Feedback

3-(2,3-dihydroxyphenyl)propanoate

Properties
MNX_IDMNXM826
formulaC9H9O4
charge-1
mass181.16536
referencechebi:46951
Image of MNXM826
InChIKeyQZDSXQJWBGMRLU-UHFFFAOYSA-M
InChIInChI=1S/C9H10O4/c10-7-3-1-2-6(9(7)13)4-5-8(11)12/h1-3,10,13H,4-5H2,(H,11,12)/p-1
SMILESOc1cccc(CCC([O-])=O)c1O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref9
Distinct compatimentalized reactions in models5

Similar chemical compounds in external resources
IdentifierDescription
biggM:dhpppn 3-(2,3-Dihydroxyphenyl)propanoate
chebi:18136 3-(2,3-dihydroxyphenyl)propanoic acid
2,3-DHP
2,3-Dhppa
2,3-Dihydroxyphenylpropionic acid
2,3-dihydroxy-beta-phenylpropionic acid
2,3-dihyrroxybenzenepropanoic acid
3,4-dihydroxyhydrocinnamic acid
3-(2,3-dihydroxyphenyl)propionic acid
hydrocaffeic acid
envipath:...53a07e6cc91d 3-(2,3-Dihydroxyphenyl)propionate
biggM:M_dhpppn
chebi:11713
chebi:11718
chebi:1419
chebi:19918
chebi:19919
keggC:M_C04044
seedM:M_cpd02501
secondary/obsolete/fantasy identifier
chebi:46951 3-(2,3-dihydroxyphenyl)propanoate
2,3-Dihydroxyphenylpropanoate
hmdb:HMDB0134042 3-(2,3-dihydroxyphenyl)propanoic acid
2,3-DHP
2,3-Dhppa
2,3-Dihydroxy-b-phenylpropionate
2,3-Dihydroxy-b-phenylpropionic acid
2,3-Dihydroxy-beta-phenylpropionate
2,3-Dihydroxy-beta-phenylpropionic acid
2,3-Dihydroxyphenylpropionate
2,3-Dihydroxyphenylpropionic acid
2,3-Dihyrroxybenzenepropanoate
2,3-Dihyrroxybenzenepropanoic acid
2,3-dhppa
3,4-Dihydroxyhydrocinnamate
3,4-Dihydroxyhydrocinnamic acid
3-(2,3-Dihydroxyphenyl)propanoic acid
3-(2,3-Dihydroxyphenyl)propionate
3-(2,3-Dihydroxyphenyl)propionic acid
Hydrocaffeate
Hydrocaffeic acid
keggC:C04044
sabiorkM:7038
3-(2,3-Dihydroxyphenyl)propanoate
2,3-Dihydroxyphenylpropanoate
metacycM:2-3-DIHYDROXYPHENYL-PROPIONATE 3-(2,3-dihydroxyphenyl)propanoate
2,3-DHP
3-(2,3-dihydroxyphenyl)propionate
3-(2,3-dihydroxyphenyl)propionic acid
3-carboxyethylcatechol
seedM:cpd02501 2,3-Dihydroxyphenylpropanoate
2,3-DHP
3-(2,3-Dihydroxyphenyl)propanoate
3-(2,3-dihydroxyphenyl)propanoate
3-(2,3-dihydroxyphenyl)propionate
3-(2,3-dihydroxyphenyl)propionic acid
3-(2,3-hihydroxyphenyl)propanoate
3-carboxyethylcatechol
dhpppn