Feedback

L-1-piperideine-6-carboxylate

Properties
MNX_IDMNXM748
formulaC6H8NO2
charge-1
mass126.13326
referencechebi:58769
Image of MNXM748
InChIKeyCSDPVAKVEWETFG-YFKPBYRVSA-M
InChIInChI=1S/C6H9NO2/c8-6(9)5-3-1-2-4-7-5/h4-5H,1-3H2,(H,8,9)/p-1/t5-/m0/s1
SMILES[O-]C(=O)[C@@H]1CCCC=N1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref19
Distinct compatimentalized reactions in models6

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd00352 delta1-Piperideine-6-L-carboxylate
(S)-2,3,4,5-Tetrahydropyridine-2-carboxylate
(S)-2,3,4,5-tetrahydropiperidine-2-carboxylate
1,6-didehydropiperidine-2-carboxylate
1-piperideine 6-carboxylate
1-piperideine-6-carboxylate
2,3,4,5-Tetrahydropyridine-2-carboxylate
2,3,4,5-tetrahydropyridine-2-carboxylate
delta1-piperideine-6-carboxylate
delta6-piperideine-2-carboxylate
thp2c
biggM:thp2c 2,3,4,5-Tetrahydropyridine-2-carboxylate
hmdb:HMDB0059657 (S)-2,3,4,5-tetrahydropyridine-2-carboxylate
(2S)-2,3,4,5-tetrahydropyridine-2-carboxylic acid
(S)-1-Piperideine-6-carboxylate
(S)-2,3,4,5-Tetrahydropyridine-2-carboxylate
(S)-2,3,4,5-Tetrahydropyridine-2-carboxylic acid
Delta(1)-Piperideine-6-L-carboxylic acid
delta(1)-Piperideine-6-L-carboxylate
delta(1)-piperideine-6-L-carboxylate
delta(1)-piperideine-6-L-carboxylic acid
delta1-Piperideine-6-L-carboxylate
delta1-Piperideine-6-L-carboxylic acid
delta1-piperideine-6-L-carboxylate
delta1-piperideine-6-L-carboxylic acid
chebi:49015 1-piperideine-6-carboxylic acid
2,3,4,5-tetrahydro-2-pyridinecarboxylic acid
2,3,4,5-tetrahydropyridine-2-carboxylic acid
Delta(1)-piperidine-6-carboxylic acid
chebi:16987 1-piperideine-6-carboxylate
2,3,4,5-tetrahydropyridine-2-carboxylate
delta-1-Piperideine-6-carboxylate
hmdb:HMDB0062589 1-piperideine-6-carboxylate
(S)-2,3,4,5-Tetrahydropiperidine-2-carboxylic acid
1,6-Didehydropiperidine-2-carboxylate
1-Piperideine-6-carboxylic acid
2,3,4,5- Tetrahydropyridine-2-carboxylate
2,3,4,5-tetrahydro-2-Pyridinecarboxylate
2,3,4,5-tetrahydro-2-Pyridinecarboxylic acid
2,3,4,5-tetrahydropyridine-2-carboxylic acid
Delta(1)-Piperidine-6-carboxylic acid
Delta1-Piperideine-6-carboxylate
Delta6-Piperideine-2-carboxylate
delta(1)-Piperidine-6-carboxylate
delta(1)-piperidine-6-carboxylate
delta(1)-piperidine-6-carboxylic acid
delta-1-Piperideine-6-carboxylate
keggC:C00450 (S)-2,3,4,5-Tetrahydropyridine-2-carboxylate
Delta1-Piperideine-6-L-carboxylate
sabiorkM:5097 2,3,4,5-Tetrahydropyridine-2-carboxylate
delta1-Piperideine-6-L-carboxylate
chebi:49014 (S)-2,3,4,5-tetrahydropyridine-2-carboxylic acid
(2S)-2,3,4,5-tetrahydropyridine-2-carboxylic acid
(S)-1-piperideine-6-carboxylic acid
Delta(1)-piperideine-6-L-carboxylic acid
delta1-Piperideine-6-L-carboxylate
biggM:M_thp2c
chebi:11409
chebi:19295
chebi:61447
chebi:682
chebi:865
hmdb:HMDB12130
hmdb:HMDB59657
hmdb:HMDB62589
keggC:M_C00450
seedM:M_cpd00352
secondary/obsolete/fantasy identifier
metacycM:CPD-7682 1-piperideine 6-carboxylate
(S)-2,3,4,5-tetrahydropiperidine-2-carboxylate
1,6-didehydropiperidine-2-carboxylate
2,3,4,5-tetrahydropyridine-2-carboxylate
Delta1-piperideine-6-carboxylate
Delta6-piperideine-2-carboxylate
chebi:58769 L-1-piperideine-6-carboxylate
(2S)-2,3,4,5-tetrahydropyridine-2-carboxylate
(S)-1-piperideine-6-carboxylate
(S)-2,3,4,5-tetrahydropyridine-2-carboxylate
Delta(1)-piperideine-6-L-carboxylate
hmdb:HMDB0012130 (S)-2,3,4,5-Tetrahydropiperidine-2-carboxylate
(S)-2,3,4,5-Tetrahydropiperidine-2-carboxylic acid
1,6-Didehydropiperidine-2-carboxylate
1-Piperideine-6-carboxylic acid
2,3,4,5- Tetrahydropyridine-2-carboxylate
2,3,4,5-tetrahydro-2-Pyridinecarboxylate
2,3,4,5-tetrahydro-2-Pyridinecarboxylic acid
2,3,4,5-tetrahydropyridine-2-carboxylic acid
Delta(1)-Piperidine-6-carboxylic acid
Delta1-Piperideine-6-carboxylate
Delta6-Piperideine-2-carboxylate
delta(1)-Piperidine-6-carboxylate
delta(1)-piperidine-6-carboxylate
delta(1)-piperidine-6-carboxylic acid
delta-1-Piperideine-6-carboxylate
MNXM162886is deprecated and replaced by this entry