Feedback

L-1-piperideine-6-carboxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM748Image of MNXM748
#reac
in my sandbox 0
in MNXref (generic)21
in models (compartimentalized) 11
formulaC6H8NO2
charge-1
mass126.05605
referencechebi:58769
InChIKeyCSDPVAKVEWETFG-YFKPBYRVSA-M
InChIInChI=1S/C6H9NO2/c8-6(9)5-3-1-2-4-7-5/h4-5H,1-3H2,(H,8,9)/p-1/t5-/m0/s1
SMILESO=C([O-])[C@@H]1CCCC=N1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58769
chebi:58769
L-1-piperideine-6-carboxylate
(2S)-2,3,4,5-tetrahydropyridine-2-carboxylate
(S)-1-piperideine-6-carboxylate
(S)-2,3,4,5-tetrahydropyridine-2-carboxylate
Delta(1)-piperideine-6-L-carboxylate
kegg.compound:C00450
keggC:C00450
(S)-2,3,4,5-Tetrahydropyridine-2-carboxylate
Delta1-Piperideine-6-L-carboxylate
CHEBI:49014
chebi:49014
(S)-2,3,4,5-tetrahydropyridine-2-carboxylic acid
(2S)-2,3,4,5-tetrahydropyridine-2-carboxylic acid
(S)-1-piperideine-6-carboxylic acid
Delta(1)-piperideine-6-L-carboxylic acid
delta1-Piperideine-6-L-carboxylate
metacyc.compound:CPD-7682
metacycM:CPD-7682
1-piperideine 6-carboxylate
(S)-2,3,4,5-tetrahydropiperidine-2-carboxylate
1,6-didehydropiperidine-2-carboxylate
2,3,4,5-tetrahydropyridine-2-carboxylate
Delta1-piperideine-6-carboxylate
Delta6-piperideine-2-carboxylate
CHEBI:16987
chebi:16987
1-piperideine-6-carboxylate
2,3,4,5-tetrahydropyridine-2-carboxylate
delta-1-Piperideine-6-carboxylate
CHEBI:49015
chebi:49015
1-piperideine-6-carboxylic acid
2,3,4,5-tetrahydro-2-pyridinecarboxylic acid
2,3,4,5-tetrahydropyridine-2-carboxylic acid
Delta(1)-piperidine-6-carboxylic acid
hmdb:HMDB0012130 2,3,4,5-Tetrahydro-2-pyridinecarboxylic acid
(2S)-2,3,4,5-Tetrahydro-2-pyridinecarboxylic acid
(2S)-2,3,4,5-tetrahydropyridine-2-carboxylic acid
(S)-1-Piperideine-6-carboxylate
(S)-2,3,4,5-Tetrahydro-2-pyridinecarboxylic acid
(S)-2,3,4,5-Tetrahydropiperidine-2-carboxylate
(S)-2,3,4,5-Tetrahydropiperidine-2-carboxylic acid
(S)-2,3,4,5-Tetrahydropyridine-2-carboxylate
(S)-2,3,4,5-Tetrahydropyridine-2-carboxylic acid
1-Piperideine-6-carboxylate
1-Piperideine-6-carboxylic acid
2,3,4,5-Tetrahydropicolinic acid
2,3,4,5-tetrahydro-2-pyridinecarboxylate
Delta(1)-Piperideine-6-L-carboxylic acid
delta(1)-Piperideine-6-L-carboxylate
delta(1)-piperideine-6-L-carboxylate
delta(1)-piperideine-6-L-carboxylic acid
delta1-Piperideine-6-L-carboxylate
delta1-Piperideine-6-L-carboxylic acid
delta1-Piperideine-6-carboxylate
delta1-Piperideine-6-carboxylic acid
delta1-Piperidine-6-carboxylate
delta1-Piperidine-6-carboxylic acid
delta1-piperideine-6-L-carboxylate
delta1-piperideine-6-L-carboxylic acid
delta1-piperideine-6-carboxylate
delta1-piperideine-6-carboxylic acid
delta1-piperidine-6-carboxylate
delta1-piperidine-6-carboxylic acid
bigg.metabolite:thp2c
biggM:thp2c
2,3,4,5-Tetrahydropyridine-2-carboxylate
sabiork.compound:5097
sabiorkM:5097
2,3,4,5-Tetrahydropyridine-2-carboxylate
delta1-Piperideine-6-L-carboxylate
seed.compound:cpd00352
seedM:cpd00352
delta1-Piperideine-6-L-carboxylate
(S)-2,3,4,5-Tetrahydropyridine-2-carboxylate
(S)-2,3,4,5-tetrahydropiperidine-2-carboxylate
1,6-didehydropiperidine-2-carboxylate
1-piperideine 6-carboxylate
1-piperideine-6-carboxylate
2,3,4,5-Tetrahydropyridine-2-carboxylate
2,3,4,5-tetrahydropyridine-2-carboxylate
delta1-piperideine-6-carboxylate
delta6-piperideine-2-carboxylate
thp2c
hmdb:HMDB0059657
hmdb:HMDB0062589
hmdb:HMDB12130
hmdb:HMDB59657
hmdb:HMDB62589
chebi:11409
chebi:19295
chebi:61447
chebi:682
chebi:865
biggM:M_thp2c
keggC:M_C00450
seedM:M_cpd00352
secondary/obsolete/fantasy identifier