This is version 4.2 of MetaNetX/MNXref
 Feedback

3-(carbamoylamino)propanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM802Image of MNXM802
#reac
in my sandbox 0
in MNXref (generic)8
in models (compartimentalized) 6
formulaC4H7N2O3
charge-1
mass131.11006
referencechebi:11892
InChIKeyJSJWCHRYRHKBBW-UHFFFAOYSA-M
InChIInChI=1S/C4H8N2O3/c5-4(9)6-2-1-3(7)8/h1-2H2,(H,7,8)(H3,5,6,9)/p-1
SMILESNC(=O)NCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:11892
chebi:11892
3-(carbamoylamino)propanoate
3-[(aminocarbonyl)amino]propanoate
3-ureidopropanoate
3-ureidopropionate
N-carbamoyl-beta-alaninate
ureidopropanoate
ureidopropionate
seed.compound:cpd01720
seedM:cpd01720
3-Ureidopropanoate
3-Ureidopropionate
3-ureidopropanoate
3-ureidopropionate
N-Carbamoyl-beta-alanine
N-carbamoyl-beta-alanine
beta-Ureidopropionic acid
beta-ureidopropionic acid
cala
kegg.compound:C02642
keggC:C02642
3-Ureidopropionate
3-Ureidopropanoate
N-Carbamoyl-beta-alanine
beta-Ureidopropionic acid
metacyc.compound:3-UREIDO-PROPIONATE
metacycM:3-UREIDO-PROPIONATE
3-ureidopropanoate
3-ureidopropionate
N-carbamoyl-beta-alanine
beta-ureidopropionic acid
bigg.metabolite:cala
biggM:cala
N-Carbamoyl-beta-alanine
sabiork.compound:2475
sabiorkM:2475
N-Carbamoyl-beta-alanine
3-Ureidopropanoate
3-Ureidopropionate
beta-Ureidopropionic acid
hmdb:HMDB0062812 N-carbamoyl-beta-alaninate
3-(carbamoylamino)Propanoate
3-(carbamoylamino)Propanoic acid
3-(carbamoylamino)propanoic acid
3-Ureidopropanoate
3-Ureidopropanoic acid
3-Ureidopropionate
3-Ureidopropionic acid
3-[(Aminocarbonyl)amino]propanoate
3-[(Aminocarbonyl)amino]propanoic acid
3-ureido-Propionate
Carbamoyl-b-ala-OH
Carbamoyl-beta-ala-OH
Ion(-1) OF N-carbamoyl-beta-alanine
N-(AMINOCARBONYL)-BETA-alanine
N-(AMINOCARBONYL)-b-alanine
N-(AMINOCARBONYL)-beta-alanine
N-(Aminocarbonyl)-'b-alanine
N-Carbamoyl-b-alanine
N-Carbamoyl-beta-alanine
N-Carbamyl-b-alanine
N-Carbamyl-beta-alanine
Ureidopropanoate
Ureidopropanoic acid
Ureidopropionate
b-Ureidopropionate
b-Ureidopropionic acid
beta-Ureidopropionate
beta-Ureidopropionic acid
beta-ureidopropionate
beta-ureidopropionic acid
ureidopropionic acid
reactome:R-ALL-73588
reactomeM:R-ALL-73588
CHEBI:18261
chebi:18261
N-carbamoyl-beta-alanine
3-(carbamoylamino)propanoic acid
3-Ureidopropanoate
3-Ureidopropionate
3-Ureidopropionic acid
3-[(aminocarbonyl)amino]propanoic acid
3-ureidopropanoic acid
N-(AMINOCARBONYL)-BETA-ALANINE
N-(aminocarbonyl)-beta-alanine
N-Carbamoyl-beta-alanine
Ureidopropanoic acid
Ureidopropionic acid
beta-Ureidopropionic acid
hmdb:HMDB0000026 Ureidopropionic acid
3-(carbamoylamino)Propanoate
3-(carbamoylamino)Propanoic acid
3-(carbamoylamino)propanoic acid
3-Ureidopropanoate
3-Ureidopropanoic acid
3-Ureidopropionate
3-Ureidopropionic acid
3-[(Aminocarbonyl)amino]propanoate
3-[(Aminocarbonyl)amino]propanoic acid
3-ureido-Propionate
Carbamoyl-b-ala-OH
Carbamoyl-beta-ala-OH
Ion(-1) OF N-carbamoyl-beta-alanine
N-(AMINOCARBONYL)-BETA-alanine
N-(AMINOCARBONYL)-b-alanine
N-(AMINOCARBONYL)-beta-alanine
N-(Aminocarbonyl)-'b-alanine
N-Carbamoyl-b-alanine
N-Carbamoyl-beta-alanine
N-Carbamyl-b-alanine
N-Carbamyl-beta-alanine
Ureidopropanoate
Ureidopropanoic acid
Ureidopropionate
b-Ureidopropionate
b-Ureidopropionic acid
beta-Ureidopropionate
beta-Ureidopropionic acid
beta-ureidopropionate
beta-ureidopropionic acid
ureidopropionic acid
hmdb:HMDB00026
hmdb:HMDB62812
chebi:12495
chebi:1671
chebi:21690
chebi:46352
biggM:M_cala
keggC:M_C02642
seedM:M_cpd01720
secondary/obsolete/fantasy identifier