Feedback

 

(2S,3S)-2-methylcitrate

Image of MNXM90279
Properties
MNX_IDMNXM90279
formulaC7H7O7
charge-3
mass203.1279
referencechebi:58853
InChIKeyYNOXCRMFGMSKIJ-NFNCENRGSA-K
InChIInChI=1S/C7H10O7/c1-3(5(10)11)7(14,6(12)13)2-4(8)9/h3,14H,2H2,1H3,(H,8,9)(H,10,11)(H,12,13)/p-3/t3-,7+/m1/s1
SMILESC[C@H](C([O-])=O)[C@@](O)(CC([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (2S,3S)-2-methylcitrate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:2mcit 2-Methylcitrate
chebi:10860 (2R, 3S)-2-Hydroxybutane-1,2,3-tricarboxylate
(2R,3S)-2-hydroxybutane-1,2,3-tricarboxylate
(2R,3S)-2-methylcitrate(3-)
YNOXCRMFGMSKIJ-WVBDSBKLSA-K
chebi:11592
chebi:11618
chebi:15598
chebi:19630
chebi:19695
2-Hydroxybutane-1,2,3-tricarboxylate
2-Methylcitrate
2-hydroxybutane-1,2,3-tricarboxylate
2-methylcitrate(3-)
YNOXCRMFGMSKIJ-UHFFFAOYSA-K
chebi:1203
chebi:19696
chebi:30835
2-hydroxy-1,2,3-butanetricarboxylic acid
2-hydroxybutane-1,2,3-tricarboxylic acid
2-methylcitric acid
3-C-carboxy-2,4-dideoxy-2-methylpentaric acid
YNOXCRMFGMSKIJ-UHFFFAOYSA-N
chebi:30836 (2R,3S)-2-Hydroxybutane-1,2,3-tricarboxylate
(2R,3S)-2-hydroxybutane-1,2,3-tricarboxylic acid
(2R,3S)-2-methylcitric acid
3-C-carboxy-2,4-dideoxy-2-methyl-D-threo-pentaric acid
YNOXCRMFGMSKIJ-WVBDSBKLSA-N
chebi:50948 (2S,3S)-2-hydroxybutane-1,2,3-tricarboxylic acid
(2S,3S)-2-methylcitric acid
3-C-carboxy-2,4-dideoxy-4-methyl-D-erythro-pentaric acid
YNOXCRMFGMSKIJ-NFNCENRGSA-N
chebi:58853 (1S,2S)-2-hydroxy-1-methylpropane-1,2,3-tricarboxylate
(2S,3S)-2-hydroxybutane-1,2,3-tricarboxylate
(2S,3S)-2-methylcitrate
(2S,3S)-2-methylcitrate(3-)
3-C-carboxylato-2,4-dideoxy-4-methyl-D-erythro-pentarate
YNOXCRMFGMSKIJ-NFNCENRGSA-K
hmdb:HMDB00379
hmdb:HMDB03610
2-Methylcitric acid
2-hydroxy-1-methylpropane-1,2,3-tricarboxylic acid
methylcitric acid
kegg:C02225 (2S,3S)-2-Hydroxybutane-1,2,3-tricarboxylate
(2S,3S)-2-Methylcitrate
2-Hydroxybutane-1,2,3-tricarboxylate
2-Methylcitrate
lipidmaps:LMFA01050442 (2R, 3S)-2-Hydroxybutane-1,2,3-tricarboxylate
(2R,3S)-2-hydroxybutane-1,2,3-tricarboxylic acid;3-C-carboxy-2,4-dideoxy-2-methyl-D-threo-pentaric acid
(2R,3S)-2-methylcitric acid
2-Hydroxybutane-1,2,3-tricarboxylate
2-Methylcitrate
lipidmaps:LMFA01050442
metacyc:CPD-622 (2S,3S)-2-hydroxybutane-1,2,3-tricarboxylate
(2S,3S)-2-methylcitrate
CPD-622
sabiork:2387 (2R, 3S)-2-Hydroxybutane-1,2,3-tricarboxylate
2-Hydroxybutane-1,2,3-tricarboxylate
2-Methylcitrate
seed:cpd01501 (2R,3S)-2-Hydroxybutane-1,2,3-tricarboxylate
2-Hydroxybutane-1,2,3-tricarboxylate
2-Methylcitrate
2-methyl-citrate
2mcit
seed:cpd24620 (2S,3S)-2-hydroxybutane-1,2,3-tricarboxylate
(2S,3S)-2-methylcitrate
deprecated:MNXM1030
deprecated:MNXM9861