Feedback

3-hydroxypropanoate

Properties
MNX_IDMNXM872
formulaC3H5O3
charge-1
mass89.07
referencechebi:16510
Image of MNXM872
InChIKeyALRHLSYJTWAHJZ-UHFFFAOYSA-M
InChIInChI=1S/C3H6O3/c4-2-1-3(5)6/h4H,1-2H2,(H,5,6)/p-1
SMILESOCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref16
Distinct compatimentalized reactions in models11

Similar chemical compounds in external resources
IdentifierDescription
envipath:...80f89844ef72 compound 44009
keggC:C01013
sabiorkM:2214
3-Hydroxypropanoate
3-Hydroxypropanoic acid
3-Hydroxypropionate
3-Hydroxypropionic acid
Hydracrylic acid
metacycM:3-HYDROXY-PROPIONATE 3-hydroxypropanoate
3-hydropropionic acid
3-hydroxypropanoic acid
3-hydroxypropionate
3-hydroxypropionic acid
beta-hydroxypropionate
hydracrylic acid
chebi:16510 3-hydroxypropanoate
3-Hydroxypropionate
3-hydroxypropionate
beta-hydroxypropionate
biggM:M_3hpp
chebi:11836
chebi:1553
chebi:20071
chebi:20079
chebi:40000
hmdb:HMDB00700
keggC:M_C01013
seedM:M_cpd00745
secondary/obsolete/fantasy identifier
seedM:cpd00745 Hydracrylic acid
3-Hydroxypropanoate
3-Hydroxypropanoic acid
3-Hydroxypropionate
3-Hydroxypropionic acid
3-hydropropionic acid
3-hydroxypropanoate
3-hydroxypropanoic acid
3-hydroxypropionate
3-hydroxypropionic acid
beta-hydroxypropionate
hydracrylic acid
hydroxypropionate
chebi:33404 3-hydroxypropionic acid
3-HYDROXY-PROPANOIC ACID
3-Hydroxypropanoic acid
3-Hydroxypropionic acid
3-hydroxypropanoic acid
Hydracrylic acid
beta-hydroxypropionic acid
biggM:3hpp 3-Hydroxypropanoate
hmdb:HMDB0000700 Hydroxypropionic acid
2-Deoxyglycerate
2-Deoxyglyceric acid
3-HYDROXY-propanoIC ACID
3-HYDROXY-propanoate
3-Hydroxypropanoate
3-Hydroxypropanoic acid
3-Hydroxypropionate
3-Hydroxypropionic acid
3-hydroxypropanoic acid
Ethylenelactate
Ethylenelactic acid
Hydracrylate
Hydracrylic acid
Hydroxypropionate
b-Hydroxypropionate
b-Hydroxypropionic acid
b-Lactate
b-Lactic acid
beta-Hydroxypropionate
beta-Hydroxypropionic acid
beta-Lactate
beta-Lactic acid
beta-hydroxypropionate
beta-hydroxypropionic acid
hydroxypropionic acid
MNXM527272is deprecated and replaced by this entry
MNXM724336is deprecated and replaced by this entry
MNXM90914is deprecated and replaced by this entry