Feedback

(2R)-2,3-bisphosphoglycerate

PropertiesImageOccurences in reactions
MNX_IDMNXM892Image of MNXM892
#reac
in my sandbox 0
in MNXref (generic)22
in models (compartimentalized) 10
formulaC3H3O10P2
charge-5
mass260.92289
referencechebi:58248
InChIKeyXOHUEYCVLUUEJJ-UWTATZPHSA-I
InChIInChI=1S/C3H8O10P2/c4-3(5)2(13-15(9,10)11)1-12-14(6,7)8/h2H,1H2,(H,4,5)(H2,6,7,8)(H2,9,10,11)/p-5/t2-/m1/s1
SMILESO=C([O-])[C@@H](COP(=O)([O-])[O-])OP(=O)([O-])[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58248
chebi:58248
(2R)-2,3-bisphosphoglycerate
(2R)-2,3-bis(phosphonatooxy)propanoate
2,3-bisphosphonato-D-glycerate
2,3-bisphosphonato-D-glycerate pentaanion
2,3-bisphosphonato-D-glycerate(5-)
bigg.metabolite:23dpg
biggM:23dpg
2 3 Disphospho D glycerate
kegg.compound:C01159
keggC:C01159
2,3-Bisphospho-D-glycerate
2,3-Diphospho-D-glycerate
D-Greenwald ester
DPG
sabiork.compound:1355
sabiorkM:1355
2,3-Bisphospho-D-glycerate
2,3-Disphospho-D-glycerate
D-Greenwald ester
DPG
sabiork.compound:20899
sabiorkM:20899
2,3-Bisphosphoglycerate
2,3-Diphosphoglycerate
Glycerate 2,3-bisphosphate
Greenwald ester
kegg.compound:C03339
keggC:C03339
2,3-Bisphosphoglycerate
2,3-Diphosphoglycerate
Greenwald ester
hmdb:HMDB0001294 2,3-Diphosphoglyceric acid
(2R)-2,3-Bis(phosphonooxy)-propanoate
(2R)-2,3-Bis(phosphonooxy)-propanoic acid
(2R)-2,3-Bis(phosphonooxy)propanoic acid
(2R)-2,3-Bis(phosphonooxy)propionic acid
(2R)-2,3-bis(phosphonooxy)propanoic acid
(R)-2,3-Bis(phosphonooxy)-propanoate
(R)-2,3-Bis(phosphonooxy)-propanoic acid
2,3 Bisphosphoglycerate
2,3 Diphosphoglycerate
2,3 Diphosphoglyceric acid
2,3-BPG
2,3-Bis(phosphonooxy)-propanoate
2,3-Bis(phosphonooxy)-propanoic acid
2,3-Bis(phosphonooxy)propanoic acid
2,3-Bis(phosphonooxy)propionic acid
2,3-Bisphosphate, glycerate
2,3-Bisphospho-D-glycerate
2,3-Bisphospho-D-glyceric acid
2,3-Bisphosphoglycerate
2,3-Bisphosphoglyceric acid
2,3-DPG
2,3-Diphospho-D-glycerate
2,3-Diphospho-D-glyceric acid
2,3-Diphospho-D-glyceric acid pentasodium salt
2,3-Diphosphoglycerate
2,3-Diphosphoglycerate, (D)-isomer
2,3-Diphosphonooxypropanoic acid
2,3-Diphosphonooxypropionic acid
2,3-Disphospho-D-glycerate
2,3-Disphospho-D-glyceric acid
D-Glyceric acid bis
D-Glyceric acid bis(dihydrogen phosphate)
D-Greenwald ester
DPG
Diphosphoglycerate
Diphosphoglyceric acid
Glycerate 2,3-bisphosphate
Glycerate 2,3-diphosphate
Glycerate bis(dihydrogen phosphate)
Glycerate diphosphate
Glyceric acid bis(dihydrogen phosphate)
Glyceric acid bis(dihydrogen phosphoric acid)
Glyceric acid diphosphate
Glyceric acid diphosphoric acid
diphosphoglycerate
CHEBI:17720
chebi:17720
2,3-bisphospho-D-glyceric acid
(2R)-2,3-bis(phosphonooxy)propanoic acid
2,3-BPG
2,3-Bisphospho-D-glycerate
2,3-Bisphosphoglyceric acid
2,3-Disphospho-D-glycerate
2,3-bisphospho-D-glycerate
2,3-diphosphoglyceric acid
2,3-disphospho-D-glycerate
D-Greenwald ester
DPG
Glyceric acid bis(dihydrogen phosphate)
Glyceric acid diphosphate
CHEBI:19324
chebi:19324
2,3-bisphosphoglycerate
2,3-bis(phosphonatooxy)propanoate
2,3-diphosphoglycerate
CHEBI:28907
chebi:28907
2,3-bisphosphoglyceric acid
2,3-bis(phosphonooxy)propanoic acid
metacyc.compound:23-DIPHOSPHOGLYCERATE
metacycM:23-DIPHOSPHOGLYCERATE
2,3-diphospho-D-glycerate
(2R)-2,3-bis(phosphonatooxy)propanoate
(2R)-2,3-bisphosphoglycerate
2,3-P2-D-glycerate
2,3-bisPGA
2,3-bisphospho-D-glycerate
2,3-bisphosphoglycerate
2,3-diphosphoglycerate
D-Greenwald ester
DPG
seed.compound:cpd00853
seedM:cpd00853
DPG
2,3-Bisphospho-D-glycerate
2,3-Disphospho-D-glycerate
2,3-P2-D-glycerate
2,3-bisPGA
2,3-bisphospho-D-glycerate
2,3-bisphosphoglycerate
2,3-diphospho-D-glycerate
2,3-diphosphoglycerate
23dpg
3-Phospho-D-glycerol phosphate
D-Greenwald ester
seed.compound:cpd02119
seedM:cpd02119
Greenwald ester
2,3-Bisphosphoglycerate
hmdb:HMDB01294
chebi:11417
chebi:19306
chebi:19307
chebi:19325
chebi:41885
chebi:872
chebi:873
biggM:M_23dpg
keggC:M_C01159
keggC:M_C03339
seedM:M_cpd00853
seedM:M_cpd02119
secondary/obsolete/fantasy identifier