Feedback

2,5-dihydroxybenzoate

PropertiesImageOccurences in reactions
MNX_IDMNXM850Image of MNXM850
#reac
in my sandbox 0
in MNXref (generic)20
in models (compartimentalized) 7
formulaC7H5O4
charge-1
mass153.01933
referencechebi:58044
InChIKeyWXTMDXOMEHJXQO-UHFFFAOYSA-M
InChIInChI=1S/C7H6O4/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,8-9H,(H,10,11)/p-1
SMILESO=C([O-])c1cc(O)ccc1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58044
chebi:58044
2,5-dihydroxybenzoate
2,5-dihydroxybenzoate anion
5-hydroxysalicylate
gentisate
hydroquinonecarboxylate
kegg.compound:C00628
keggC:C00628
2,5-Dihydroxybenzoate
2,5-Dihydroxybenzoic acid
Gentisate
Gentisic acid
Hydroquinonecarboxylic acid
sabiork.compound:2123
sabiorkM:2123
2,5-Dihydroxybenzoate
Gentisate
Gentisic acid
Hydroquinonecarboxylic acid
bigg.metabolite:HC00460
biggM:HC00460
2,5-dihydroxybenzoate
reactome:R-ALL-5229239
reactomeM:R-ALL-5229239
reactome:R-ALL-5246483
reactomeM:R-ALL-5246483
CHEBI:17189
chebi:17189
2,5-dihydroxybenzoic acid
2,5-Dihydroxybenzoate
2,5-Dihydroxybenzoic acid
5-hydroxysalicylic acid
Gentisate
Gentisic acid
Hydroquinonecarboxylic acid
envipath:...ca79ed2789a7
envipathM:...ca79ed2789a7
Gentisate
seed.compound:cpd00479
seedM:cpd00479
Gentisate
2,5-DHBA
2,5-Dihydroxybenzoate
2,5-Dihydroxybenzoic acid
2,5-dihydroxybenzoate
2,5-dihydroxybenzoic acid
2,5-dioxybenzoic acid
3,6-dihydroxybenzoic acid
5-hydroxysalicylate
5-hydroxysalicylic acid
Gentisic acid
Hydroquinonecarboxylic acid
gentisate
gentisic acid
hydroquinonecarboxylic acid
hmdb:HMDB0000152 Gentisic acid
2,5-Dihydroxybenzoate
2,5-Dihydroxybenzoic acid
2,5-Dihydroxybenzoic acid, monosodium salt
2,5-Dioxybenzoate
2,5-Dioxybenzoic acid
2,5-dihydroxybenzoic acid
3,6-Dihydroxybenzoate
3,6-Dihydroxybenzoic acid
5-Hydroxy-salicylate
5-Hydroxy-salicylic acid
5-Hydroxysalicylate
5-Hydroxysalicylic acid
Carboxyhydroquinone
Dihydroxybenzoicacid
Gensigen
Gensigon
Gentisate
Gentisinate
Gentisinic acid
Hydroquinonecarboxylate
Hydroquinonecarboxylic acid
Lithium 2,5-dihydroxybenzoate
metacyc.compound:CPD-633
metacycM:CPD-633
gentisate
2,5-DHBA
2,5-dihydroxybenzoate
2,5-dihydroxybenzoic acid
2,5-dioxybenzoic acid
3,6-dihydroxybenzoic acid
5-hydroxysalicylate
5-hydroxysalicylic acid
gentisic acid
hydroquinonecarboxylic acid
hmdb:HMDB00152
chebi:11451
chebi:19381
chebi:19382
chebi:936
biggM:M_HC00460
keggC:M_C00628
seedM:M_cpd00479
secondary/obsolete/fantasy identifier