Feedback

5-dehydro-4-deoxy-D-glucarate

Properties
MNX_IDMNXM854
formulaC6H6O7
charge-2
mass190.10764
referencechebi:42819
Image of MNXM854
InChIKeyQUURPCHWPQNNGL-ZAFYKAAXSA-L
InChIInChI=1S/C6H8O7/c7-2(4(9)6(12)13)1-3(8)5(10)11/h2,4,7,9H,1H2,(H,10,11)(H,12,13)/p-2/t2-,4+/m0/s1
SMILESO[C@@H](CC(=O)C([O-])=O)[C@@H](O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref11
Distinct compatimentalized reactions in models7

Similar chemical compounds in external resources
IdentifierDescription
biggM:5dh4dglc 5-Dehydro-4-deoxy-D-glucarate
metacycM:5-KETO-4-DEOXY-D-GLUCARATE 5-dehydro-4-deoxy-D-glucarate
(2R,3S)-2,3-dihydroxy-5-oxohexanedioate
2-keto-L-threo-4,5-dihydroxyadipate
3-deoxy-(L)-threo-2-hexulosarate
3-deoxy-2-keto-L-threo-hexarate
3-deoxy-L-threo-hex-2-ulosarate
5-KDG
5-keto-4-deoxy-D-glucarate
GLR
KDG
KGR
biggM:5d4dglcr 5 Dehydro 4 deoxy D glucarate
seedM:cpd00515 5-Dehydro-4-deoxy-D-glucarate
(2R,3S)-2,3-dihydroxy-5-oxohexanedioate
2,3-dihydroxy-5-oxo-hexanedioate
2-keto-L-threo-4,5-dihydroxyadipate
3-deoxy-(L)-threo-2-hexulosarate
3-deoxy-2-keto-L-threo-hexarate
3-deoxy-L-threo-hex-2-ulosarate
5-KDG
5-dehydro-4-deoxy-D-glucarate
5-keto-4-deoxy-D-glucarate
5d4dglcr
GLR
KGR
keggC:C00679 5-Dehydro-4-deoxy-D-glucarate
(2R,3S)-2,3-Dihydroxy-5-oxohexanedioate
chebi:16369 5-dehydro-4-deoxy-D-glucaric acid
3-deoxy-L-threo-hex-2-ulosaric acid
5-Dehydro-4-deoxy-D-glucarate
chebi:42819 5-dehydro-4-deoxy-D-glucarate
2,3-DIHYDROXY-5-OXO-HEXANEDIOATE
3-deoxy-(L)-threo-2-hexulosarate
3-deoxy-L-threo-hex-2-ulosarate
5-Dehydro-4-deoxy-D-glucarate
5-KDG
5-dehydro-4-deoxy-D-glucarate(2-)
chebi:35453 5-dehydro-4-deoxy-D-glucarate(1-)
hydrogen 3-deoxy-L-threo-hex-2-ulosarate
biggM:M_5d4dglcr
biggM:M_5dh4dglc
chebi:12117
chebi:2048
chebi:20561
chebi:35454
chebi:42815
chebi:43704
keggC:M_C00679
seedM:M_cpd00515
secondary/obsolete/fantasy identifier
sabiorkM:5177 5-Dehydro-4-deoxy-D-glucarate
3-Deoxy-L-threo-2-hexulosarate
3-Deoxy-L-threo-hex-2-ulosaric acid
5-Dehydro-4-deoxy-D-glucaric acid