Feedback

3-hydroxypropanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM872Image of MNXM872
#reac
in my sandbox 0
in MNXref (generic)17
in models (compartimentalized) 11
formulaC3H5O3
charge-1
mass89.07
referencechebi:16510
InChIKeyALRHLSYJTWAHJZ-UHFFFAOYSA-M
InChIInChI=1S/C3H6O3/c4-2-1-3(5)6/h4H,1-2H2,(H,5,6)/p-1
SMILESOCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16510
chebi:16510
3-hydroxypropanoate
3-Hydroxypropionate
3-hydroxypropionate
beta-hydroxypropionate
bigg.metabolite:3hpp
biggM:3hpp
3-Hydroxypropanoate
sabiork.compound:2214
sabiorkM:2214
kegg.compound:C01013
keggC:C01013
3-Hydroxypropanoate
3-Hydroxypropanoic acid
3-Hydroxypropionate
3-Hydroxypropionic acid
Hydracrylic acid
metacyc.compound:3-HYDROXY-PROPIONATE
metacycM:3-HYDROXY-PROPIONATE
3-hydroxypropanoate
3-hydropropionic acid
3-hydroxypropanoic acid
3-hydroxypropionate
3-hydroxypropionic acid
beta-hydroxypropionate
hydracrylic acid
CHEBI:33404
chebi:33404
3-hydroxypropionic acid
3-HYDROXY-PROPANOIC ACID
3-Hydroxypropanoic acid
3-Hydroxypropionic acid
3-hydroxypropanoic acid
Hydracrylic acid
beta-hydroxypropionic acid
seed.compound:cpd00745
seedM:cpd00745
Hydracrylic acid
3-Hydroxypropanoate
3-Hydroxypropanoic acid
3-Hydroxypropionate
3-Hydroxypropionic acid
3-hydropropionic acid
3-hydroxypropanoate
3-hydroxypropanoic acid
3-hydroxypropionate
3-hydroxypropionic acid
beta-hydroxypropionate
hydracrylic acid
hydroxypropionate
hmdb:HMDB0000700 Hydroxypropionic acid
2-Deoxyglycerate
2-Deoxyglyceric acid
3-HYDROXY-propanoIC ACID
3-HYDROXY-propanoate
3-Hydroxypropanoate
3-Hydroxypropanoic acid
3-Hydroxypropionate
3-Hydroxypropionic acid
3-hydroxypropanoic acid
Ethylenelactate
Ethylenelactic acid
Hydracrylate
Hydracrylic acid
Hydroxypropionate
b-Hydroxypropionate
b-Hydroxypropionic acid
b-Lactate
b-Lactic acid
beta-Hydroxypropionate
beta-Hydroxypropionic acid
beta-Lactate
beta-Lactic acid
beta-hydroxypropionate
beta-hydroxypropionic acid
hydroxypropionic acid
envipath:...80f89844ef72
envipathM:...80f89844ef72
compound 44009
hmdb:HMDB00700
chebi:11836
chebi:1553
chebi:20071
chebi:20079
chebi:40000
biggM:M_3hpp
keggC:M_C01013
seedM:M_cpd00745
secondary/obsolete/fantasy identifier