Feedback

 

5-dehydro-4-deoxy-D-glucarate

Image of MNXM854
Properties
MNX_IDMNXM854
formulaC6H6O7
charge-2
mass190.1087
referencechebi:42819
InChIKeyQUURPCHWPQNNGL-ZAFYKAAXSA-L
InChIInChI=1S/C6H8O7/c7-2(4(9)6(12)13)1-3(8)5(10)11/h2,4,7,9H,1H2,(H,10,11)(H,12,13)/p-2/t2-,4+/m0/s1
SMILESO[C@@H](CC(=O)C([O-])=O)[C@@H](O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 5-dehydro-4-deoxy-D-glucarate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:5d4dglcr 5 Dehydro 4 deoxy D glucarate
bigg:5dh4dglc 5-Dehydro-4-deoxy-D-glucarate
chebi:12117
chebi:16369
chebi:2048
chebi:20561
3-deoxy-L-threo-hex-2-ulosaric acid
5-Dehydro-4-deoxy-D-glucarate
5-dehydro-4-deoxy-D-glucaric acid
QUURPCHWPQNNGL-ZAFYKAAXSA-N
chebi:35453 5-dehydro-4-deoxy-D-glucarate(1-)
QUURPCHWPQNNGL-ZAFYKAAXSA-M
hydrogen 3-deoxy-L-threo-hex-2-ulosarate
chebi:35454
chebi:42815
chebi:42819
chebi:43704
2,3-DIHYDROXY-5-OXO-HEXANEDIOATE
3-deoxy-(L)-threo-2-hexulosarate
3-deoxy-L-threo-hex-2-ulosarate
5-Dehydro-4-deoxy-D-glucarate
5-KDG
5-dehydro-4-deoxy-D-glucarate
5-dehydro-4-deoxy-D-glucarate(2-)
QUURPCHWPQNNGL-ZAFYKAAXSA-L
kegg:C00679 (2R,3S)-2,3-Dihydroxy-5-oxohexanedioate
5-Dehydro-4-deoxy-D-glucarate
metacyc:5-KETO-4-DEOXY-D-GLUCARATE (2R,3S)-2,3-dihydroxy-5-oxohexanedioate
2-keto-L-threo-4,5-dihydroxyadipate
3-deoxy-(L)-threo-2-hexulosarate
3-deoxy-2-keto-L-threo-hexarate
3-deoxy-L-threo-hex-2-ulosarate
5-KDG
5-KETO-4-DEOXY-D-GLUCARATE
5-dehydro-4-deoxy-D-glucarate
5-keto-4-deoxy-D-glucarate
GLR
KDG
KGR
sabiork:5177 3-Deoxy-L-threo-2-hexulosarate
3-Deoxy-L-threo-hex-2-ulosaric acid
5-Dehydro-4-deoxy-D-glucarate
5-Dehydro-4-deoxy-D-glucaric acid
seed:cpd00515 5-Dehydro-4-deoxy-D-glucarate
5d4dglcr