Feedback

cis-aconitate

Properties
MNX_IDMNXM813
formulaC6H3O6
charge-3
mass171.08442
referencechebi:16383
Image of MNXM813
InChIKeyGTZCVFVGUGFEME-IWQZZHSRSA-K
InChIInChI=1S/C6H6O6/c7-4(8)1-3(6(11)12)2-5(9)10/h1H,2H2,(H,7,8)(H,9,10)(H,11,12)/p-3/b3-1-
SMILES[O-]C(=O)C\C(=C\C([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref25
Distinct compatimentalized reactions in models24

Similar chemical compounds in external resources
IdentifierDescription
biggM:acon_C Cis-Aconitate
biggM:HC00342 Cis-aconitate(3-)
(1Z)-prop-1-ene-1,2,3-tricarboxylat
chebi:32805 cis-aconitic acid
(1Z)-prop-1-ene-1,2,3-tricarboxylic acid
(Z)-1-propene-1,2,3-tricarboxylic acid
cis-1-propene-1,2,3-tricarboxylic acid
cis-Aconitic acid
keggC:C00417
sabiorkM:2043
cis-Aconitate
cis-Aconitic acid
chebi:16383 cis-aconitate
(1Z)-prop-1-ene-1,2,3-tricarboxylate
cis-aconitate(3-)
envipath:...70f4dca66baa cis-Aconitate
seedM:cpd00331 cis-Aconitate
(Z)-prop-1-ene-1,2,3-tricarboxylate
acon-C
cis-Aconitic acid
cis-aconitate
cis-aconitic acid
hmdb:HMDB0000072 cis-Aconitic acid
(1Z)-1-Propene-1,2,3-tricarboxylate
(1Z)-1-Propene-1,2,3-tricarboxylic acid
(1Z)-prop-1-ene-1,2,3-tricarboxylic acid
(Z)-1-Propene-1,2,3-tricarboxylate
(Z)-1-Propene-1,2,3-tricarboxylic acid
(Z)-Aconitate
(Z)-Aconitic acid
1-Propene-1,2,3-tricarboxylate
1-Propene-1,2,3-tricarboxylic acid
1-cis-2,3-Propenetricarboxylate
1-cis-2,3-Propenetricarboxylic acid
Achilleic acid
Acid, achilleic
Acid, aconitic
Acid, acontic
Acid, adonic
Acid, carboxyglutaconic
Acid, citridic
Acid, citridinic
Acid, equisetic
Acid, pyrocitric
Aconitate
Aconitic acid
Acontic acid
Adonic acid
Carboxyglutaconic acid
Citridic acid
Citridinic acid
Equisetic acid
Pyrocitric acid
cis-1-Propene-1,2,3-tricarboxylate
cis-1-Propene-1,2,3-tricarboxylic acid
cis-Aconate
cis-Aconic acid
cis-Aconitate
cis-Oxaloacetate
cis-Oxaloacetic acid
cis-aconitic acid
biggM:M_HC00342
biggM:M_acon_C
chebi:10482
chebi:12798
chebi:23306
chebi:23308
hmdb:HMDB0000461
hmdb:HMDB00072
hmdb:HMDB00461
keggC:M_C00417
seedM:M_cpd00331
secondary/obsolete/fantasy identifier
metacycM:CIS-ACONITATE cis-aconitate
(Z)-prop-1-ene-1,2,3-tricarboxylate
cis-aconitic acid
MNXM162425is deprecated and replaced by this entry