|
![]() |
InChIKey | VHKNBDIQDAXGBL-UHFFFAOYSA-M |
InChI | InChI=1S/C5H6O4/c6-3-1-2-4(7)5(8)9/h3H,1-2H2,(H,8,9)/p-1 |
SMILES | [O-]C(=O)C(=O)CCC=O |
#reac | |
---|---|
Distinct reactions in my sandbox | 0 |
Distinct generic reactions in MNXref | 9 |
Distinct compatimentalized reactions in models | 4 |
Identifier | Description |
---|---|
chebi:58136 | 2,5-dioxopentanoate |
hmdb:HMDB0060365 | 2,5-Dioxopentanoate 2,5-dioxopentanoic acid 2-Oxoglutarate semialdehyde 2-Oxoglutaric acid semialdehyde 2-oxoglutarate semialdehyde |
seedM:cpd00340 | 2,5-Dioxopentanoate 2,5-dioxopentanoate 2-Oxoglutarate semialdehyde 2-ketoglutarate semialdehyde 2-oxoglutarate semialdehyde 25dop alpha-ketoglutarate semialdehyde |
chebi:17415 | 2,5-dioxopentanoic acid 2,5-Dioxopentanoate 2-Oxoglutarate semialdehyde |
envipath:...ae2b20fea3e6 | compound 1247 |
biggM:M_25dop chebi:11454 chebi:19385 chebi:938 hmdb:HMDB60365 keggC:M_C00433 seedM:M_cpd00340 | secondary/obsolete/fantasy identifier |
biggM:25dop | 2 5 Dioxopentanoate |
sabiorkM:5091 | 2,5-Dioxopentanoate 2-Oxoglutarate semialdehyde alpha-Ketoglutarate semialdehyde alpha-Ketoglutaric semialdehyde |
keggC:C00433 | 2,5-Dioxopentanoate 2-Oxoglutarate semialdehyde |
metacycM:CPD-654 | 2,5-dioxopentanoate 2-ketoglutarate semialdehyde 2-oxoglutarate semialdehyde alpha-ketoglutarate semialdehyde |
MNXM165561 | is deprecated and replaced by this entry |
MNXM723763 | is deprecated and replaced by this entry |