Feedback

L-tyrosine

PropertiesImageOccurences in reactions
MNX_IDMNXM76Image of MNXM76
#reac
in my sandbox 0
in MNXref (generic)329
in models (compartimentalized) 249
formulaC9H11NO3
charge0
mass181.18858
referencechebi:58315
InChIKeyOUYCCCASQSFEME-QMMMGPOBSA-N
InChIInChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1
SMILES[NH3+][C@@H](Cc1ccc(O)cc1)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-29506
reactomeM:R-ALL-29506
reactome:R-ALL-352030
reactomeM:R-ALL-352030
reactome:R-ALL-379710
reactomeM:R-ALL-379710
reactome:R-ALL-5668567
reactomeM:R-ALL-5668567
CHEBI:58315
chebi:58315
L-tyrosine
(2S)-2-ammonio-3-(4-hydroxyphenyl)propanoate
(2S)-2-azaniumyl-3-(4-hydroxyphenyl)propanoate
L-tyrosine zwitterion
seed.compound:cpd30745
seedM:cpd30745
DL-Tyrosine
2-Amino-3-(p-hydroxyphenyl)propionic acid
3-(p-Hydroxyphenyl)alanine
bigg.metabolite:tyr__L
biggM:tyr__L
envipath:...6bd3196c0365
envipathM:...6bd3196c0365
L-Tyrosine
hmdb:HMDB0000158 L-Tyrosine
(-)-a-amino-P-Hydroxyhydrocinnamate
(-)-a-amino-P-Hydroxyhydrocinnamic acid
(-)-alpha-amino-P-Hydroxyhydrocinnamate
(-)-alpha-amino-P-Hydroxyhydrocinnamic acid
(-)-alpha-amino-P-hydroxyhydrocinnamate
(-)-alpha-amino-P-hydroxyhydrocinnamic acid
(2S)-2-amino-3-(4-Hydroxyphenyl)propanoate
(2S)-2-amino-3-(4-Hydroxyphenyl)propanoic acid
(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid
(S)-(-)-Tyrosine
(S)-2-amino-3-(P-Hydroxyphenyl)propionate
(S)-2-amino-3-(P-Hydroxyphenyl)propionic acid
(S)-3-(P-Hydroxyphenyl)alanine
(S)-Tyrosine
(S)-a-amino-4-Hydroxy-benzenepropanoate
(S)-a-amino-4-Hydroxy-benzenepropanoic acid
(S)-a-amino-4-Hydroxybenzenepropanoate
(S)-a-amino-4-Hydroxybenzenepropanoic acid
(S)-alpha-amino-4-Hydroxy-benzenepropanoate
(S)-alpha-amino-4-Hydroxy-benzenepropanoic acid
(S)-alpha-amino-4-Hydroxybenzenepropanoate
(S)-alpha-amino-4-Hydroxybenzenepropanoic acid
(S)-alpha-amino-4-hydroxybenzenepropanoate
(S)-alpha-amino-4-hydroxybenzenepropanoic acid
2-amino-3-(4-Hydroxyphen yl)-2-amino-3-(4-hydroxyphenyl)-propanoate
2-amino-3-(4-Hydroxyphen yl)-2-amino-3-(4-hydroxyphenyl)-propanoic acid
3-(4-Hydroxyphenyl)-L-alanine
4-Hydroxy-L-phenylalanine
Benzenepropanoate
Benzenepropanoic acid
L Tyrosine
L-P-Tyrosine
L-Tyrosin
L-tyrosine
P-Tyrosine
Para tyrosine
Para-tyrosine
TYROSINE
Tyr
Tyrosine, L isomer
Tyrosine, L-isomer
Y
seed.compound:cpd00069
seedM:cpd00069
L-Tyrosine
(S)-2-Amino-3-(p-hydroxyphenyl)propionic acid
(S)-3-(p-Hydroxyphenyl)alanine
L-tyr
L-tyrosine
Tyrosine
tyr
tyr-L
tyrosine
sabiork.compound:84
sabiorkM:84
L-Tyrosine
(S)-2-Amino-3-(p-hydroxyphenyl)propionic acid
(S)-3-(p-Hydroxyphenyl)alanine
Tyr
kegg.compound:C00082
keggC:C00082
L-Tyrosine
(S)-2-Amino-3-(p-hydroxyphenyl)propionic acid
(S)-3-(p-Hydroxyphenyl)alanine
Tyrosine
CHEBI:32760
chebi:32760
L-tyrosinate(1-)
(2S)-2-amino-3-(4-hydroxyphenyl)propanoate
L-tyrosine anion
L-tyrosine monoanion
hydrogen L-tyrosinate
CHEBI:32761
chebi:32761
L-tyrosinate(2-)
(2S)-2-amino-3-(4-oxidophenyl)propanoate
L-tyrosinate
L-tyrosine dianion
CHEBI:17895
chebi:17895
L-tyrosine
(-)-alpha-amino-p-hydroxyhydrocinnamic acid
(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid
(S)-(-)-Tyrosine
(S)-2-Amino-3-(p-hydroxyphenyl)propionic acid
(S)-3-(p-Hydroxyphenyl)alanine
(S)-Tyrosine
(S)-alpha-amino-4-hydroxybenzenepropanoic acid
4-hydroxy-L-phenylalanine
L-Tyrosin
L-Tyrosine
TYROSINE
Tyr
Tyrosine
Y
metacyc.compound:TYR
metacycM:TYR
L-tyrosine
L-tyr
Y
tyr
tyrosine
CHEBI:32762
chebi:32762
L-tyrosinium
(1S)-1-carboxy-2-(4-hydroxyphenyl)ethanaminium
L-tyrosine cation
kegg.drug:D00022
keggD:D00022
Tyrosine (USP/INN)
L-Tyrosine (JP17)
sabiork.compound:2291
sabiorkM:2291
kegg.compound:C01536
keggC:C01536
Tyrosine
2-Amino-3-(p-hydroxyphenyl)propionic acid
3-(p-Hydroxyphenyl)alanine
CHEBI:32784
chebi:32784
tyrosinate(1-)
2-amino-3-(4-hydroxyphenyl)propanoate
hydrogen tyrosinate
tyrosine anion
CHEBI:32785
chebi:32785
tyrosinate(2-)
2-amino-3-(4-oxidophenyl)propanoate
tyrosinate
tyrosine dianion
CHEBI:18186
chebi:18186
tyrosine
2-Amino-3-(p-hydroxyphenyl)propionic acid
2-amino-3-(4-hydroxyphenyl)propanoic acid
3-(p-Hydroxyphenyl)alanine
Tyr
Tyrosin
Tyrosine
Y
tirosina
CHEBI:32786
chebi:32786
tyrosinium
1-carboxy-2-(4-hydroxyphenyl)ethanaminium
tyrosine cation
biggM:tyr-L
hmdb:HMDB0000647
hmdb:HMDB00158
hmdb:HMDB00647
chebi:13181
chebi:15277
chebi:21411
chebi:27176
chebi:46070
chebi:46161
chebi:6313
chebi:9800
biggM:M_tyr__L
keggC:M_C00082
keggC:M_C01536
keggD:M_D00022
seedM:M_cpd00069
seedM:M_cpd30745
secondary/obsolete/fantasy identifier