Feedback

L-2,4-diaminobutanoate

Properties
MNX_IDMNXM840
formulaC4H11N2O2
charge1
mass119.14242
referencechebi:58761
Image of MNXM840
InChIKeyOGNSCSPNOLGXSM-VKHMYHEASA-O
InChIInChI=1S/C4H10N2O2/c5-2-1-3(6)4(7)8/h3H,1-2,5-6H2,(H,7,8)/p+1/t3-/m0/s1
SMILES[NH3+]CC[C@H]([NH3+])C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref16
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB0006284 L-2,4-diaminobutyric acid
(2S)-2,4-diaminobutanoic acid
(S)-2,4-Diaminobutanoate
(S)-2,4-Diaminobutanoic acid
(S)-2,4-Diaminobutyric acid
(S)-2,4-diamino-Butanoate
(S)-2,4-diamino-Butanoic acid
2,4-Diaminobutyric acid
2,4-Diaminobutyric acid dihydrochloride, (+-)-isomer
2,4-Diaminobutyric acid dihydrochloride, (S)-isomer
2,4-Diaminobutyric acid monohydrochloride, (+-)-isomer
2,4-Diaminobutyric acid monohydrochloride, (S)-isomer
2,4-Diaminobutyric acid, (+)-isomer
2,4-Diaminobutyric acid, (+-)-isomer
2,4-Diaminobutyric acid, (R)-isomer
2,4-Diaminobutyric acid, (S)-isomer
2,4-diaminobutyric acid
Dbu
L-2,4-Diaminobutanoate
L-2,4-Diaminobutanoic acid
L-2,4-Diaminobutyrate
L-2,4-diamino-Butyric acid
L-2,4-diamino-N-Butyric acid
L-DABA
L-Dbu
L-Diaminobutyrate
L-Diaminobutyric acid
L-alpha,gamma-Diaminobutyric acid
a,g-Diaminobutyrate
a,g-Diaminobutyric acid
alpha,gamma-Diaminobutyrate
alpha,gamma-Diaminobutyric acid
alpha,gamma-diaminobutyrate
alpha,gamma-diaminobutyric acid
seedM:cpd02095 L-2,4-Diaminobutyrate
(2S)-2,4-diaminobutanoate
2,4-diamino-L-butyrate
24dab
L-2,4-Diaminobutanoate
L-2,4-diaminobutanoate
L-2,4-diaminobutyrate
L-2,4-diaminobutyric acid
alpha,gamma-Diaminobutyrate
diaminobutyrate
chebi:58761 L-2,4-diaminobutanoate
(2S)-2,4-diazaniumylbutanoate
L-2,4-diazaniumylbutyrate
biggM:M_24dab
chebi:13044
chebi:13045
chebi:21191
chebi:21192
chebi:6154
hmdb:HMDB06284
keggC:M_C03283
seedM:M_cpd02095
secondary/obsolete/fantasy identifier
metacycM:CPD-470 L-2,4-diaminobutanoate
(2S)-2,4-diaminobutanoate
2,4-diamino-L-butyrate
L-2,4-diaminobutyrate
L-2,4-diaminobutyric acid
diaminobutyrate
chebi:16028 L-2,4-diaminobutyrate
(2S)-2,4-diaminobutanoate
L-2,4-diaminobutyrate anion
L-2,4-diaminobutyrate(1-)
biggM:24dab L-2,4-Diaminobutanoate
keggC:C03283
sabiorkM:6525
L-2,4-Diaminobutanoate
L-2,4-Diaminobutyrate
alpha,gamma-Diaminobutyrate
chebi:48950
reactome:R-ALL-352009
reactome:R-ALL-352023
L-2,4-diaminobutyric acid
(2S)-2,4-diaminobutanoic acid
(S)-2,4-diaminobutanoic acid
Dbu
L-2,4-Diaminobutanoate
L-2,4-Diaminobutyrate
L-2,4-diaminobutanoic acid
L-Dbu
L-diaminobutyric acid
alpha,gamma-Diaminobutyrate