Feedback

(S)-2,3-dihydrodipicolinate

PropertiesImageOccurences in reactions
MNX_IDMNXM807Image of MNXM807
#reac
in my sandbox 0
in MNXref (generic)17
in models (compartimentalized) 4
formulaC7H5NO4
charge-2
mass167.11894
referencechebi:30620
InChIKeyUWOCFOFVIBZJGH-YFKPBYRVSA-L
InChIInChI=1S/C7H7NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h1-2,5H,3H2,(H,9,10)(H,11,12)/p-2/t5-/m0/s1
SMILES[O-]C(=O)[C@@H]1CC=CC(=N1)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:30620
chebi:30620
(S)-2,3-dihydrodipicolinate
(2S)-2,3-dihydropyridine-2,6-dicarboxylate
(S)-2,3-dihydrodipicolinate(2-)
(S)-2,3-dihydropyridine-2,6-dicarboxylate
L-2,3-Dihydrodipicolinate
metacyc.compound:2-3-DIHYDRODIPICOLINATE
metacycM:2-3-DIHYDRODIPICOLINATE
(S)-2,3-dihydrodipicolinate
2,3-di-H-dipicolinate
L-2,3-dihydrodipicolinate
CHEBI:18042
chebi:18042
(S)-2,3-dihydrodipicolinic acid
(2S)-2,3-dihydropyridine-2,6-dicarboxylic acid
(S)-2,3-Dihydropyridine-2,6-dicarboxylate
2,3-Dihydrodipicolinate
Dihydrodipicolinic acid
bigg.metabolite:23dhdp
biggM:23dhdp
2,3-Dihydrodipicolinate
CHEBI:11421
chebi:11421
2,3-dihydrodipicolinate(2-)
2,3-dihydropyridine-2,6-dicarboxylate
CHEBI:48052
chebi:48052
2,3-dihydrodipicolinic acid
2,3-dihydropyridine-2,6-dicarboxylic acid
seed.compound:cpd02120
seedM:cpd02120
Dihydrodipicolinate
(S)-2,3-Dihydropyridine-2,6-dicarboxylate
(S)-2,3-dihydrodipicolinate
2,3-Dihydrodipicolinate
2,3-di-H-dipicolinate
2-3-Dihydrodipicolinate
23dhdp
Dihydrodipicolinic acid
L-2,3-Dihydrodipicolinate
L-2,3-dihydrodipicolinate
kegg.compound:C03340
keggC:C03340
L-2,3-Dihydrodipicolinate
(S)-2,3-Dihydropyridine-2,6-dicarboxylate
2,3-Dihydrodipicolinate
Dihydrodipicolinate
Dihydrodipicolinic acid
hmdb:HMDB0012247 L-2,3-Dihydrodipicolinate
2,3-Di-H-dipicolinate
2,3-Dihydrodipicolinate
2,3-dihydrodipicolinic acid
2,3-dihydropyridine-2,6-dicarboxylic acid
Dihydrodipicolinate
sabiork.compound:6562
sabiorkM:6562
L-2,3-Dihydrodipicolinate
2,3-Dihydrodipicolinate
Dihydrodipicolinate
Dihydrodipicolinic acid
hmdb:HMDB12247
chebi:19312
chebi:23739
chebi:878
biggM:M_23dhdp
keggC:M_C03340
seedM:M_cpd02120
secondary/obsolete/fantasy identifier