Feedback

 

D-glucarate

Image of MNXM744
Properties
MNX_IDMNXM744
formulaC6H8O8
charge-2
mass208.124
referencechebi:30612
InChIKeyDSLZVSRJTYRBFB-LLEIAEIESA-L
InChIInChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/p-2/t1-,2-,3-,4+/m0/s1
SMILESO[C@@H]([C@H](O)[C@@H](O)C([O-])=O)[C@H](O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of D-glucarate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:glcr D-Glucarate
chebi:16002
chebi:20982
chebi:4155
(2R,3S,4S,5S)-2,3,4,5-tetrahydroxyhexanedioic acid
D-(+)-saccharic acid
D-Glucaric acid
D-Glucosaccharic acid
D-Saccharic acid
D-glucaric acid
DSLZVSRJTYRBFB-LLEIAEIESA-N
Glucaric acid
L-Gularic acid
saccharic acid
chebi:12953
chebi:20980
chebi:30612
chebi:42731
(2R,3S,4S,5S)-2,3,4,5-tetrahydroxyhexanedioate
D-GLUCARATE
D-glucarate
D-glucarate(2-)
DSLZVSRJTYRBFB-LLEIAEIESA-L
chebi:33801 D-glucarate(1-)
D-saccharate
D-saccharate(1-)
hydrogen D-glucarate
hmdb:HMDB00663 (2R,3S,4S,5S)-2,3,4,5-tetrahydroxyhexanedioic acid
Glucaric acid
saccharic acid
hmdb:HMDB29881 2,3,4,5-tetrahydroxyhexanedioic acid
D-Glucaric acid
mucic acid
kegg:C00818 D-Glucarate
D-Glucaric acid
D-Glucosaccharic acid
D-Saccharic acid
Glucarate
Glucaric acid
L-Gularic acid
lipidmaps:LMFA01170108 2S,3S,4S,5R-tetrahydroxy-hexanedioic acid
Glucaric acid
lipidmaps:LMFA01170108
metacyc:D-GLUCARATE (D)-glucarate
D-GLUCARATE
D-glucarate
D-glucaric acid
D-glucosaccharic acid
D-saccharate
D-saccharic acid
L-gularic acid
glucarate
saccharate
sabiork:5252 D-Glucarate
D-Glucaric acid
D-Glucosaccharic acid
L-Gularic acid
d-Saccharic acid
seed:cpd00571 Glucarate
Glucaric acid
seed:cpd00609 D-Glucarate
D-Glucaric acid
D-Glucosaccharic acid
L-Gularic acid
d-Saccharic acid
glcr
seed:cpd01246 Galactarate
Galactaric acid
Mucic acid
deprecated:MNXM12294
deprecated:MNXM48479
deprecated:MNXM525929
deprecated:MNXM97558