Feedback

5-dehydro-4-deoxy-D-glucarate

PropertiesImageOccurences in reactions
MNX_IDMNXM854Image of MNXM854
#reac
in my sandbox 0
in MNXref (generic)10
in models (compartimentalized) 6
formulaC6H6O7
charge-2
mass190.10764
referencechebi:42819
InChIKeyQUURPCHWPQNNGL-ZAFYKAAXSA-L
InChIInChI=1S/C6H8O7/c7-2(4(9)6(12)13)1-3(8)5(10)11/h2,4,7,9H,1H2,(H,10,11)(H,12,13)/p-2/t2-,4+/m0/s1
SMILESO[C@@H](CC(=O)C([O-])=O)[C@@H](O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:42819
chebi:42819
5-dehydro-4-deoxy-D-glucarate
2,3-DIHYDROXY-5-OXO-HEXANEDIOATE
3-deoxy-(L)-threo-2-hexulosarate
3-deoxy-L-threo-hex-2-ulosarate
5-Dehydro-4-deoxy-D-glucarate
5-KDG
5-dehydro-4-deoxy-D-glucarate(2-)
bigg.metabolite:5d4dglcr
biggM:5d4dglcr
5 Dehydro 4 deoxy D glucarate
bigg.metabolite:5dh4dglc
biggM:5dh4dglc
5-Dehydro-4-deoxy-D-glucarate
kegg.compound:C00679
keggC:C00679
5-Dehydro-4-deoxy-D-glucarate
(2R,3S)-2,3-Dihydroxy-5-oxohexanedioate
seed.compound:cpd00515
seedM:cpd00515
5-Dehydro-4-deoxy-D-glucarate
(2R,3S)-2,3-dihydroxy-5-oxohexanedioate
2,3-dihydroxy-5-oxo-hexanedioate
2-keto-L-threo-4,5-dihydroxyadipate
3-deoxy-(L)-threo-2-hexulosarate
3-deoxy-2-keto-L-threo-hexarate
3-deoxy-L-threo-hex-2-ulosarate
5-KDG
5-dehydro-4-deoxy-D-glucarate
5-keto-4-deoxy-D-glucarate
5d4dglcr
GLR
KGR
sabiork.compound:5177
sabiorkM:5177
5-Dehydro-4-deoxy-D-glucarate
3-Deoxy-L-threo-2-hexulosarate
3-Deoxy-L-threo-hex-2-ulosaric acid
5-Dehydro-4-deoxy-D-glucaric acid
CHEBI:35453
chebi:35453
5-dehydro-4-deoxy-D-glucarate(1-)
hydrogen 3-deoxy-L-threo-hex-2-ulosarate
metacyc.compound:5-KETO-4-DEOXY-D-GLUCARATE
metacycM:5-KETO-4-DEOXY-D-GLUCARATE
5-dehydro-4-deoxy-D-glucarate
(2R,3S)-2,3-dihydroxy-5-oxohexanedioate
2-keto-L-threo-4,5-dihydroxyadipate
3-deoxy-(L)-threo-2-hexulosarate
3-deoxy-2-keto-L-threo-hexarate
3-deoxy-L-threo-hex-2-ulosarate
5-KDG
5-keto-4-deoxy-D-glucarate
GLR
KDG
KGR
CHEBI:16369
chebi:16369
5-dehydro-4-deoxy-D-glucaric acid
3-deoxy-L-threo-hex-2-ulosaric acid
5-Dehydro-4-deoxy-D-glucarate
chebi:12117
chebi:2048
chebi:20561
chebi:35454
chebi:42815
chebi:43704
biggM:M_5d4dglcr
biggM:M_5dh4dglc
keggC:M_C00679
seedM:M_cpd00515
secondary/obsolete/fantasy identifier