Feedback

phenylglyoxylate

Properties
MNX_IDMNXM764
formulaC8H5O3
charge-1
mass149.1235
referencechebi:36656
Image of MNXM764
InChIKeyFAQJJMHZNSSFSM-UHFFFAOYSA-M
InChIInChI=1S/C8H6O3/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5H,(H,10,11)/p-1
SMILES[O-]C(=O)C(=O)c1ccccc1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref17
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd01447 Benzoylformate
2-Oxo-2-phenylacetate
2-oxo-2-phenylacetate
Benzoylformic acid
Phenylglyoxylate
Phenylglyoxylic acid
alpha-Oxo-benzeneacetic acid
benz
benzoylformate
benzoylformic acid
phenylglyoxylate
phenylglyoxylic acid
chebi:36656 phenylglyoxylate
benzoylformic acid anion
oxo(phenyl)acetate
phenylglyoxylic acid anion
chebi:18280 phenylglyoxylic acid
2-Oxo-2-phenylacetate
2-oxo-2-phenylacetic acid
2-phenylethanoic acid
BENZOYL-FORMIC ACID
Benzoylformate
Benzoylformic acid
Phenylglyoxylate
Phenylglyoxylic acid
alpha-Oxo-benzeneacetic acid
alpha-ketophenylacetic acid
benzeneglyoxylic acid
oxo(phenyl)acetic acid
hmdb:HMDB0001587 Phenylglyoxylic acid
2-Phenylethanoate
2-Phenylethanoic acid
2-oxo-2-Phenylacetate
2-oxo-2-Phenylacetic acid
2-oxo-2-phenylacetic acid
BENZOYL-formIC ACID
BENZOYL-formate
Benzeneglyoxylate
Benzeneglyoxylic acid
Benzoylformate
Benzoylformic acid
Oxophenylacetic acid
Phenylgloxylic acid
Phenylglyoxilic acid
Phenylglyoxylate
Phenylglyoxylic acid, calcium salt
Phenylglyoxylic acid, potassium salt
Phenylglyoxylic acid, sodium salt
Phenylglyoxylic hydrochloride
Phenyloxoacetic acid
a-Ketophenylacetate
a-Ketophenylacetic acid
a-Oxobenzeneacetic acid
a-oxo-Benzeneacetate
a-oxo-Benzeneacetic acid
alpha-Ketophenylacetate
alpha-Ketophenylacetic acid
alpha-Oxobenzeneacetic acid
alpha-ketophenylacetate
alpha-ketophenylacetic acid
alpha-oxo-Benzeneacetate
alpha-oxo-Benzeneacetic acid
alpha-oxo-benzeneacetate
alpha-oxo-benzeneacetic acid
benzoylformic acid
metacycM:PHENYLGLYOXYLATE phenylglyoxylate
2-oxo-2-phenylacetate
benzoylformate
benzoylformic acid
phenylglyoxylic acid
envipath:...2069dbecb424 Benzoylformate
chebi:10323
chebi:13885
chebi:14783
chebi:25991
chebi:25993
chebi:39582
hmdb:HMDB01587
keggC:M_C02137
seedM:M_cpd01447
secondary/obsolete/fantasy identifier
keggC:C02137
sabiorkM:6022
alpha-Oxo-benzeneacetic acid
2-Oxo-2-phenylacetate
Benzoylformate
Benzoylformic acid
Phenylglyoxylate
Phenylglyoxylic acid