Feedback

glutamate

MNXM89557 is deprecated and here replaced by MNXM741172
!!! Alternative mappings exist !!!
Properties
MNX_IDMNXM741172
formulaC5H8NO4
charge-1
mass146.12136
referencechebi:14321
Image of MNXM741172
InChIKeyWHUUTDBJXJRKMK-UHFFFAOYSA-M
InChIInChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/p-1
SMILES[NH3+]C(CCC([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref18
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
chebi:76051 glutamic acid-2,3,3,4,4-d5
(2,3,3,4,4-(2)H5)glutamic acid
2,3,3,4,4-pentadeuterioglutamic acid
glutamic acid-d5
metacycM:Glutamates glutamate
seedM:cpd27177 Glutamates
keggD:D04341 Glutamic acid (USAN)
DL-Glutamic acid
hmdb:HMDB0060475 DL-Glutamate
2-Aminoglutarate
2-Aminoglutaric acid
2-aminopentanedioic acid
Aluminum L glutamate
Aluminum L-glutamate
D Glutamate
D-Glutamate
DL-Glutamic acid
DL-Glutaminate
DL-Glutaminic acid
DL-glutamic acid
E
Glu
Glutamate
Glutamate, potassium
Glutamic acid
Glutamic acid, (D)-isomer
Glutaminate
Glutaminic acid
Glutaminsaeure
L Glutamate
L Glutamic acid
L-Glutamate
L-Glutamate, aluminum
L-Glutamic acid
Potassium glutamate
chebi:14321 glutamate
2-ammoniopentanedioate
glutamate(1-)
glutamic acid monoanion
hydrogen glutamate
seedM:cpd19002 DL-Glutamate
2-Aminoglutaric acid
DL-Glutaminic acid
Glutamic acid
chebi:18237 glutamic acid
2-Aminoglutaric acid
2-aminopentanedioic acid
DL-Glutamic acid
DL-Glutaminic acid
E
Glu
Glutamate
Glutamic acid
Glutaminic acid
Glutaminsaeure
chebi:29987 glutamate(2-)
2-aminopentanedioate
glutamate
glutamic acid dianion
chebi:24314
chebi:5431
hmdb:HMDB60475
keggC:M_C00302
keggD:M_D04341
seedM:M_cpd19002
seedM:M_cpd27177
secondary/obsolete/fantasy identifier
keggC:C00302
sabiorkM:2010
Glutamate
2-Aminoglutaric acid
Glutaminic acid
MNXM18is deprecated and replaced by MNXM89557
MNXM89557is deprecated and replaced by this entry
MNXM89557is deprecated and replaced by MNXM741173 (L-glutamate)
MNXM96412is deprecated and replaced by MNXM89557