Feedback

6-hydroxynicotinate

PropertiesImageOccurences in reactions
MNX_IDMNXM773Image of MNXM773
#reac
in my sandbox 0
in MNXref (generic)20
in models (compartimentalized) 8
formulaC6H4NO3
charge-1
mass138.01967
referencechebi:57664
InChIKeyBLHCMGRVFXRYRN-UHFFFAOYSA-M
InChIInChI=1S/C6H5NO3/c8-5-2-1-4(3-7-5)6(9)10/h1-3H,(H,7,8)(H,9,10)/p-1
SMILESO=C([O-])c1ccc(O)nc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57664
chebi:57664
6-hydroxynicotinate
6-hydroxynicotinate anion
6-hydroxynicotinate(1-)
6-hydroxypyridine-3-carboxylate
bigg.metabolite:6hnac
biggM:6hnac
6-Hydroxynicotinate
kegg.compound:C01020
keggC:C01020
6-Hydroxynicotinate
6-Hydroxynicotinic acid
seed.compound:cpd00752
seedM:cpd00752
6-Hydroxynicotinate
6-Hydroxynicotinic acid
6-hydroxy-nicotinate
6-hydroxynicotinate
6hnac
Nicotinic acid, 1,6-dihydro-6-oxo-
hmdb:HMDB0002658 6-Hydroxynicotinic acid
1,6-Dihydro-6-oxo-3-pyridinecarboxylic acid
1,6-Dihydro-6-oxo-nicotinic acid
2-Hydroxy-5-carboxypyridine
2-Hydroxypyridine-5-carboxylic acid
2-Pyridone-5-carboxylic acid
5-Carboxy-2-pyridone
6-Hydroxy-nicotinic acid
6-Hydroxyniacin
6-Hydroxynicotinate
6-Hydroxypyridine-3-carboxylic acid
6-hydroxynicotinic acid
6-hydroxypyridine-3-carboxylic acid
metacyc.compound:6-HYDROXY-NICOTINATE
metacycM:6-HYDROXY-NICOTINATE
6-hydroxynicotinate
6-hydroxy-nicotinate
Nicotinic acid, 1,6-dihydro-6-oxo-
CHEBI:16168
chebi:16168
6-hydroxynicotinic acid
6-Hydroxynicotinate
6-Hydroxynicotinic acid
6-hydroxypyridine-3-carboxylic acid
hmdb:HMDB02658
chebi:12219
chebi:20731
chebi:2200
biggM:M_6hnac
keggC:M_C01020
seedM:M_cpd00752
secondary/obsolete/fantasy identifier