Feedback

(2R)-2,3-bisphosphoglycerate

Properties
MNX_IDMNXM892
formulaC3H3O10P2
charge-5
mass260.997442
referencechebi:58248
Image of MNXM892
InChIKeyXOHUEYCVLUUEJJ-UWTATZPHSA-I
InChIInChI=1S/C3H8O10P2/c4-3(5)2(13-15(9,10)11)1-12-14(6,7)8/h2H,1H2,(H,4,5)(H2,6,7,8)(H2,9,10,11)/p-5/t2-/m1/s1
SMILES[O-]C(=O)[C@@H](COP([O-])([O-])=O)OP([O-])([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref20
Distinct compatimentalized reactions in models5

Similar chemical compounds in external resources
IdentifierDescription
keggC:C03339 2,3-Bisphosphoglycerate
Greenwald ester
chebi:17720 2,3-bisphospho-D-glyceric acid
(2R)-2,3-bis(phosphonooxy)propanoic acid
2,3-BPG
2,3-Bisphospho-D-glycerate
2,3-Bisphosphoglyceric acid
2,3-Disphospho-D-glycerate
2,3-bisphospho-D-glycerate
2,3-diphosphoglyceric acid
2,3-disphospho-D-glycerate
D-Greenwald ester
DPG
Glyceric acid bis(dihydrogen phosphate)
Glyceric acid diphosphate
seedM:cpd02119 Greenwald ester
2,3-Bisphosphoglycerate
chebi:28907 2,3-bisphosphoglyceric acid
2,3-bis(phosphonooxy)propanoic acid
biggM:M_23dpg
chebi:11417
chebi:19306
chebi:19307
chebi:19325
chebi:41885
chebi:872
chebi:873
hmdb:HMDB01294
keggC:M_C01159
keggC:M_C03339
seedM:M_cpd00853
seedM:M_cpd02119
secondary/obsolete/fantasy identifier
chebi:19324 2,3-bisphosphoglycerate
2,3-bis(phosphonatooxy)propanoate
2,3-diphosphoglycerate
chebi:58248 (2R)-2,3-bisphosphoglycerate
(2R)-2,3-bis(phosphonatooxy)propanoate
2,3-bisphosphonato-D-glycerate
2,3-bisphosphonato-D-glycerate pentaanion
2,3-bisphosphonato-D-glycerate(5-)
biggM:23dpg 2 3 Disphospho D glycerate
hmdb:HMDB0001294 2,3-Diphosphoglyceric acid
(2R)-2,3-Bis(phosphonooxy)-propanoate
(2R)-2,3-Bis(phosphonooxy)-propanoic acid
(2R)-2,3-bis(phosphonooxy)propanoic acid
(R)-2,3-Bis(phosphonooxy)-propanoate
(R)-2,3-Bis(phosphonooxy)-propanoic acid
2,3 Bisphosphoglycerate
2,3 Diphosphoglycerate
2,3 Diphosphoglyceric acid
2,3-BPG
2,3-Bis(phosphonooxy)-propanoate
2,3-Bis(phosphonooxy)-propanoic acid
2,3-Bisphosphate, glycerate
2,3-Bisphosphoglycerate
2,3-Bisphosphoglyceric acid
2,3-DPG
2,3-Diphosphoglycerate
2,3-Diphosphoglycerate, (D)-isomer
2,3-bisphospho-D-Glycerate
2,3-bisphospho-D-Glyceric acid
2,3-diphospho-D-Glycerate
2,3-diphospho-D-Glyceric acid
2,3-diphospho-D-Glyceric acid pentasodium salt
2,3-disphospho-D-Glycerate
2,3-disphospho-D-Glyceric acid
D-Glyceric acid bis
D-Glyceric acid bis(dihydrogen phosphate)
D-Greenwald ester
DPG
Diphosphoglycerate
Diphosphoglyceric acid
Glycerate 2,3-bisphosphate
Glycerate 2,3-diphosphate
Glycerate bis(dihydrogen phosphate)
Glycerate diphosphate
Glyceric acid bis(dihydrogen phosphate)
Glyceric acid bis(dihydrogen phosphoric acid)
Glyceric acid diphosphate
Glyceric acid diphosphoric acid
diphosphoglycerate
seedM:cpd00853 DPG
2,3-Bisphospho-D-glycerate
2,3-Disphospho-D-glycerate
2,3-P2-D-glycerate
2,3-bisPGA
2,3-bisphospho-D-glycerate
2,3-bisphosphoglycerate
2,3-diphospho-D-glycerate
2,3-diphosphoglycerate
23dpg
3-Phospho-D-glycerol phosphate
D-Greenwald ester
metacycM:23-DIPHOSPHOGLYCERATE 2,3-diphospho-D-glycerate
(2R)-2,3-bis(phosphonatooxy)propanoate
(2R)-2,3-bisphosphoglycerate
2,3-P2-D-glycerate
2,3-bisPGA
2,3-bisphospho-D-glycerate
2,3-bisphosphoglycerate
2,3-diphosphoglycerate
D-Greenwald ester
DPG
keggC:C01159
sabiorkM:1355
2,3-Bisphospho-D-glycerate
2,3-Disphospho-D-glycerate
D-Greenwald ester
DPG
sabiorkM:20899 2,3-Bisphosphoglycerate
2,3-Diphosphoglycerate
Glycerate 2,3-bisphosphate
Greenwald ester
MNXM146487is deprecated and replaced by this entry
MNXM162335is deprecated and replaced by this entry
MNXM90982is deprecated and replaced by this entry
MNXM95025is deprecated and replaced by this entry