Feedback

Delta(1)-piperideine-2-carboxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM911Image of MNXM911
#reac
in my sandbox 0
in MNXref (generic)8
in models (compartimentalized) 5
formulaC6H9NO2
charge0
mass127.1412
referencechebi:77631
InChIKeyGEJXSVNGWOSZPC-UHFFFAOYSA-N
InChIInChI=1S/C6H9NO2/c8-6(9)5-3-1-2-4-7-5/h1-4H2,(H,8,9)
SMILES[O-]C(=O)C1=[NH+]CCCC1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:77631
chebi:77631
Delta(1)-piperideine-2-carboxylate
1-piperideine-2-carboxylic acid zwitterion
3,4,5,6-tetrahydropyridinium-2-carboxylate
hmdb:HMDB0062778 1-piperideine-2-carboxylate
1,2-Didehydropiperidine-2-carboxylate
1,2-Didehydropiperidine-2-carboxylic acid
1-P-2-CA
3,4,5,6-tetrahydropyridine-2-carboxylic acid
D-1-Piperideine-2-carboxylate
Delta(1)-Piperidine-2-carboxylic acid
Delta1-Piperideine-2-carboxylate
delta 1-Piperideine-2-carboxylate
delta(1)-Piperideine-2-carboxylate
delta(1)-Piperidine-2-carboxylate
delta(1)-piperidine-2-carboxylate
delta(1)-piperidine-2-carboxylic acid
metacyc.compound:DELTA1-PIPERIDEINE-2-CARBOXYLATE
metacycM:DELTA1-PIPERIDEINE-2-CARBOXYLATE
1-piperideine-2-carboxylate
1,2-didehydropiperidine-2-carboxylate
Delta1-piperideine-2-carboxylate
CHEBI:16187
chebi:16187
1-piperideine-2-carboxylate
3,4,5,6-tetrahydropyridine-2-carboxylate
CHEBI:30912
chebi:30912
1-piperideine-2-carboxylic acid
1,2-Didehydropiperidine-2-carboxylate
3,4,5,6-tetrahydropyridine-2-carboxylic acid
Delta(1)-piperidine-2-carboxylic acid
hmdb:HMDB0001084 D-1-Piperideine-2-carboxylic acid
1,2-Didehydropiperidine-2-carboxylate
1,2-Didehydropiperidine-2-carboxylic acid
1-P-2-CA
1-piperideine-2-carboxylate
3,4,5,6-tetrahydropyridine-2-carboxylic acid
D-1-Piperideine-2-carboxylate
Delta(1)-Piperidine-2-carboxylic acid
Delta1-Piperideine-2-carboxylate
delta 1-Piperideine-2-carboxylate
delta(1)-Piperideine-2-carboxylate
delta(1)-Piperidine-2-carboxylate
delta(1)-piperidine-2-carboxylate
delta(1)-piperidine-2-carboxylic acid
bigg.metabolite:1pipdn2c
biggM:1pipdn2c
Delta1-Piperideine-2-carboxylate
kegg.compound:C04092
keggC:C04092
Delta1-Piperideine-2-carboxylate
1,2-Didehydropiperidine-2-carboxylate
1-Piperideine-2-carboxylate
sabiork.compound:7071
sabiorkM:7071
delta1-Piperideine-2-carboxylate
seed.compound:cpd00922
seedM:cpd00922
delta1-Piperideine-2-carboxylate
1,2-Didehydropiperidine-2-carboxylate
1,2-didehydropiperidine-2-carboxylate
1-piperideine-2-carboxylate
1pipdn2c
delta1-piperideine-2-carboxylate
hmdb:HMDB01084
hmdb:HMDB62778
chebi:10539
chebi:11153
chebi:12278
chebi:18885
chebi:18886
chebi:23601
chebi:500
biggM:M_1pipdn2c
keggC:M_C04092
seedM:M_cpd00922
secondary/obsolete/fantasy identifier