Feedback

 

(S,S)-tartrate

Image of MNXM7948
Properties
MNX_IDMNXM7948
formulaC4H4O6
charge-2
mass148.0721
referencechebi:30927
InChIKeyFEWJPZIEWOKRBE-LWMBPPNESA-L
InChIInChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/p-2/t1-,2-/m0/s1
SMILESO[C@@H]([C@H](O)C([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (S,S)-tartrate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:tartr__D D-tartrate
chebi:15672
chebi:18806
chebi:446
chebi:45873
(-)-(S,S)-tartaric acid
(-)-D-tartaric acid
(-)-Tartaric acid
(-)-Weinsaeure
(-)-tartaric acid
(2S,3S)-(-)-tartaric acid
(2S,3S)-2,3-dihydroxybutanedioic acid
(2S,3S)-Tartaric acid
(2S,3S)-tartaric acid
(S,S)-(-)-tartaric acid
(S,S)-Tartaric acid
D(-)-TARTARIC ACID
D-(-)-tartaric acid
D-Tartaric acid
D-tartaric acid
D-threaric acid
FEWJPZIEWOKRBE-LWMBPPNESA-N
Linksweinsaeure
chebi:11077
chebi:18807
chebi:30927
(-)-tartrate
(2S,3S)-2,3-dihydroxybutanedioate
(2S,3S)-2,3-dihydroxysuccinate
(2S,3S)-tartrate
(S,S)-tartrate
D-tartrate(2-)
D-threarate
FEWJPZIEWOKRBE-LWMBPPNESA-L
chebi:35399 (2S,3S)-3-carboxy-2,3-dihydroxypropanoate
D-tartrate(1-)
FEWJPZIEWOKRBE-LWMBPPNESA-M
hmdb:HMDB29878 (2S,3S)-2,3-dihydroxybutanedioic acid
D-Tartaric acid
D-tartaric acid
metacyc:D-TARTRATE (-)-tartaric acid
(-)-tartrate
(2S,3S)-tartaric acid
(2S,3S)-tartrate
(S,S)-tartaric acid
(S,S)-tartrate
D-TARTRATE
D-tartarate
D-tartaric acid
D-tartrate
kegg:C02107
sabiork:3875
(-)-Tartaric acid
(2S,3S)-Tartaric acid
(S,S)-Tartaric acid
(S,S)-Tartrate
D-Tartaric acid
D-Tartrate
seed:cpd19018 (-)-Tartaric acid
(-)-tartaric acid
(-)-tartrate
(2S,3S)-Tartaric acid
(2S,3S)-tartaric acid
(2S,3S)-tartrate
(S,S)-Tartaric acid
(S,S)-Tartrate
(S,S)-tartaric acid
(S,S)-tartrate
D-Tartaric acid
D-Tartrate
D-tartarate
D-tartaric acid
D-tartrate