Feedback

5-aminopentanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM792Image of MNXM792
#reac
in my sandbox 0
in MNXref (generic)21
in models (compartimentalized) 13
formulaC5H11NO2
charge0
mass117.07898
referencechebi:356010
InChIKeyJJMDCOVWQOJGCB-UHFFFAOYSA-N
InChIInChI=1S/C5H11NO2/c6-4-2-1-3-5(7)8/h1-4,6H2,(H,7,8)
SMILES[NH3+]CCCCC(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:356010
chebi:356010
5-aminopentanoate
5-aminopentanoic acid zwitterion
5-ammoniopentanoate
5-azaniumylpentanoate
bigg.metabolite:5aptn
biggM:5aptn
5-Aminopentanoate
sabiork.compound:5090
sabiorkM:5090
kegg.compound:C00431
keggC:C00431
5-Aminopentanoate
5-Aminopentanoic acid
5-Aminovaleric acid
seed.compound:cpd00339
seedM:cpd00339
5-Aminopentanoate
5-Aminopentanoic acid
5-Aminovaleric acid
5-aminopentanoate
5-aminopentanoic acid
5-aminovalerate
5-aminovaleric acid
5aptn
d-amino-N-valeric acid
d-amino-valeric acid
delta-amino-N-valerate
delta-aminovalerate
hmdb:HMDB0003355 5-Aminopentanoic acid
5-Amino-N-valerate
5-Amino-N-valeric acid
5-Amino-pentanoate
5-Aminopentanoate
5-Aminovalerate
5-Aminovaleric acid
5-Aminovaleric acid hydrochloride
5-aminopentanoic acid
5-aminovaleric acid
DANVA
delta-Amino-N-valerate
delta-Amino-N-valeric acid
delta-Aminovalerate
delta-Aminovaleric acid
delta-amino-N-valerate
delta-amino-N-valeric acid
delta-aminovalerate
delta-aminovaleric acid
lipidmaps:LMFA01100040
lipidmapsM:LMFA01100040
5-amino-pentanoic acid
5-Aminopentanoic acid
5-amino-pentanoic acid
metacyc.compound:5-AMINOPENTANOATE
metacycM:5-AMINOPENTANOATE
5-aminopentanoate
5-aminopentanoic acid
5-aminovalerate
5-aminovaleric acid
delta-amino-N-valerate
delta-amino-N-valeric acid
delta-amino-valeric acid
delta-aminovalerate
delta-aminovaleric acid
CHEBI:86394
chebi:86394
5-aminopentanoate
5-aminovalerate
delta-aminovalerate
CHEBI:15887
chebi:15887
5-aminopentanoic acid
5-Aminopentanoate
5-Aminopentanoic acid
5-Aminovaleric acid
5-amino-n-valeric acid
DANVA
delta-Amino-n-valeric acid
delta-aminovaleric acid
envipath:...9cbcbeb42287
envipathM:...9cbcbeb42287
compound 38211
hmdb:HMDB03355
chebi:12111
chebi:2037
chebi:20549
chebi:41853
biggM:M_5aptn
keggC:M_C00431
seedM:M_cpd00339
secondary/obsolete/fantasy identifier