Feedback

 

3-(2,3-dihydroxyphenyl)propanoate

Image of MNXM826
Properties
MNX_IDMNXM826
formulaC9H9O4
charge-1
mass181.1659
referencechebi:46951
InChIKeyQZDSXQJWBGMRLU-UHFFFAOYSA-M
InChIInChI=1S/C9H10O4/c10-7-3-1-2-6(9(7)13)4-5-8(11)12/h1-3,10,13H,4-5H2,(H,11,12)/p-1
SMILESOc1cccc(CCC([O-])=O)c1O

This chemical compound does not exist in my selection



Occurrences of 3-(2,3-dihydroxyphenyl)propanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:dhpppn 3-(2,3-Dihydroxyphenyl)propanoate
chebi:11713
chebi:19918
chebi:46951
2,3-Dihydroxyphenylpropanoate
3-(2,3-dihydroxyphenyl)propanoate
QZDSXQJWBGMRLU-UHFFFAOYSA-M
chebi:11718
chebi:1419
chebi:18136
chebi:19919
2,3-DHP
2,3-Dhppa
2,3-Dihydroxyphenylpropionic acid
2,3-dihydroxy-beta-phenylpropionic acid
2,3-dihyrroxybenzenepropanoic acid
3,4-dihydroxyhydrocinnamic acid
3-(2,3-dihydroxyphenyl)propanoic acid
3-(2,3-dihydroxyphenyl)propionic acid
QZDSXQJWBGMRLU-UHFFFAOYSA-N
hydrocaffeic acid
envipath:...53a07e6cc91d 3-(2,3-Dihydroxyphenyl)propionate
metacyc:2-3-DIHYDROXYPHENYL-PROPIONATE 2,3-DHP
2-3-DIHYDROXYPHENYL-PROPIONATE
3-(2,3-dihydroxyphenyl)propanoate
3-(2,3-dihydroxyphenyl)propionate
3-(2,3-dihydroxyphenyl)propionic acid
3-carboxyethylcatechol
kegg:C04044
sabiork:7038
2,3-Dihydroxyphenylpropanoate
3-(2,3-Dihydroxyphenyl)propanoate
seed:cpd02501 2,3-Dihydroxyphenylpropanoate
3-(2,3-Dihydroxyphenyl)propanoate
dhpppn