Feedback

 

isovalerate

Image of MNXM7454
Properties
MNX_IDMNXM7454
formulaC5H9O2
charge-1
mass101.1243
referencechebi:48942
InChIKeyGWYFCOCPABKNJV-UHFFFAOYSA-M
InChIInChI=1S/C5H10O2/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H,6,7)/p-1
SMILESCC(C)CC([O-])=O

This chemical compound does not exist in my selection



Occurrences of isovalerate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3mb 3-Methylbutanoic acid
chebi:48942 3-methyl-n-butyrate
3-methylbutanoate
3-methylbutyrate
GWYFCOCPABKNJV-UHFFFAOYSA-M
beta-methylbutyrate
delphinate
isopentanoate
isopropylacetate
isovalerate
isovalerianate
chebi:24930
chebi:28484
chebi:43426
chebi:6069
3-Methylbutanoic acid
3-Methylbuttersaeure
3-methyl-n-butyric acid
3-methylbutanoic acid
3-methylbutyric acid
GWYFCOCPABKNJV-UHFFFAOYSA-N
ISOVALERIC ACID
Isovalerate
Isovaleriansaeure
Isovaleric acid
beta-methylbutyric acid
delphinic acid
isobutylformic acid
isopentanoic acid
isopropylacetic acid
isovalerianic acid
isovaleric acid
hmdb:HMDB00718 3-methylbutanoic acid
Isovaleric acid
isovaleric acid
kegg:C08262 3-Methylbutanoic acid
Isovalerate
Isovaleric acid
lipidmaps:LMFA01020181 3-methyl-butanoic acid
Isovaleric acid
lipidmaps:LMFA01020181
metacyc:ISOVALERATE ISOVALERATE
isovalerate
sabiork:10362 3-Methylbutanoic acid
3-methylbutyric acid
Isopentanoate
Isovaleric acid
beta-methylbutyric acid
seed:cpd05178 3-Methylbutanoic acid
Isovaleric acid