Feedback

 

isochorismate

Image of MNXM799
Properties
MNX_IDMNXM799
formulaC10H8O6
charge-2
mass224.168
referencechebi:29780
InChIKeyNTGWPRCCOQCMGE-YUMQZZPRSA-L
InChIInChI=1S/C10H10O6/c1-5(9(12)13)16-7-4-2-3-6(8(7)11)10(14)15/h2-4,7-8,11H,1H2,(H,12,13)(H,14,15)/p-2/t7-,8-/m0/s1
SMILESO[C@@H]1[C@@H](OC(=C)C([O-])=O)C=CC=C1C([O-])=O

This chemical compound does not exist in my selection



Occurrences of isochorismate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:ichor Isochorismate
chebi:14464
chebi:17582
chebi:24883
chebi:5997
(5S,6S)-5-[(1-carboxyethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylic acid
Isochorismic acid
NTGWPRCCOQCMGE-YUMQZZPRSA-N
isochorismic acid
chebi:29780 (5S,6S)-5-[(1-carboxylatoethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylate
Isochorismate
NTGWPRCCOQCMGE-YUMQZZPRSA-L
isochorismate
isochorismate(2-)
metacyc:ISOCHORISMATE ISOCHORISMATE
Isochorismic acid
isochorismate
kegg:C00885
sabiork:5298
Isochorismate
Isochorismic acid
seed:cpd00658 Isochorismate
Isochorismic acid
ichor