Feedback

isochorismate

PropertiesImageOccurences in reactions
MNX_IDMNXM799Image of MNXM799
#reac
in my sandbox 0
in MNXref (generic)17
in models (compartimentalized) 15
formulaC10H8O6
charge-2
mass224.03319
referencechebi:29780
InChIKeyNTGWPRCCOQCMGE-YUMQZZPRSA-L
InChIInChI=1S/C10H10O6/c1-5(9(12)13)16-7-4-2-3-6(8(7)11)10(14)15/h2-4,7-8,11H,1H2,(H,12,13)(H,14,15)/p-2/t7-,8-/m0/s1
SMILESC=C(O[C@H]1C=CC=C(C(=O)[O-])[C@@H]1O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:29780
chebi:29780
isochorismate
(5S,6S)-5-[(1-carboxylatoethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylate
Isochorismate
isochorismate(2-)
bigg.metabolite:ichor
biggM:ichor
SLM:000485363
slm:000485363
Isochorismate
sabiork.compound:5298
sabiorkM:5298
kegg.compound:C00885
keggC:C00885
Isochorismate
Isochorismic acid
seed.compound:cpd00658
seedM:cpd00658
Isochorismate
Isochorismic acid
ichor
isochorismate
metacyc.compound:ISOCHORISMATE
metacycM:ISOCHORISMATE
isochorismate
Isochorismic acid
CHEBI:17582
chebi:17582
isochorismic acid
(5S,6S)-5-[(1-carboxyethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylic acid
Isochorismic acid
chebi:14464
chebi:24883
chebi:5997
biggM:M_ichor
keggC:M_C00885
seedM:M_cpd00658
secondary/obsolete/fantasy identifier