Feedback

 

isocitrate

Image of MNXM89661
Properties
MNX_IDMNXM89661
formulaC6H5O7
charge-3
mass189.1013
referencechebi:16087
InChIKeyODBLHEXUDAPZAU-UHFFFAOYSA-K
InChIInChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/p-3
SMILESOC(C(CC([O-])=O)C([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of isocitrate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:icit Isocitrate
chebi:14465
chebi:16087
chebi:24884
1-hydroxypropane-1,2,3-tricarboxylate
1-hydroxytricarballylate
3-carboxylato-2,3-dideoxypentarate
ODBLHEXUDAPZAU-UHFFFAOYSA-K
isocitrate
isocitrate(3-)
chebi:36453 ODBLHEXUDAPZAU-UHFFFAOYSA-L
hydrogen isocitrate
isocitrate(2-)
chebi:36454 ODBLHEXUDAPZAU-UHFFFAOYSA-M
dihydrogen isocitrate
isocitrate(1-)
chebi:24886
chebi:30887
chebi:5998
1-Hydroxypropane-1,2,3-tricarboxylic acid
1-Hydroxytricarballylic acid
1-hydroxypropane-1,2,3-tricarboxylic acid
3-carboxy-2,3-dideoxypentaric acid
Isocitric acid
ODBLHEXUDAPZAU-UHFFFAOYSA-N
isocitric acid
hmdb:HMDB00193 1-hydroxypropane-1,2,3-tricarboxylic acid
Isocitric acid
isocitric acid
kegg:C00311
sabiork:2013
1-Hydroxypropane-1,2,3-tricarboxylic acid
1-Hydroxytricarballylic acid
Isocitrate
Isocitric acid
seed:cpd00260 1-Hydroxypropane-1,2,3-tricarboxylic acid
1-Hydroxytricarballylic acid
Isocitrate
Isocitric acid
icit