Feedback

4-hydroxy-2-oxoglutarate

PropertiesImageOccurences in reactions
MNX_IDMNXM894Image of MNXM894
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 8
formulaC5H4O6
charge-2
mass160.08166
referencechebi:17742
InChIKeyWXSKVKPSMAHCSG-UHFFFAOYSA-L
InChIInChI=1S/C5H6O6/c6-2(4(8)9)1-3(7)5(10)11/h2,6H,1H2,(H,8,9)(H,10,11)/p-2
SMILESOC(CC(=O)C([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17742
chebi:17742
4-hydroxy-2-oxoglutarate
2-hydroxy-4-oxoglutarate
2-hydroxy-4-oxopentanedioate
2-keto-4-hydroxyglutarate
2-oxo-4-hydroxyglutarate
4-hydroxy-2-ketoglutarate
4-hydroxy-2-oxoglutarate(2-)
bigg.metabolite:4h2oglt
biggM:4h2oglt
4 Hydroxy 2 oxoglutarate
seed.compound:cpd00830
seedM:cpd00830
4-Hydroxy-2-oxoglutarate
(+/-)-2-hydroxy-4-oxopentanedioic acid
(4R)-4-hydroxy-2-oxoglutarate
(R)-2-hydroxy-4-oxopentanedioate
2-keto-4-hydroxyglutarate
2-oxo-4-hydroxyglutarate
4-Hydroxy-2-oxoglutaric acid
4-hydroxy-2-ketoglutarate
4-hydroxy-2-oxoglutarate
4h2oglt
CPD-15015
D-4-hydroxy-2-keto-glutarate
D-4-hydroxy-2-ketoglutarate
D-4-hydroxy-2-oxoglutarate
sabiork.compound:2252
sabiorkM:2252
4-Hydroxy-2-oxoglutarate
2-Hydroxy-4-oxopentanedioate
2-Hydroxy-4-oxopentanedioic acid
2-Keto-4-hydroxyglutarate
4-Hydroxy-2-oxoglutaric acid
kegg.compound:C01127
keggC:C01127
4-Hydroxy-2-oxoglutarate
4-Hydroxy-2-oxoglutaric acid
hmdb:HMDB0002070 4-Hydroxy-2-oxoglutaric acid
(+/-)-2-hydroxy-4-oxopentanedioate
(+/-)-2-hydroxy-4-oxopentanedioic acid
2-Hydroxy-4-oxopentanedioate
2-Hydroxy-4-oxopentanedioic acid
2-hydroxy-4-oxopentanedioic acid
2-keto-4-Hydroxyglutarate
2-keto-4-Hydroxyglutarate, (+-)-isomer
2-oxo-4-Hydroxyglutarate
4-Hydroxy-2-ketoglutarate
4-Hydroxy-2-oxoglutarate
4-hydroxy-2-oxoglutaric acid
D-4-Hydroxy-2-ketoglutarate
CHEBI:36148
chebi:36148
4-hydroxy-2-oxoglutarate(1-)
2-keto-4-hydroxyglutarate(1-)
2-oxo-4-hydroxyglutarate(1-)
4-hydroxy-2-ketoglutarate(1-)
hydrogen 2-hydroxy-4-oxopentanedioate
CHEBI:30923
chebi:30923
4-hydroxy-2-oxoglutaric acid
2-hydroxy-4-oxopentanedioic acid
4-Hydroxy-2-oxoglutaric acid
envipath:...cc6603cd87a8
envipathM:...cc6603cd87a8
compound 1541
hmdb:HMDB0001479
hmdb:HMDB01479
hmdb:HMDB02070
chebi:11993
chebi:1838
chebi:20374
chebi:20375
biggM:M_4h2oglt
keggC:M_C01127
seedM:M_cpd00830
secondary/obsolete/fantasy identifier