Feedback

6-oxohexanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM831Image of MNXM831
#reac
in my sandbox 0
in MNXref (generic)10
in models (compartimentalized) 0
formulaC6H9O3
charge-1
mass129.13386
referencechebi:18322
InChIKeyPNPPVRALIYXJBW-UHFFFAOYSA-M
InChIInChI=1S/C6H10O3/c7-5-3-1-2-4-6(8)9/h5H,1-4H2,(H,8,9)/p-1
SMILES[O-]C(=O)CCCCC=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:18322
chebi:18322
6-oxohexanoate
adipate semialdehyde
envipath:...98540c3ab723
envipathM:...98540c3ab723
6-Oxohexanoate
seed.compound:cpd03640
seedM:cpd03640
6-Oxohexanoate
6-Oxohexanoic acid
6-ketohexanoate
6-ketohexanoic acid
6-oxohexanoate
6-oxohexanoic acid
Adipate semialdehyde
Hexan-1-one-6-carboxylate
adipate semialdehyde
sabiork.compound:2861
sabiorkM:2861
6-Oxohexanoate
Adipate semialdehyde
Hexan-1-one-6-carboxylate
metacyc.compound:6-OXO-HEXANOATE
metacycM:6-OXO-HEXANOATE
6-oxohexanoate
6-ketohexanoate
6-ketohexanoic acid
6-oxohexanoic acid
adipate semialdehyde
CHEBI:2490
chebi:2490
6-oxohexanoic acid
1-hexanal-6-carboxylic acid
5-carbohydroxy-1-pentanal
5-formylvaleric acid
6-Oxohexanoic acid
6-hydroxy caproic acid
adipic acid monoaldehyde
adipic acid semialdehyde
adipic monoaldehyde
adipic semialdehyde
hmdb:HMDB0012882 Adipate semialdehyde
1-Hexanal-6-carboxylate
1-Hexanal-6-carboxylic acid
5-Carbohydroxy-1-pentanal
5-Formylvalerate
5-Formylvaleric acid
6-Hydroxy caproate
6-Hydroxy caproic acid
6-Oxohexanoate
6-Oxohexanoic acid
6-oxohexanoic acid
Adipate monoaldehyde
Adipic acid monoaldehyde
Adipic acid semialdehyde
Adipic monoaldehyde
Adipic semialdehyde
Hexan-1-one-6-carboxylate
kegg.compound:C06102
keggC:C06102
Adipate semialdehyde
6-Oxohexanoate
6-Oxohexanoic acid
Hexan-1-one-6-carboxylate
hmdb:HMDB12882
chebi:12226
chebi:20749
chebi:22265
keggC:M_C06102
seedM:M_cpd03640
secondary/obsolete/fantasy identifier