Feedback

maleamate

Properties
MNX_IDMNXM902
formulaC4H4NO3
charge-1
mass114.0795
referencechebi:16146
Image of MNXM902
InChIKeyFSQQTNAZHBEJLS-UPHRSURJSA-M
InChIInChI=1S/C4H5NO3/c5-3(6)1-2-4(7)8/h1-2H,(H2,5,6)(H,7,8)/p-1/b2-1-
SMILESNC(=O)\C=C/C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref7
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
chebi:16146 maleamate
(2Z)-4-amino-4-oxobut-2-enoate
keggC:C01596
sabiorkM:5688
Maleamate
Maleamic acid
seedM:cpd01123 Maleamate
(Z)-4-amino-4-oxo-but-2-enoate
2-Butenoic acid, 4-amino-4-oxo- (Z)-
Maleamic acid
maleamate
maleamic acid
maleic acid monoamide
malm
chebi:29045 maleamic acid
(2Z)-4-amino-4-oxobut-2-enoic acid
(Z)-3-carbamoyl acrylic acid
(Z)-4-amino-4-oxo-2-butenoic acid
Maleamic acid
maleic monoamide
metacycM:MALEAMATE maleamate
(Z)-4-amino-4-oxo-but-2-enoate
maleamic acid
maleic acid monoamide
biggM:M_malm
chebi:14557
chebi:14558
chebi:25116
chebi:25117
chebi:6652
keggC:M_C01596
seedM:M_cpd01123
secondary/obsolete/fantasy identifier
biggM:malm
envipath:...9c9e8c694711
Maleamate