Feedback

maleamate

PropertiesImageOccurences in reactions
MNX_IDMNXM902Image of MNXM902
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 4
formulaC4H4NO3
charge-1
mass114.01967
referencechebi:16146
InChIKeyFSQQTNAZHBEJLS-UPHRSURJSA-M
InChIInChI=1S/C4H5NO3/c5-3(6)1-2-4(7)8/h1-2H,(H2,5,6)(H,7,8)/p-1/b2-1-
SMILESNC(=O)/C=C\C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16146
chebi:16146
maleamate
(2Z)-4-amino-4-oxobut-2-enoate
bigg.metabolite:malm
biggM:malm
envipath:...9c9e8c694711
envipathM:...9c9e8c694711
Maleamate
seed.compound:cpd01123
seedM:cpd01123
Maleamate
(Z)-4-amino-4-oxo-but-2-enoate
2-Butenoic acid, 4-amino-4-oxo- (Z)-
Maleamic acid
maleamate
maleamic acid
maleic acid monoamide
malm
sabiork.compound:5688
sabiorkM:5688
kegg.compound:C01596
keggC:C01596
Maleamate
Maleamic acid
metacyc.compound:MALEAMATE
metacycM:MALEAMATE
maleamate
(Z)-4-amino-4-oxo-but-2-enoate
maleamic acid
maleic acid monoamide
CHEBI:29045
chebi:29045
maleamic acid
(2Z)-4-amino-4-oxobut-2-enoic acid
(Z)-3-carbamoyl acrylic acid
(Z)-4-amino-4-oxo-2-butenoic acid
Maleamic acid
maleic monoamide
chebi:14557
chebi:14558
chebi:25116
chebi:25117
chebi:6652
biggM:M_malm
keggC:M_C01596
seedM:M_cpd01123
secondary/obsolete/fantasy identifier