Feedback

2,5-dihydroxybenzoate

Properties
MNX_IDMNXM850
formulaC7H5O4
charge-1
mass153.1122
referencechebi:58044
Image of MNXM850
InChIKeyWXTMDXOMEHJXQO-UHFFFAOYSA-M
InChIInChI=1S/C7H6O4/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,8-9H,(H,10,11)/p-1
SMILESOc1ccc(O)c(c1)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref22
Distinct compatimentalized reactions in models4

Similar chemical compounds in external resources
IdentifierDescription
biggM:HC00460 2,5-dihydroxybenzoate
chebi:17189
reactome:R-ALL-5229239
reactome:R-ALL-5246483
2,5-dihydroxybenzoic acid
2,5-Dihydroxybenzoate
2,5-Dihydroxybenzoic acid
5-hydroxysalicylic acid
Gentisate
Gentisic acid
Hydroquinonecarboxylic acid
sabiorkM:2123 2,5-Dihydroxybenzoate
Gentisate
Gentisic acid
Hydroquinonecarboxylic acid
envipath:...ca79ed2789a7 Gentisate
chebi:58044 2,5-dihydroxybenzoate
2,5-dihydroxybenzoate anion
5-hydroxysalicylate
gentisate
hydroquinonecarboxylate
metacycM:CPD-633 gentisate
2,5-DHBA
2,5-dihydroxybenzoate
2,5-dihydroxybenzoic acid
2,5-dioxybenzoic acid
3,6-dihydroxybenzoic acid
5-hydroxysalicylate
5-hydroxysalicylic acid
gentisic acid
hydroquinonecarboxylic acid
keggC:C00628 2,5-Dihydroxybenzoate
2,5-Dihydroxybenzoic acid
Gentisate
Gentisic acid
Hydroquinonecarboxylic acid
seedM:cpd00479 Gentisate
2,5-DHBA
2,5-Dihydroxybenzoate
2,5-Dihydroxybenzoic acid
2,5-dihydroxybenzoate
2,5-dihydroxybenzoic acid
2,5-dioxybenzoic acid
3,6-dihydroxybenzoic acid
5-hydroxysalicylate
5-hydroxysalicylic acid
Gentisic acid
Hydroquinonecarboxylic acid
gentisate
gentisic acid
hydroquinonecarboxylic acid
biggM:M_HC00460
chebi:11451
chebi:19381
chebi:19382
chebi:936
hmdb:HMDB00152
keggC:M_C00628
seedM:M_cpd00479
secondary/obsolete/fantasy identifier
hmdb:HMDB0000152 Gentisic acid
2,5-Dihydroxybenzoate
2,5-Dihydroxybenzoic acid
2,5-Dihydroxybenzoic acid, monosodium salt
2,5-Dioxybenzoate
2,5-Dioxybenzoic acid
2,5-dihydroxybenzoic acid
3,6-Dihydroxybenzoate
3,6-Dihydroxybenzoic acid
5-Hydroxy-salicylate
5-Hydroxy-salicylic acid
5-Hydroxysalicylate
5-Hydroxysalicylic acid
Carboxyhydroquinone
Dihydroxybenzoicacid
Gensigen
Gensigon
Gentisate
Gentisinate
Gentisinic acid
Hydroquinonecarboxylate
Hydroquinonecarboxylic acid
Lithium 2,5-dihydroxybenzoate