Feedback

6-hydroxynicotinate

Properties
MNX_IDMNXM773
formulaC6H4NO3
charge-1
mass138.1009
referencechebi:57664
Image of MNXM773
InChIKeyBLHCMGRVFXRYRN-UHFFFAOYSA-M
InChIInChI=1S/C6H5NO3/c8-5-2-1-4(3-7-5)6(9)10/h1-3H,(H,7,8)(H,9,10)/p-1
SMILESOc1ccc(cn1)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref20
Distinct compatimentalized reactions in models6

Similar chemical compounds in external resources
IdentifierDescription
keggC:C01020 6-Hydroxynicotinate
6-Hydroxynicotinic acid
seedM:cpd00752 6-Hydroxynicotinate
6-Hydroxynicotinic acid
6-hydroxy-nicotinate
6-hydroxynicotinate
6hnac
Nicotinic acid, 1,6-dihydro-6-oxo-
hmdb:HMDB0002658 6-Hydroxynicotinic acid
1,6-dihydro-6-oxo-3-Pyridinecarboxylic acid
1,6-dihydro-6-oxo-Nicotinic acid
2-Hydroxy-5-carboxypyridine
2-Hydroxypyridine-5-carboxylic acid
2-Pyridone-5-carboxylic acid
5-Carboxy-2-pyridone
6-Hydroxy-nicotinic acid
6-Hydroxyniacin
6-Hydroxynicotinate
6-Hydroxypyridine-3-carboxylic acid
6-hydroxynicotinic acid
6-hydroxypyridine-3-carboxylic acid
chebi:57664 6-hydroxynicotinate
6-hydroxynicotinate anion
6-hydroxynicotinate(1-)
6-hydroxypyridine-3-carboxylate
chebi:16168 6-hydroxynicotinic acid
6-Hydroxynicotinate
6-Hydroxynicotinic acid
6-hydroxypyridine-3-carboxylic acid
metacycM:6-HYDROXY-NICOTINATE 6-hydroxynicotinate
6-hydroxy-nicotinate
Nicotinic acid, 1,6-dihydro-6-oxo-
biggM:6hnac 6-Hydroxynicotinate
biggM:M_6hnac
chebi:12219
chebi:20731
chebi:2200
hmdb:HMDB02658
keggC:M_C01020
seedM:M_cpd00752
secondary/obsolete/fantasy identifier