Feedback

5-aminopentanoate

Properties
MNX_IDMNXM792
formulaC5H11NO2
charge0
mass117.14638
referencechebi:356010
Image of MNXM792
InChIKeyJJMDCOVWQOJGCB-UHFFFAOYSA-N
InChIInChI=1S/C5H11NO2/c6-4-2-1-3-5(7)8/h1-4,6H2,(H,7,8)
SMILES[NH3+]CCCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref20
Distinct compatimentalized reactions in models12

Similar chemical compounds in external resources
IdentifierDescription
chebi:86394 5-aminopentanoate
5-aminovalerate
delta-aminovalerate
lipidmaps:LMFA01100040 5-amino-pentanoic acid
5-Aminopentanoic acid
5-amino-pentanoic acid
chebi:15887 5-aminopentanoic acid
5-Aminopentanoate
5-Aminopentanoic acid
5-Aminovaleric acid
5-amino-n-valeric acid
DANVA
delta-Amino-n-valeric acid
delta-aminovaleric acid
envipath:...9cbcbeb42287 compound 38211
seedM:cpd00339 5-Aminopentanoate
5-Aminopentanoic acid
5-Aminovaleric acid
5-aminopentanoate
5-aminopentanoic acid
5-aminovalerate
5-aminovaleric acid
5aptn
d-amino-N-valeric acid
d-amino-valeric acid
delta-amino-N-valerate
delta-aminovalerate
metacycM:5-AMINOPENTANOATE 5-aminopentanoate
5-aminopentanoic acid
5-aminovalerate
5-aminovaleric acid
d-amino-N-valeric acid
d-amino-valeric acid
delta-amino-N-valerate
delta-aminovalerate
chebi:356010 5-aminopentanoate
5-aminopentanoic acid zwitterion
5-ammoniopentanoate
5-azaniumylpentanoate
hmdb:HMDB0003355 5-Aminopentanoic acid
5-Aminopentanoate
5-Aminovalerate
5-Aminovaleric acid
5-Aminovaleric acid hydrochloride
5-amino-N-Valerate
5-amino-N-Valeric acid
5-aminopentanoic acid
5-aminovaleric acid
DANVA
delta-Aminovalerate
delta-Aminovaleric acid
delta-amino-N-Valerate
delta-amino-N-Valeric acid
delta-amino-N-valerate
delta-amino-N-valeric acid
delta-aminovalerate
delta-aminovaleric acid
biggM:5aptn 5-Aminopentanoate
biggM:M_5aptn
chebi:12111
chebi:2037
chebi:20549
chebi:41853
hmdb:HMDB03355
keggC:M_C00431
seedM:M_cpd00339
secondary/obsolete/fantasy identifier
keggC:C00431
sabiorkM:5090
5-Aminopentanoate
5-Aminopentanoic acid
5-Aminovaleric acid
MNXM724026is deprecated and replaced by this entry