Feedback

isovalerate

Properties
MNX_IDMNXM7454
formulaC5H9O2
charge-1
mass101.12376
referencechebi:48942
Image of MNXM7454
InChIKeyGWYFCOCPABKNJV-UHFFFAOYSA-M
InChIInChI=1S/C5H10O2/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H,6,7)/p-1
SMILESCC(C)CC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref13
Distinct compatimentalized reactions in models7

Similar chemical compounds in external resources
IdentifierDescription
chebi:48942 isovalerate
3-methyl-n-butyrate
3-methylbutanoate
3-methylbutyrate
beta-methylbutyrate
delphinate
isopentanoate
isopropylacetate
isovalerianate
metacycM:ISOVALERATE isovalerate
hmdb:HMDB0000718 Isovaleric acid
3-Methyl butyric acid
3-Methyl-N-butyrate
3-Methyl-N-butyric acid
3-Methylbutanoate
3-Methylbutanoic acid
3-Methylbuttersaeure
3-Methylbutyrate
3-Methylbutyric acid
3-Methylbutyric acid: isopropyl-acetate
3-Methylbutyric acid: isopropyl-acetic acid
3-methylbutanoic acid
Delphinate
Delphinic acid
Isobutylformate
Isobutylformic acid
Isopentanoate
Isopentanoic acid
Isopropylacetate
Isopropylacetic acid
Isovalerate
Isovalerianate
Isovalerianic acid
Isovaleriansaeure
b-Methylbutyrate
b-Methylbutyric acid
beta-Methylbutyrate
beta-Methylbutyric acid
beta-methylbutyrate
beta-methylbutyric acid
isovaleric acid
seedM:cpd05178 Isovaleric acid
3-Methylbutanoic acid
Isovalerate
isovalerate
biggM:M_3mb
chebi:24930
chebi:43426
chebi:6069
hmdb:HMDB00718
keggC:M_C08262
seedM:M_cpd05178
secondary/obsolete/fantasy identifier
chebi:28484 isovaleric acid
3-Methylbutanoic acid
3-Methylbuttersaeure
3-methyl-n-butyric acid
3-methylbutanoic acid
3-methylbutyric acid
ISOVALERIC ACID
Isovalerate
Isovaleriansaeure
Isovaleric acid
beta-methylbutyric acid
delphinic acid
isobutylformic acid
isopentanoic acid
isopropylacetic acid
isovalerianic acid
sabiorkM:10362 Isovaleric acid
3-Methylbutanoic acid
3-methylbutyric acid
Isopentanoate
beta-methylbutyric acid
biggM:3mb 3-Methylbutanoic acid
lipidmaps:LMFA01020181 Isovaleric acid
3-methyl-butanoic acid
Delphinic acid
FA(5:0)
Isopentanoic acid
Isopropylacetic acid
Isovalerianic acid
keggC:C08262 3-Methylbutanoic acid
Isovalerate
Isovaleric acid