Feedback

 

(S)-2,3-dihydrodipicolinate

Image of MNXM807
Properties
MNX_IDMNXM807
formulaC7H5NO4
charge-2
mass167.12
referencechebi:30620
InChIKeyUWOCFOFVIBZJGH-YFKPBYRVSA-L
InChIInChI=1S/C7H7NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h1-2,5H,3H2,(H,9,10)(H,11,12)/p-2/t5-/m0/s1
SMILES[O-]C(=O)[C@@H]1CC=CC(=N1)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (S)-2,3-dihydrodipicolinate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:18042
chebi:878
(2S)-2,3-dihydropyridine-2,6-dicarboxylic acid
(S)-2,3-Dihydropyridine-2,6-dicarboxylate
(S)-2,3-dihydrodipicolinic acid
2,3-Dihydrodipicolinate
Dihydrodipicolinic acid
UWOCFOFVIBZJGH-YFKPBYRVSA-N
chebi:19312
chebi:23739
chebi:29048
chebi:30620
(2S)-2,3-dihydropyridine-2,6-dicarboxylate
(S)-2,3-dihydrodipicolinate
(S)-2,3-dihydrodipicolinate(2-)
(S)-2,3-dihydropyridine-2,6-dicarboxylate
L-2,3-Dihydrodipicolinate
UWOCFOFVIBZJGH-YFKPBYRVSA-L
hmdb:HMDB12247 2,3-dihydrodipicolinic acid
2,3-dihydropyridine-2,6-dicarboxylic acid
L-2,3-Dihydrodipicolinate
kegg:C03340 (S)-2,3-Dihydropyridine-2,6-dicarboxylate
2,3-Dihydrodipicolinate
Dihydrodipicolinate
Dihydrodipicolinic acid
L-2,3-Dihydrodipicolinate
metacyc:2-3-DIHYDRODIPICOLINATE (S)-2,3-dihydrodipicolinate
2,3-di-H-dipicolinate
2-3-DIHYDRODIPICOLINATE
L-2,3-dihydrodipicolinate
sabiork:6562 2,3-Dihydrodipicolinate
Dihydrodipicolinate
Dihydrodipicolinic acid
L-2,3-Dihydrodipicolinate
seed:cpd02120 2,3-Dihydrodipicolinate
2-3-Dihydrodipicolinate
23dhdp
Dihydrodipicolinate
Dihydrodipicolinic acid
L-2,3-Dihydrodipicolinate