-fructofuranose 1-phosphate beta-D-fructofuranose-1-P |
| chebi:138881 | beta-D-fructose 1-phosphate 1-O-phosphonato-beta-D-fructofuranose beta-D-fructofuranose 1-phosphate beta-D-fructofuranose 1-phosphate(2-) |
| seedM:cpd00802 | D-fructose-1-phosphate D-Fructose 1-phosphate D-Fructose1-phosphate D-fructofuranose-1-phosphate Fructose 1-phosphate beta-D-fructofuranose 1-phosphate beta-D-fructofuranose-1-P beta-D-fructose-1-P beta-D-fructose-1-phosphate f1p fructose-1-P fructose-1-phosphate |
| metacycM:D-fructofuranose-1-phosphate | D-fructofuranose 1-phosphate |
| sabiorkM:1458 | Fructose 1-phosphate |
| biggM:f1p keggC:C01094 sabiorkM:1351 | D-Fructose 1-phosphate |
| chebi:139419 | beta-D-fructofuranose 1-phosphate 1-O-phosphono-beta-D-fructofuranose beta-D-fructofuranose 1-(dihydrogen phosphate) beta-D-fructose 1-phosphate |
| hmdb:HMDB0001076 | Fructose 1-phosphate D-Fructose 1-phosphate D-Fructose-1-P D-Fructose-1-phosphate Fructose-1-P Fructose-1-phosphate [(2R,3S,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methoxyphosphonic acid {[(2R,3S,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methoxy}phosphonic acid |
| biggM:M_f1p chebi:20930 chebi:5174 hmdb:HMDB01076 keggC:M_C01094 seedM:M_cpd00802 | secondary/obsolete/fantasy identifier |
| MNXM145568 | is deprecated and replaced by this entry |
| MNXM90055 | is deprecated and replaced by this entry |
| MNXM90464 | is deprecated and replaced by MNXM145568 |
| MNXM90812 | is deprecated and replaced by MNXM145568 |
